data_bmse010294 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010294 _Entry.Title lignin_cw_compound_2015 _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2011-07-19 _Entry.Last_release_date 2012-02-24 _Entry.Original_release_date 2011-07-19 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.21 _Entry.Original_NMR_STAR_version 3.1.0.46 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name lignin_cw_compound_2015 loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 Sally Ralph ? ? bmse010294 2 Stephane Quideau ? ? bmse010294 3 John Ralph ? ? bmse010294 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010294 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 3 bmse010294 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 90 bmse010294 "1H chemical shifts" 4 bmse010294 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2011-07-19 2009-05-26 original Author "Original spectra from USDA" bmse010294 2 2011-09-07 2011-09-07 update BMRB "Ensured correct reference IDs" bmse010294 3 2011-09-09 2011-09-09 update BMRB "Brought up to date with latest Dictionary" bmse010294 4 2011-12-08 2011-12-08 update BMRB "Changing chemcomp name from Guaiacylglycerol-A,B-bis-coniferyl ether for database consistency" bmse010294 5 2011-12-14 2011-12-14 update BMRB "Set Assembly.Name to match Chem_comp.name" bmse010294 6 2011-12-16 2011-12-16 update BMRB "Standardized solvent" bmse010294 7 2012-02-24 2012-02-24 update BMRB "Set Raw_data_flag to no, since there are no raw data" bmse010294 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010294 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type Internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010294 1 2 John Ralph ? ? ? bmse010294 1 3 Larry Landucci ? L. ? bmse010294 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010294 _Assembly.ID 1 _Assembly.Name lignin_cw_compound_2015 _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 $lignin_cw_compound_2015 1 $lignin_cw_compound_2015 yes native no no ? ? ? bmse010294 1 stop_ save_ save_lignin_cw_compound_2015 _Entity.Sf_category entity _Entity.Sf_framecode lignin_cw_compound_2015 _Entity.Entry_ID bmse010294 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name 'Guaiacylglycerol-A,B-bis-coniferyl ether' _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010294 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010294 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $lignin_cw_compound_2015 . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010294 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010294 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $lignin_cw_compound_2015 . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010294 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010294 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name lignin_cw_compound_2015 _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C30H34O9/c1-35-26-18-22(10-11-23(26)34)30(39-25-13-9-21(7-5-15-32)17-28(25)37-3)29(19-33)38-24-12-8-20(6-4-14-31)16-27(24)36-2/h4-13,16-18,29-34H,14-15,19H2,1-3H3/b6-4+,7-5+/t29-,30+/m0/s1 ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C30 H34 O9' _Chem_comp.Formula_weight 538.58556 _Chem_comp.Formula_mono_iso_wt_nat 538.2202826903 _Chem_comp.Formula_mono_iso_wt_13C 568.3209278243 _Chem_comp.Formula_mono_iso_wt_15N 538.2202826903 _Chem_comp.Formula_mono_iso_wt_13C_15N 568.3209278243 _Chem_comp.Image_file_name standards/lignin_cw_compound_2015/lit/jr_2015.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/lignin_cw_compound_2015/lit/jr_2015.