data_bmse010328 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010328 _Entry.Title lignin_cw_compound_2080 _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2011-07-19 _Entry.Last_release_date 2012-02-24 _Entry.Original_release_date 2011-07-19 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.21 _Entry.Original_NMR_STAR_version 3.1.0.46 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name lignin_cw_compound_2080 loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 Sally Ralph ? ? bmse010328 2 Stephane Quideau ? ? bmse010328 3 John Ralph ? ? bmse010328 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010328 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 1 bmse010328 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 32 bmse010328 "1H chemical shifts" 33 bmse010328 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2011-07-19 2009-05-26 original Author "Original spectra from USDA" bmse010328 2 2011-09-07 2011-09-07 update BMRB "Ensured correct reference IDs" bmse010328 3 2011-09-09 2011-09-09 update BMRB "Brought up to date with latest Dictionary" bmse010328 4 2011-12-14 2011-12-14 update BMRB "Set Assembly.Name to match Chem_comp.name" bmse010328 5 2011-12-16 2011-12-16 update BMRB "Standardized solvent" bmse010328 6 2012-02-24 2012-02-24 update BMRB "Set Raw_data_flag to no, since there are no raw data" bmse010328 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010328 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type Internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010328 1 2 John Ralph ? ? ? bmse010328 1 3 Larry Landucci ? L. ? bmse010328 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010328 _Assembly.ID 1 _Assembly.Name lignin_cw_compound_2080 _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 $lignin_cw_compound_2080 1 $lignin_cw_compound_2080 yes native no no ? ? ? bmse010328 1 stop_ save_ save_lignin_cw_compound_2080 _Entity.Sf_category entity _Entity.Sf_framecode lignin_cw_compound_2080 _Entity.Entry_ID bmse010328 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name lignin_cw_compound_2080 _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010328 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010328 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $lignin_cw_compound_2080 . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010328 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010328 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $lignin_cw_compound_2080 . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010328 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010328 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name lignin_cw_compound_2080 _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C32H34O12/c1-19(33)42-23-13-10-21(11-14-23)12-15-29(35)41-18-28(44-31-24(37-3)8-7-9-25(31)38-4)30(36)22-16-26(39-5)32(43-20(2)34)27(17-22)40-6/h7-17,28,30,36H,18H2,1-6H3/b15-12+/t28-,30+/m1/s1 ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C32 H34 O12' _Chem_comp.Formula_weight 610.60516 _Chem_comp.Formula_mono_iso_wt_nat 610.2050265566 _Chem_comp.Formula_mono_iso_wt_13C 642.3123813662 _Chem_comp.Formula_mono_iso_wt_15N 610.2050265566 _Chem_comp.Formula_mono_iso_wt_13C_15N 642.3123813662 _Chem_comp.Image_file_name standards/lignin_cw_compound_2080/lit/jr_2080.