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID "Guaiacylglycerol-A,B-bis-coniferyl ether" synonym bmse010294 1 4-{3-Hydroxy-1,2-bis-[4-(3-hydroxypropenyl)-2-methoxyphenoxy]propyl}-2-methoxyphenol synonym bmse010294 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID "Guaiacylglycerol-A,B-bis-coniferyl ether" Beilstein bmse010294 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical COC1=C(C=CC(=C1)[C@H]([C@H](CO)OC2=C(C=C(C=CCO)C=C2)OC)OC3=C(C=C(C=CCO)C=C3)OC)O bmse010294 1 Isomeric COC1=C(C=CC(=C1)[C@H]([C@H](CO)OC2=C(C=C(C=CCO)C=C2)OC)OC3=C(C=C(C=CCO)C=C3)OC)O bmse010294 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 A3OMe C ? ? ? ? 122.5792 70.0000 ? ? ? bmse010294 1 C2 B3OMe C ? ? ? ? 344.2816 102.0000 ? ? ? bmse010294 1 C3 C3OMe C ? ? ? ? 94.8672 214.0000 ? ? ? bmse010294 1 C4 BB C ? ? ? ? 399.7088 198.0000 ? ? ? bmse010294 1 C5 CB C ? ? ? ? 150.2944 310.0000 ? ? ? bmse010294 1 C6 BA C ? ? ? ? 371.9968 214.0000 ? ? ? bmse010294 1 C7 CA C ? ? ? ? 178.0064 294.0000 ? ? ? bmse010294 1 C8 B6 C ? ? ? ? 316.5696 214.0000 ? ? ? bmse010294 1 C9 C6 C ? ? ? ? 205.7184 246.0000 ? ? ? bmse010294 1 C10 A6 C ? ? ? ? 233.4304 102.0000 ? ? ? bmse010294 1 C11 A5 C ? ? ? ? 233.4304 70.0000 ? ? ? bmse010294 1 C12 B5 C ? ? ? ? 288.8576 198.0000 ? ? ? bmse010294 1 C13 C5 C ? ? ? ? 205.7184 214.0000 ? ? ? bmse010294 1 C14 BG C ? ? ? ? 427.4208 214.0000 ? ? ? bmse010294 1 C15 CG C ? ? ? ? 150.2944 342.0000 ? ? ? bmse010294 1 C16 B2 C ? ? ? ? 344.2816 166.0000 ? ? ? bmse010294 1 C17 C2 C ? ? ? ? 150.2944 246.0000 ? ? ? bmse010294 1 C18 A2 C ? ? ? ? 178.0064 102.0000 ? ? ? bmse010294 1 C19 G C ? ? ? ? 233.4304 198.0000 ? ? ? bmse010294 1 C20 B1 C ? ? ? ? 344.2816 198.0000 ? ? ? bmse010294 1 C21 C1 C ? ? ? ? 178.0064 262.0000 ? ? ? bmse010294 1 C22 A1 C ? ? ? ? 205.7184 118.0000 ? ? ? bmse010294 1 C23 A4 C ? ? ? ? 205.7184 54.0000 ? ? ? bmse010294 1 C24 B4 C ? ? ? ? 288.8576 166.0000 ? ? ? bmse010294 1 C25 C4 C ? ? ? ? 178.0064 198.0000 ? ? ? bmse010294 1 C26 A3 C ? ? ? ? 178.0064 70.0000 ? ? ? bmse010294 1 C27 B3 C ? ? ? ? 316.5696 150.0000 ? ? ? bmse010294 1 C28 C3 C ? ? ? ? 150.2944 214.0000 ? ? ? bmse010294 1 C29 B C ? ? ? ? 233.4304 166.0000 ? ? ? bmse010294 1 C30 A C ? ? ? ? 205.7184 150.0000 ? ? ? bmse010294 1 O31 ? O ? ? ? ? 455.1328 198.0000 ? ? ? bmse010294 1 O32 ? O ? ? ? ? 122.5792 358.0000 ? ? ? bmse010294 1 O33 ? O ? ? ? ? 261.1456 214.0000 ? ? ? bmse010294 1 O34 ? O ? ? ? ? 205.7184 22.0000 ? ? ? bmse010294 1 O35 ? O ? ? ? ? 150.2944 54.0000 ? ? ? bmse010294 1 O36 ? O ? ? ? ? 316.5696 118.0000 ? ? ? bmse010294 1 O37 ? O ? ? ? ? 122.5792 198.0000 ? ? ? bmse010294 1 O38 ? O ? ? ? ? 261.1456 150.0000 ? ? ? bmse010294 1 O39 ? O ? ? ? ? 178.0064 166.0000 ? ? ? bmse010294 1 H40 ? H ? ? ? ? 132.4986 87.1823 ? ? ? bmse010294 1 H41 ? H ? ? ? ? 105.3969 79.9194 ? ? ? bmse010294 1 H42 ? H ? ? ? ? 112.6598 52.8177 ? ? ? bmse010294 1 H43 ? H ? ? ? ? 334.3614 84.8182 ? ? ? bmse010294 1 H44 ? H ? ? ? ? 361.4634 92.0798 ? ? ? bmse010294 1 H45 ? H ? ? ? ? 354.2018 119.1818 ? ? ? bmse010294 1 H46 ? H ? ? ? ? 104.7874 231.1818 ? ? ? bmse010294 1 H47 ? H ? ? ? ? 77.6854 223.9202 ? ? ? bmse010294 1 H48 ? H ? ? ? ? 84.9470 196.8182 ? ? ? bmse010294 1 H49 ? H ? ? ? ? 399.7088 178.1600 ? ? ? bmse010294 1 H50 ? H ? ? ? ? 133.1124 300.0801 ? ? ? bmse010294 1 H51 ? H ? ? ? ? 371.9973 233.8400 ? ? ? bmse010294 1 H52 ? H ? ? ? ? 195.1884 303.9199 ? ? ? bmse010294 1 H53 ? H ? ? ? ? 316.5696 233.8400 ? ? ? bmse010294 1 H54 ? H ? ? ? ? 222.9004 255.9199 ? ? ? bmse010294 1 H55 ? H ? ? ? ? 250.6124 111.9199 ? ? ? bmse010294 1 H56 ? H ? ? ? ? 250.6124 60.0801 ? ? ? bmse010294 1 H57 ? H ? ? ? ? 271.6756 207.9199 ? ? ? bmse010294 1 H58 ? H ? ? ? ? 222.9004 204.0801 ? ? ? bmse010294 1 H59 ? H ? ? ? ? 440.1738 229.1983 ? ? ? bmse010294 1 H60 ? H ? ? ? ? 414.6678 229.1983 ? ? ? bmse010294 1 H61 ? H ? ? ? ? 169.8330 338.5551 ? ? ? bmse010294 1 H62 ? H ? ? ? ? 157.0796 360.6437 ? ? ? bmse010294 1 H63 ? H ? ? ? ? 361.4636 156.0801 ? ? ? bmse010294 1 H64 ? H ? ? ? ? 133.1124 255.9199 ? ? ? bmse010294 1 H65 ? H ? ? ? ? 160.8244 111.9199 ? ? ? bmse010294 1 H66 AG1 H ? ? ? ? 226.6452 216.6437 ? ? ? bmse010294 1 H67 AG2 H ? ? ? ? 213.8918 194.5551 ? ? ? bmse010294 1 H68 AB H ? ? ? ? 233.4309 146.1600 ? ? ? bmse010294 1 H69 AA H ? ? ? ? 188.5364 140.0801 ? ? ? bmse010294 1 H70 ? H ? ? ? ? 455.1326 178.1600 ? ? ? bmse010294 1 H71 ? H ? ? ? ? 122.5785 377.8400 ? ? ? bmse010294 1 H72 ? H ? ? ? ? 278.3272 204.0794 ? ? ? bmse010294 1 H73 ? H ? ? ? ? 188.5365 12.0800 ? ? ? bmse010294 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010294 1 C2 C2 BMRB bmse010294 1 C3 C3 BMRB bmse010294 1 C4 C4 BMRB bmse010294 1 C5 C5 BMRB bmse010294 1 C6 C6 BMRB bmse010294 1 C7 C7 BMRB bmse010294 1 C8 C8 BMRB bmse010294 1 C9 C9 BMRB bmse010294 1 C10 C10 BMRB bmse010294 1 C11 C11 BMRB bmse010294 1 C12 C12 BMRB bmse010294 1 C13 C13 BMRB bmse010294 1 C14 C14 BMRB bmse010294 1 C15 C15 BMRB bmse010294 1 C16 C16 BMRB bmse010294 1 C17 C17 BMRB bmse010294 1 C18 C18 BMRB bmse010294 1 C19 C19 BMRB bmse010294 1 C20 C20 BMRB bmse010294 1 C21 C21 BMRB bmse010294 1 C22 C22 BMRB bmse010294 1 C23 C23 BMRB bmse010294 1 C24 C24 BMRB bmse010294 1 C25 C25 BMRB bmse010294 1 C26 C26 BMRB bmse010294 1 C27 C27 BMRB bmse010294 1 C28 C28 BMRB bmse010294 1 C29 C29 BMRB bmse010294 1 C30 C30 BMRB bmse010294 1 O31 O31 BMRB bmse010294 1 O32 O32 BMRB bmse010294 1 O33 O33 BMRB bmse010294 1 O34 O34 BMRB bmse010294 1 O35 O35 BMRB bmse010294 1 O36 O36 BMRB bmse010294 1 O37 O37 BMRB bmse010294 1 O38 O38 BMRB bmse010294 1 O39 O39 BMRB bmse010294 1 H40 H40 BMRB bmse010294 1 H41 H41 BMRB bmse010294 1 H42 H42 BMRB bmse010294 1 H43 H43 BMRB bmse010294 1 H44 H44 BMRB bmse010294 1 H45 H45 BMRB bmse010294 1 H46 H46 BMRB bmse010294 1 H47 H47 BMRB bmse010294 1 H48 H48 BMRB bmse010294 1 H49 H49 BMRB bmse010294 1 H50 H50 BMRB bmse010294 1 H51 H51 BMRB bmse010294 1 H52 H52 BMRB bmse010294 1 H53 H53 BMRB bmse010294 1 H54 H54 BMRB bmse010294 1 H55 H55 BMRB bmse010294 1 H56 H56 BMRB bmse010294 1 H57 H57 BMRB bmse010294 1 H58 H58 BMRB bmse010294 1 H59 H59 BMRB bmse010294 1 H60 H60 BMRB bmse010294 1 H61 H61 BMRB bmse010294 1 H62 H62 BMRB bmse010294 1 H63 H63 BMRB bmse010294 1 H64 H64 BMRB bmse010294 1 H65 H65 BMRB bmse010294 1 H66 H66 BMRB bmse010294 1 H67 H67 BMRB bmse010294 1 H68 H68 BMRB bmse010294 1 H69 H69 BMRB bmse010294 1 H70 H70 BMRB bmse010294 1 H71 H71 BMRB bmse010294 1 H72 H72 BMRB bmse010294 1 H73 H73 BMRB bmse010294 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 O35 ? bmse010294 1 2 covalent SING C2 O36 ? bmse010294 1 3 covalent SING C3 O37 ? bmse010294 1 4 covalent DOUB C4 C6 ? bmse010294 1 5 covalent SING C4 C14 ? bmse010294 1 6 covalent DOUB C5 C7 ? bmse010294 1 7 covalent SING C5 C15 ? bmse010294 1 8 covalent SING C6 C20 ? bmse010294 1 9 covalent SING C7 C21 ? bmse010294 1 10 covalent DOUB C8 C12 ? bmse010294 1 11 covalent SING C8 C20 ? bmse010294 1 12 covalent DOUB C9 C13 ? bmse010294 1 13 covalent SING C9 C21 ? bmse010294 1 14 covalent DOUB C10 C11 ? bmse010294 1 15 covalent SING C10 C22 ? bmse010294 1 16 covalent SING C11 C23 ? bmse010294 1 17 covalent SING C12 C24 ? bmse010294 1 18 covalent SING C13 C25 ? bmse010294 1 19 covalent SING C14 O31 ? bmse010294 1 20 covalent SING C15 O32 ? bmse010294 