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/lignin_cw_compound_2080/lit/jr_2080.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID Unnamed synonym bmse010328 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID "To be defined" Beilstein bmse010328 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical CC(=O)OC1=CC=C(C=C1)C=CC(=O)OC[C@H]([C@H](C2=CC(=C(C(=C2)OC)OC(C)=O)OC)O)OC3=C(C=CC=C3OC)OC bmse010328 1 Isomeric CC(=O)OC1=CC=C(C=C1)C=CC(=O)OC[C@H]([C@H](C2=CC(=C(C(=C2)OC)OC(C)=O)OC)O)OC3=C(C=CC=C3OC)OC bmse010328 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 AcMe C ? ? ? ? 67.1536 107.1040 ? ? ? bmse010328 1 C2 AcMe C ? ? ? ? 427.4192 347.1040 ? ? ? bmse010328 1 C3 BOMe C ? ? ? ? 466.5360 106.4352 ? ? ? bmse010328 1 C4 BOMe C ? ? ? ? 310.2896 49.5616 ? ? ? bmse010328 1 C5 AOMe C ? ? ? ? 316.5680 251.1040 ? ? ? bmse010328 1 C6 AOMe C ? ? ? ? 482.8464 251.1040 ? ? ? bmse010328 1 C7 B1 C ? ? ? ? 404.8272 32.8960 ? ? ? bmse010328 1 C8 B2 C ? ? ? ? 425.3968 57.4080 ? ? ? bmse010328 1 C9 B6 C ? ? ? ? 373.3136 38.4512 ? ? ? bmse010328 1 C10 C2 C ? ? ? ? 178.0048 171.1040 ? ? ? bmse010328 1 C11 C6 C ? ? ? ? 205.7168 123.1040 ? ? ? bmse010328 1 C12 CA C ? ? ? ? 233.4320 171.1040 ? ? ? bmse010328 1 C13 C3 C ? ? ? ? 150.2928 155.1040 ? ? ? bmse010328 1 C14 C5 C ? ? ? ? 178.0048 107.1040 ? ? ? bmse010328 1 C15 CB C ? ? ? ? 261.1440 155.1040 ? ? ? bmse010328 1 C16 A2 C ? ? ? ? 371.9952 219.1040 ? ? ? bmse010328 1 C17 A6 C ? ? ? ? 427.4192 219.1040 ? ? ? bmse010328 1 C18 G C ? ? ? ? 344.2832 171.1040 ? ? ? bmse010328 1 C19 AcC=O C ? ? ? ? 94.8656 123.1040 ? ? ? bmse010328 1 C20 AcC=O C ? ? ? ? 427.4192 315.1040 ? ? ? bmse010328 1 C21 C1 C ? ? ? ? 205.7168 155.1040 ? ? ? bmse010328 1 C22 A1 C ? ? ? ? 399.7072 203.1040 ? ? ? bmse010328 1 C23 C4 C ? ? ? ? 150.2928 123.1040 ? ? ? bmse010328 1 C24 B3 C ? ? ? ? 414.4528 87.4784 ? ? ? bmse010328 1 C25 B5 C ? ? ? ? 362.3696 68.5216 ? ? ? bmse010328 1 C26 A3 C ? ? ? ? 371.9952 251.1040 ? ? ? bmse010328 1 C27 A5 C ? ? ? ? 427.4192 251.1040 ? ? ? bmse010328 1 C28 B C ? ? ? ? 371.9952 155.1040 ? ? ? bmse010328 1 C29 CG C ? ? ? ? 288.8560 171.1040 ? ? ? bmse010328 1 C30 A C ? ? ? ? 399.7072 171.1040 ? ? ? bmse010328 1 C31 B4 C ? ? ? ? 382.9392 93.0336 ? ? ? bmse010328 1 C32 A4 C ? ? ? ? 399.7072 267.1040 ? ? ? bmse010328 1 O33 ? O ? ? ? ? 94.8656 155.1040 ? ? ? bmse010328 1 O34 ? O ? ? ? ? 455.1344 299.1040 ? ? ? bmse010328 1 O35 ? O ? ? ? ? 288.8560 203.1040 ? ? ? bmse010328 1 O36 ? O ? ? ? ? 427.4192 155.1040 ? ? ? bmse010328 1 O37 ? O ? ? ? ? 435.0224 111.9904 ? ? ? bmse010328 1 O38 ? O ? ? ? ? 330.8592 74.0768 ? ? ? bmse010328 1 O39 ? O ? ? ? ? 344.2832 267.1040 ? ? ? bmse010328 1 O40 ? O ? ? ? ? 455.1344 267.1040 ? ? ? bmse010328 1 O41 ? O ? ? ? ? 316.5680 155.1040 ? ? ? bmse010328 1 O42 ? O ? ? ? ? 122.5808 107.1040 ? ? ? bmse010328 1 O43 ? O ? ? ? ? 399.7072 299.1040 ? ? ? bmse010328 1 O44 ? O ? ? ? ? 371.9952 123.1040 ? ? ? bmse010328 1 H45 AcMe H ? ? ? ? 57.2334 124.2858 ? ? ? bmse010328 1 H46 AcMe H ? ? ? ? 