1 21 covalent DOUB C16 C20 ? bmse010294 1 22 covalent SING C16 C27 ? bmse010294 1 23 covalent DOUB C17 C21 ? bmse010294 1 24 covalent SING C17 C28 ? bmse010294 1 25 covalent DOUB C18 C22 ? bmse010294 1 26 covalent SING C18 C26 ? bmse010294 1 27 covalent SING C19 C29 ? bmse010294 1 28 covalent SING C19 O33 ? bmse010294 1 29 covalent SING C22 C30 ? bmse010294 1 30 covalent DOUB C23 C26 ? bmse010294 1 31 covalent SING C23 O34 ? bmse010294 1 32 covalent DOUB C24 C27 ? bmse010294 1 33 covalent SING C24 O38 ? bmse010294 1 34 covalent DOUB C25 C28 ? bmse010294 1 35 covalent SING C25 O39 ? bmse010294 1 36 covalent SING C26 O35 ? bmse010294 1 37 covalent SING C27 O36 ? bmse010294 1 38 covalent SING C28 O37 ? bmse010294 1 39 covalent SING C29 C30 ? bmse010294 1 40 covalent SING C29 O38 ? bmse010294 1 41 covalent SING C30 O39 ? bmse010294 1 42 covalent SING C1 H40 ? bmse010294 1 43 covalent SING C1 H41 ? bmse010294 1 44 covalent SING C1 H42 ? bmse010294 1 45 covalent SING C2 H43 ? bmse010294 1 46 covalent SING C2 H44 ? bmse010294 1 47 covalent SING C2 H45 ? bmse010294 1 48 covalent SING C3 H46 ? bmse010294 1 49 covalent SING C3 H47 ? bmse010294 1 50 covalent SING C3 H48 ? bmse010294 1 51 covalent SING C4 H49 ? bmse010294 1 52 covalent SING C5 H50 ? bmse010294 1 53 covalent SING C6 H51 ? bmse010294 1 54 covalent SING C7 H52 ? bmse010294 1 55 covalent SING C8 H53 ? bmse010294 1 56 covalent SING C9 H54 ? bmse010294 1 57 covalent SING C10 H55 ? bmse010294 1 58 covalent SING C11 H56 ? bmse010294 1 59 covalent SING C12 H57 ? bmse010294 1 60 covalent SING C13 H58 ? bmse010294 1 61 covalent SING C14 H59 ? bmse010294 1 62 covalent SING C14 H60 ? bmse010294 1 63 covalent SING C15 H61 ? bmse010294 1 64 covalent SING C15 H62 ? bmse010294 1 65 covalent SING C16 H63 ? bmse010294 1 66 covalent SING C17 H64 ? bmse010294 1 67 covalent SING C18 H65 ? bmse010294 1 68 covalent SING C19 H66 ? bmse010294 1 69 covalent SING C19 H67 ? bmse010294 1 70 covalent SING C29 H68 ? bmse010294 1 71 covalent SING C30 H69 ? bmse010294 1 72 covalent SING O31 H70 ? bmse010294 1 73 covalent SING O32 H71 ? bmse010294 1 74 covalent SING O33 H72 ? bmse010294 1 75 covalent SING O34 H73 ? bmse010294 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID yes USDA_NMR_database 2015 "Compound Number" ? lignin_cw_compound_2015 ? "matching entry" ? bmse010294 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010294 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010294 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_2015 "natural abundance" 1 $lignin_cw_compound_2015 ? Solute Saturated ? ? 1 ? "Stephane Quideau" "Guaiacylglycerol-A,B-bis-coniferyl ether" n/a bmse010294 1 2 CDCl3 ? 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010294 1 stop_ save_ save_sample_2 _Sample.Sf_category sample _Sample.Sf_framecode sample_2 _Sample.Entry_ID bmse010294 _Sample.ID 2 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_2015 "natural abundance" 1 $lignin_cw_compound_2015 ? Solute Saturated ? ? 1 ? "Stephane Quideau" "Guaiacylglycerol-A,B-bis-coniferyl ether" n/a bmse010294 2 2 acetone "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010294 2 stop_ save_ save_sample_3 _Sample.Sf_category sample _Sample.Sf_framecode sample_3 _Sample.Entry_ID bmse010294 _Sample.ID 3 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_2015 "natural abundance" 1 $lignin_cw_compound_2015 ? Solute Saturated ? ? 1 ? "Stephane Quideau" "Guaiacylglycerol-A,B-bis-coniferyl ether" n/a bmse010294 3 2 DMSO "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010294 3 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010294 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010294 1 temperature 297 ? K bmse010294 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010294 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010294 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010294 1 stop_ save_ save_Bruker_360 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_360 _NMR_spectrometer.Entry_ID bmse010294 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model DRX _NMR_spectrometer.Field_strength 360 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010294 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 13C" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010294 1 2 "1D 1H" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010294 1 3 "1D 13C" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010294 1 4 "1D 13C" no ? ? 3 $sample_3 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010294 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010294 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 CDCl3 "residual solvent proton" ppm 7.24 internal direct 1.000000000 ? ? ? bmse010294 1 C 13 CDCl3 "solvent carbon" ppm 77.00 internal direct ? ? ? ? bmse010294 1 stop_ save_ save_chem_shift_reference_2 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_2 _Chem_shift_reference.Entry_ID bmse010294 _Chem_shift_reference.ID 2 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010294 2 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010294 2 stop_ save_ save_chem_shift_reference_3 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_3 _Chem_shift_reference.Entry_ID bmse010294 _Chem_shift_reference.ID 3 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 DMSO-d6 "residual solvent methyl proton" ppm 2.49 internal direct 1.000000000 ? ? ? bmse010294 3 C 13 DMSO-d6 "solvent methyl carbon" ppm 39.50 internal direct ? ? ? ? bmse010294 3 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010294 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 13C" 1 $sample_1 bmse010294 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010294 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_asym_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.PDB_record_ID _Atom_chem_shift.PDB_model_num _Atom_chem_shift.PDB_strand_ID _Atom_chem_shift.PDB_ins_code _Atom_chem_shift.PDB_residue_no _Atom_chem_shift.PDB_residue_name _Atom_chem_shift.PDB_atom_name _Atom_chem_shift.Original_PDB_strand_ID _Atom_chem_shift.Original_PDB_residue_no _Atom_chem_shift.Original_PDB_residue_name _Atom_chem_shift.Original_PDB_atom_name _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 55.76 ? ? 1 ? ? ? ? ? ? A3OMe ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 2 ? 1 1 1 1 1 C2 C 13 55.85 ? ? 1 ? ? ? ? ? ? B3OMe ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 3 ? 1 1 1 1 1 C3 C 13 55.93 ? ? 1 ? ? ? ? ? ? C3OMe ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 4 ? 1 1 1 1 1 C19 C 13 62.17 ? ? 1 ? ? ? ? ? ? G ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 5 ? 1 1 1 1 1 C14 C 13 63.56 ? ? 1 ? ? ? ? ? ? BG ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 6 ? 1 1 1 1 1 C15 C 13 63.63 ? ? 1 ? ? ? ? ? ? CG ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 7 ? 1 1 1 1 1 C30 C 13 81.68 ? ? 1 ? ? ? ? ? ? A ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 8 ? 1 1 1 1 1 C29 C 13 85.42 ? ? 1 ? ? ? ? ? ? B ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 9 ? 1 1 1 1 1 C17 C 13 109.38 ? ? 1 ? ? ? ? ? ? C2 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 10 ? 1 1 1 1 1 C16 C 13 109.54 ? ? 