49.9718 97.1838 ? ? ? bmse010328 1 H47 AcMe H ? ? ? ? 77.0738 89.9222 ? ? ? bmse010328 1 H48 AcMe H ? ? ? ? 447.2592 347.1040 ? ? ? bmse010328 1 H49 AcMe H ? ? ? ? 427.4192 366.9440 ? ? ? bmse010328 1 H50 AcMe H ? ? ? ? 407.5792 347.1040 ? ? ? bmse010328 1 H51 BOMe H ? ? ? ? 463.0917 86.8965 ? ? ? bmse010328 1 H52 BOMe H ? ? ? ? 486.0748 102.9909 ? ? ? bmse010328 1 H53 BOMe H ? ? ? ? 469.9803 125.9739 ? ? ? bmse010328 1 H54 BOMe H ? ? ? ? 295.0909 62.3141 ? ? ? bmse010328 1 H55 BOMe H ? ? ? ? 297.5371 34.3629 ? ? ? bmse010328 1 H56 BOMe H ? ? ? ? 325.4883 36.8091 ? ? ? bmse010328 1 H57 AOMe H ? ? ? ? 306.6487 268.2863 ? ? ? bmse010328 1 H58 AOMe H ? ? ? ? 299.3857 241.1846 ? ? ? bmse010328 1 H59 AOMe H ? ? ? ? 326.4873 233.9217 ? ? ? bmse010328 1 H60 AOMe H ? ? ? ? 472.9262 233.9222 ? ? ? bmse010328 1 H61 AOMe H ? ? ? ? 500.0282 241.1838 ? ? ? bmse010328 1 H62 AOMe H ? ? ? ? 492.7666 268.2858 ? ? ? bmse010328 1 H63 B1 H ? ? ? ? 411.6130 14.2525 ? ? ? bmse010328 1 H64 B2 H ? ? ? ? 444.9353 53.9622 ? ? ? bmse010328 1 H65 B6 H ? ? ? ? 360.5609 23.2527 ? ? ? bmse010328 1 H66 C2 H ? ? ? ? 178.0048 190.9440 ? ? ? bmse010328 1 H67 C6 H ? ? ? ? 222.8988 113.1841 ? ? ? bmse010328 1 H68 CA H ? ? ? ? 233.4325 190.9440 ? ? ? bmse010328 1 H69 C3 H ? ? ? ? 133.1108 165.0239 ? ? ? bmse010328 1 H70 C5 H ? ? ? ? 178.0048 87.2640 ? ? ? bmse010328 1 H71 CB H ? ? ? ? 261.1440 135.2640 ? ? ? bmse010328 1 H72 A2 H ? ? ? ? 354.8132 209.1841 ? ? ? bmse010328 1 H73 A6 H ? ? ? ? 444.6012 209.1841 ? ? ? bmse010328 1 H74 G1 H ? ? ? ? 357.0364 186.3021 ? ? ? bmse010328 1 H75 G2 H ? ? ? ? 331.5307 186.3027 ? ? ? bmse010328 1 H76 B H ? ? ? ? 389.1772 145.1841 ? ? ? bmse010328 1 H77 ? H ? ? ? ? 416.8892 181.0239 ? ? ? bmse010328 1 H78 ? H ? ? ? ? 427.4189 135.2640 ? ? ? bmse010328 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010328 1 C2 C2 BMRB bmse010328 1 C3 C3 BMRB bmse010328 1 C4 C4 BMRB bmse010328 1 C5 C5 BMRB bmse010328 1 C6 C6 BMRB bmse010328 1 C7 C7 BMRB bmse010328 1 C8 C8 BMRB bmse010328 1 C9 C9 BMRB bmse010328 1 C10 C10 BMRB bmse010328 1 C11 C11 BMRB bmse010328 1 C12 C12 BMRB bmse010328 1 C13 C13 BMRB bmse010328 1 C14 C14 BMRB bmse010328 1 C15 C15 BMRB bmse010328 1 C16 C16 BMRB bmse010328 1 C17 C17 BMRB bmse010328 1 C18 C18 BMRB bmse010328 1 C19 C19 BMRB bmse010328 1 C20 C20 BMRB bmse010328 1 C21 C21 BMRB bmse010328 1 C22 C22 BMRB bmse010328 1 C23 C23 BMRB bmse010328 1 C24 C24 BMRB bmse010328 1 C25 C25 BMRB bmse010328 1 C26 C26 BMRB bmse010328 1 C27 C27 BMRB bmse010328 1 C28 C28 BMRB bmse010328 1 C29 C29 BMRB bmse010328 1 C30 C30 BMRB bmse010328 1 C31 C31 BMRB bmse010328 1 C32 C32 BMRB bmse010328 1 O33 O33 BMRB bmse010328 1 O34 O34 BMRB bmse010328 1 O35 O35 BMRB bmse010328 1 O36 O36 BMRB bmse010328 1 O37 O37 BMRB bmse010328 1 O38 O38 BMRB bmse010328 1 O39 O39 BMRB bmse010328 1 O40 O40 BMRB bmse010328 1 O41 O41 BMRB bmse010328 1 O42 O42 BMRB bmse010328 1 O43 O43 BMRB bmse010328 1 O44 O44 BMRB bmse010328 1 H45 H45 BMRB bmse010328 1 H46 H46 BMRB bmse010328 1 H47 H47 BMRB bmse010328 1 H48 H48 BMRB bmse010328 1 H49 H49 BMRB bmse010328 1 H50 H50 BMRB bmse010328 1 H51 H51 BMRB bmse010328 1 H52 H52 BMRB