1 ? ? ? ? ? ? B2 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 11 ? 1 1 1 1 1 C18 C 13 109.77 ? ? 1 ? ? ? ? ? ? A2 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 12 ? 1 1 1 1 1 C11 C 13 114.26 ? ? 1 ? ? ? ? ? ? A5 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 13 ? 1 1 1 1 1 C13 C 13 115.94 ? ? 1 ? ? ? ? ? ? C5 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 14 ? 1 1 1 1 1 C12 C 13 119.13 ? ? 1 ? ? ? ? ? ? B5 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 15 ? 1 1 1 1 1 C9 C 13 119.49 ? ? 1 ? ? ? ? ? ? C6 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 16 ? 1 1 1 1 1 C8 C 13 119.74 ? ? 1 ? ? ? ? ? ? B6 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 17 ? 1 1 1 1 1 C10 C 13 120.33 ? ? 1 ? ? ? ? ? ? A6 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 18 ? 1 1 1 1 1 C5 C 13 127.10 ? ? 1 ? ? ? ? ? ? CB ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 19 ? 1 1 1 1 1 C4 C 13 127.60 ? ? 1 ? ? ? ? ? ? BB ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 20 ? 1 1 1 1 1 C6 C 13 130.59 ? ? 1 ? ? ? ? ? ? BA ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 21 ? 1 1 1 1 1 C7 C 13 130.79 ? ? 1 ? ? ? ? ? ? CA ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 22 ? 1 1 1 1 1 C22 C 13 130.43 ? ? 1 ? ? ? ? ? ? A1 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 23 ? 1 1 1 1 1 C21 C 13 130.85 ? ? 1 ? ? ? ? ? ? C1 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 24 ? 1 1 1 1 1 C20 C 13 132.09 ? ? 1 ? ? ? ? ? ? B1 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 25 ? 1 1 1 1 1 C23 C 13 145.49 ? ? 1 ? ? ? ? ? ? A4 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 26 ? 1 1 1 1 1 C25 C 13 146.64 ? ? 1 ? ? ? ? ? ? C4 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 27 ? 1 1 1 1 1 C26 C 13 146.85 ? ? 1 ? ? ? ? ? ? A3 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 28 ? 1 1 1 1 1 C24 C 13 147.08 ? ? 1 ? ? ? ? ? ? B4 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 29 ? 1 1 1 1 1 C28 C 13 149.80 ? ? 1 ? ? ? ? ? ? C3 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 30 ? 1 1 1 1 1 C27 C 13 150.81 ? ? 1 ? ? ? ? ? ? B3 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 1 stop_ save_ save_assigned_chemical_shifts_2 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_2 _Assigned_chem_shift_list.Entry_ID bmse010294 _Assigned_chem_shift_list.ID 2 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 2 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_2 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 2 "1D 1H" 2 $sample_2 bmse010294 2 3 "1D 13C" 2 $sample_2 bmse010294 2 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010294 2 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_asym_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.PDB_record_ID _Atom_chem_shift.PDB_model_num _Atom_chem_shift.PDB_strand_ID _Atom_chem_shift.PDB_ins_code _Atom_chem_shift.PDB_residue_no _Atom_chem_shift.PDB_residue_name _Atom_chem_shift.PDB_atom_name _Atom_chem_shift.Original_PDB_strand_ID _Atom_chem_shift.Original_PDB_residue_no _Atom_chem_shift.Original_PDB_residue_name _Atom_chem_shift.Original_PDB_atom_name _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 56.18 ? ? 1 ? ? ? ? ? ? A3OMe ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 2 ? 1 1 1 1 1 C2 C 13 56.20 ? ? 1 ? ? ? ? ? ? B3OMe ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 3 ? 1 1 1 1 1 C3 C 13 56.32 ? ? 1 ? ? ? ? ? ? C3OMe ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 4 ? 1 1 1 1 1 C19 C 13 61.75 ? ? 1 ? ? ? ? ? ? G ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 5 ? 1 1 1 1 1 C14 C 13 63.25 ? ? 1 ? ? ? ? ? ? BG ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 6 ? 1 1 1 1 1 C15 C 13 63.25 ? ? 1 ? ? ? ? ? ? CG ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 7 ? 1 1 1 1 1 C30 C 13 81.15 ? ? 1 ? ? ? ? ? ? A ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 8 ? 1 1 1 1 1 C29 C 13 85.31 ? ? 1 ? ? ? ? ? ? B ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 9 ? 1 1 1 1 1 C17 C 13 110.74 ? ? 1 ? ? ? ? ? ? C2 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 10 ? 1 1 1 1 1 C16 C 13 110.93 ? ? 1 ? ? ? ? ? ? B2 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 11 ? 1 1 1 1 1 C18 C 13 112.11 ? ? 1 ? ? ? ? ? ? A2 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 12 ? 1 1 1 1 1 C11 C 13 115.23 ? ? 1 ? ? ? ? ? ? A5 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 13 ? 1 1 1 1 1 C13 C 13 117.02 ? ? 1 ? ? ? ? ? ? C5 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 14 ? 1 1 1 1 1 C12 C 13 119.04 ? ? 1 ? ? ? ? ? ? B5 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 15 ? 1 1 1 1 1 C9 C 13 119.90 ? ? 1 ? ? ? ? ? ? C6 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 16 ? 1 1 1 1 1 C8 C 13 120.15 ? ? 1 ? ? ? ? ? ? B6 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 17 ? 1 1 1 1 1 C10 C 13 121.49 ? ? 1 ? ? ? ? ? ? A6 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 18 ? 1 1 1 1 1 C5 C 13 129.22 ? ? 1 ? ? ? ? ? ? CB ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 19 ? 1 1 1 1 1 C4 C 13 129.45 ? ? 1 ? ? ? ? ? ? BB ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 20 ? 1 1 1 1 1 C6 C 13 129.85 ? ? 1 ? ? ? ? ? ? BA ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 21 ? 1 1 1 1 1 C7 C 13 129.85 ? ? 1 ? ? ? ? ? ? CA ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 22 ? 1 1 1 1 1 C22 C 13 130.39 ? ? 1 ? ? ? ? ? ? A1 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 23 ? 1 1 1 1 1 C21 C 13 132.05 ? ? 1 ? ? ? ? ? ? C1 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 24 ? 1 1 1 1 1 C20 C 13 132.74 ? ? 1 ? ? ? ? ? ? B1 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 25 ? 1 1 1 1 1 C23 C 13 147.18 ? ? 1 ? ? ? ? ? ? A4 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 26 ? 1 1 1 1 1 C25 C 13 147.77 ? ? 1 ? ? ? ? ? ? C4 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 27 ? 1 1 1 1 1 C26 C 13 148.10 ? ? 1 ? ? ? ? ? ? A3 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 28 ? 1 1 1 1 1 C24 C 13 148.61 ? ? 1 ? ? ? ? ? ? B4 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 29 ? 1 1 1 1 1 C28 C 13 151.17 ? ? 1 ? ? ? ? ? ? C3 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 30 ? 1 1 1 1 1 C27 C 13 151.71 ? ? 1 ? ? ? ? ? ? B3 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 31 ? 1 1 1 1 1 H69 H 1 5.46 ? ? 1 ? ? ? ? ? ? AA ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 32 ? 1 1 1 1 1 H68 H 1 4.56 ? ? 1 ? ? ? ? ? ? AB ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 33 ? 1 1 1 1 1 H66 H 1 3.81 ? ? 1 ? ? ? ? ? ? AG1 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 34 ? 1 1 1 1 1 H67 H 1 3.93 ? ? 1 ? ? ? ? ? ? AG2 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 2 stop_ save_ save_assigned_chemical_shifts_3 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_3 _Assigned_chem_shift_list.Entry_ID bmse010294 _Assigned_chem_shift_list.ID 3 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 3 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_3 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 4 "1D 13C" 3 $sample_3 bmse010294 3 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010294 3 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_asym_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.PDB_record_ID _Atom_chem_shift.PDB_model_num _Atom_chem_shift.PDB_strand_ID _Atom_chem_shift.PDB_ins_code _Atom_chem_shift.PDB_residue_no _Atom_chem_shift.PDB_residue_name _Atom_chem_shift.PDB_atom_name _Atom_chem_shift.Original_PDB_strand_ID _Atom_chem_shift.Original_PDB_residue_no _Atom_chem_shift.Original_PDB_residue_name _Atom_chem_shift.Original_PDB_atom_name _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 55.41 ? ? 