bmse010328 1 H53 H53 BMRB bmse010328 1 H54 H54 BMRB bmse010328 1 H55 H55 BMRB bmse010328 1 H56 H56 BMRB bmse010328 1 H57 H57 BMRB bmse010328 1 H58 H58 BMRB bmse010328 1 H59 H59 BMRB bmse010328 1 H60 H60 BMRB bmse010328 1 H61 H61 BMRB bmse010328 1 H62 H62 BMRB bmse010328 1 H63 H63 BMRB bmse010328 1 H64 H64 BMRB bmse010328 1 H65 H65 BMRB bmse010328 1 H66 H66 BMRB bmse010328 1 H67 H67 BMRB bmse010328 1 H68 H68 BMRB bmse010328 1 H69 H69 BMRB bmse010328 1 H70 H70 BMRB bmse010328 1 H71 H71 BMRB bmse010328 1 H72 H72 BMRB bmse010328 1 H73 H73 BMRB bmse010328 1 H74 H74 BMRB bmse010328 1 H75 H75 BMRB bmse010328 1 H76 H76 BMRB bmse010328 1 H77 H77 BMRB bmse010328 1 H78 H78 BMRB bmse010328 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C19 ? bmse010328 1 2 covalent SING C2 C20 ? bmse010328 1 3 covalent SING C3 O37 ? bmse010328 1 4 covalent SING C4 O38 ? bmse010328 1 5 covalent SING C5 O39 ? bmse010328 1 6 covalent SING C6 O40 ? bmse010328 1 7 covalent DOUB C7 C8 ? bmse010328 1 8 covalent SING C7 C9 ? bmse010328 1 9 covalent SING C8 C24 ? bmse010328 1 10 covalent DOUB C9 C25 ? bmse010328 1 11 covalent SING C10 C13 ? bmse010328 1 12 covalent DOUB C10 C21 ? bmse010328 1 13 covalent DOUB C11 C14 ? bmse010328 1 14 covalent SING C11 C21 ? bmse010328 1 15 covalent DOUB C12 C15 ? bmse010328 1 16 covalent SING C12 C21 ? bmse010328 1 17 covalent DOUB C13 C23 ? bmse010328 1 18 covalent SING C14 C23 ? bmse010328 1 19 covalent SING C15 C29 ? bmse010328 1 20 covalent DOUB C16 C22 ? bmse010328 1 21 covalent SING C16 C26 ? bmse010328 1 22 covalent SING C17 C22 ? bmse010328 1 23 covalent DOUB C17 C27 ? bmse010328 1 24 covalent SING C18 C28 ? bmse010328 1 25 covalent SING C18 O41 ? bmse010328 1 26 covalent DOUB C19 O33 ? bmse010328 1 27 covalent SING C19 O42 ? bmse010328 1 28 covalent DOUB C20 O34 ? bmse010328 1 29 covalent SING C20 O43 ? bmse010328 1 30 covalent SING C22 C30 ? bmse010328 1 31 covalent SING C23 O42 ? bmse010328 1 32 covalent DOUB C24 C31 ? bmse010328 1 33 covalent SING C24 O37 ? bmse010328 1 34 covalent SING C25 C31 ? bmse010328 1 35 covalent SING C25 O38 ? bmse010328 1 36 covalent DOUB C26 C32 ? bmse010328 1 37 covalent SING C26 O39 ? bmse010328 1 38 covalent SING C27 C32 ? bmse010328 1 39 covalent SING C27 O40 ? bmse010328 1 40 covalent SING C28 C30 ? bmse010328 1 41 covalent SING C28 O44 ? bmse010328 1 42 covalent DOUB C29 O35 ? bmse010328 1 43 covalent SING C29 O41 ? bmse010328 1 44 covalent SING C30 O36 ? bmse010328 1 45 covalent SING C31 O44 ? bmse010328 1 46 covalent SING C32 O43 ? bmse010328 1 47 covalent SING C1 H45 ? bmse010328 1 48 covalent SING C1 H46 ? bmse010328 1 49 covalent SING C1 H47 ? bmse010328 1 50 covalent SING C2 H48 ? bmse010328 1 51 covalent SING C2 H49 ? bmse010328 1 52 covalent SING C2 H50 ? bmse010328 1 53 covalent SING C3 H51 ? bmse010328 1 54 covalent SING C3 H52 ? bmse010328 1 55 covalent SING C3 H53 ? bmse010328 1 56 covalent SING C4 H54 ? bmse010328 1 57 covalent SING C4 H55 ? bmse010328 1 58 covalent SING C4 H56 ? bmse010328 1 59 covalent SING C5 H57 ? bmse010328 1 60 covalent SING C5 H58 ? bmse010328 1 61 covalent SING C5 H59 ? bmse010328 1 62 covalent SING C6 H60 ? bmse010328 1 63 