1 ? ? ? ? ? ? A3OMe ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 2 ? 1 1 1 1 1 C2 C 13 55.61 ? ? 1 ? ? ? ? ? ? B3OMe ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 3 ? 1 1 1 1 1 C3 C 13 55.80 ? ? 1 ? ? ? ? ? ? C3OMe ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 4 ? 1 1 1 1 1 C19 C 13 59.74 ? ? 1 ? ? ? ? ? ? G ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 5 ? 1 1 1 1 1 C14 C 13 61.52 ? ? 1 ? ? ? ? ? ? BG ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 6 ? 1 1 1 1 1 C15 C 13 61.58 ? ? 1 ? ? ? ? ? ? CG ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 7 ? 1 1 1 1 1 C30 C 13 79.01 ? ? 1 ? ? ? ? ? ? A ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 8 ? 1 1 1 1 1 C29 C 13 82.53 ? ? 1 ? ? ? ? ? ? B ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 9 ? 1 1 1 1 1 C17 C 13 109.93 ? ? 1 ? ? ? ? ? ? C2 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 10 ? 1 1 1 1 1 C16 C 13 109.93 ? ? 1 ? ? ? ? ? ? B2 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 11 ? 1 1 1 1 1 C18 C 13 111.91 ? ? 1 ? ? ? ? ? ? A2 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 12 ? 1 1 1 1 1 C11 C 13 114.74 ? ? 1 ? ? ? ? ? ? A5 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 13 ? 1 1 1 1 1 C13 C 13 115.71 ? ? 1 ? ? ? ? ? ? C5 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 14 ? 1 1 1 1 1 C12 C 13 116.15 ? ? 1 ? ? ? ? ? ? B5 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 15 ? 1 1 1 1 1 C9 C 13 118.87 ? ? 1 ? ? ? ? ? ? C6 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 16 ? 1 1 1 1 1 C8 C 13 119.00 ? ? 1 ? ? ? ? ? ? B6 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 17 ? 1 1 1 1 1 C10 C 13 120.34 ? ? 1 ? ? ? ? ? ? A6 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 18 ? 1 1 1 1 1 C5 C 13 128.32 ? ? 1 ? ? ? ? ? ? CB ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 19 ? 1 1 1 1 1 C4 C 13 128.47 ? ? 1 ? ? ? ? ? ? BB ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 20 ? 1 1 1 1 1 C6 C 13 130.49 ? ? 1 ? ? ? ? ? ? BA ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 21 ? 1 1 1 1 1 C7 C 13 130.49 ? ? 1 ? ? ? ? ? ? CA ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 22 ? 1 1 1 1 1 C22 C 13 128.24 ? ? 1 ? ? ? ? ? ? A1 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 23 ? 1 1 1 1 1 C21 C 13 128.71 ? ? 1 ? ? ? ? ? ? C1 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 24 ? 1 1 1 1 1 C20 C 13 128.82 ? ? 1 ? ? ? ? ? ? B1 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 25 ? 1 1 1 1 1 C23 C 13 146.07 ? ? 1 ? ? ? ? ? ? A4 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 26 ? 1 1 1 1 1 C25 C 13 146.27 ? ? 1 ? ? ? ? ? ? C4 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 27 ? 1 1 1 1 1 C26 C 13 147.11 ? ? 1 ? ? ? ? ? ? A3 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 28 ? 1 1 1 1 1 C24 C 13 147.36 ? ? 1 ? ? ? ? ? ? B4 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 29 ? 1 1 1 1 1 C28 C 13 149.73 ? ? 1 ? ? ? ? ? ? C3 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 30 ? 1 1 1 1 1 C27 C 13 149.80 ? ? 1 ? ? ? ? ? ? B3 ? ? ? ? ? ? ? ? ? ? ? ? bmse010294 3 stop_ save_