covalent SING C6 H61 ? bmse010328 1 64 covalent SING C6 H62 ? bmse010328 1 65 covalent SING C7 H63 ? bmse010328 1 66 covalent SING C8 H64 ? bmse010328 1 67 covalent SING C9 H65 ? bmse010328 1 68 covalent SING C10 H66 ? bmse010328 1 69 covalent SING C11 H67 ? bmse010328 1 70 covalent SING C12 H68 ? bmse010328 1 71 covalent SING C13 H69 ? bmse010328 1 72 covalent SING C14 H70 ? bmse010328 1 73 covalent SING C15 H71 ? bmse010328 1 74 covalent SING C16 H72 ? bmse010328 1 75 covalent SING C17 H73 ? bmse010328 1 76 covalent SING C18 H74 ? bmse010328 1 77 covalent SING C18 H75 ? bmse010328 1 78 covalent SING C28 H76 ? bmse010328 1 79 covalent SING C30 H77 ? bmse010328 1 80 covalent SING O36 H78 ? bmse010328 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID yes USDA_NMR_database 2080 "Compound Number" ? lignin_cw_compound_2080 ? "matching entry" ? bmse010328 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010328 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010328 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_2080 "natural abundance" 1 $lignin_cw_compound_2080 ? Solute Saturated ? ? 1 ? "Stephane Quideau" lignin_cw_compound_2080 n/a bmse010328 1 2 acetone "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010328 1 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010328 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010328 1 temperature 297 ? K bmse010328 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010328 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010328 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010328 1 stop_ save_ save_Bruker_360 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_360 _NMR_spectrometer.Entry_ID bmse010328 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model DRX _NMR_spectrometer.Field_strength 360 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010328 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 1H" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010328 1 2 "1D 13C" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010328 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010328 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010328 1 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010328 1 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010328 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 1H" 1 $sample_1 bmse010328 1 2 "1D 13C" 1 $sample_1 bmse010328 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010328 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 20.26 ? ? 4 ? ? ? ? ? AcMe ? bmse010328 1 2 ? 1 1 1 1 1 C2 C 13 20.94 ? ? 4 ? ? ? ? ? AcMe ? bmse010328 1 3 ? 1 1 1 1 1 C5 C 13 56.38 ? ? 1 ? ? ? ? ? AOMe ? bmse010328 1 4 ? 1 1 1 1 1 C6 C 13 56.38 ? ? 1 ? ? ? ? ? AOMe ? bmse010328 1 5 ? 1 1 1 1 1 C3 C 13 56.48 ? ? 1 ? ? ? ? ? BOMe ? bmse010328 1 6 ? 1 1 1 1 1 C4 C 13 56.48 ? ? 1 ? ? ? ? ? BOMe ? bmse010328 1 7 ? 1 1 1 1 1 C18 C 13 63.67 ? ? 1 ? ? ? ? ? G ? bmse010328 1 8 ? 1 1 1 1 1 C30 C 13 73.30 ? ? 1 ? ? ? ? ? A ? bmse010328 1 9 ? 1 1 1 1 1 C28 C 13 84.07 ? ? 1 ? ? ? ? ? B ? bmse010328 1 10 ? 1 1 1 1 1 C16 C 13 103.76 ? ? 1 ? ? ? ? ? A2 ? bmse010328 1 11 ? 1 1 1 1 1 C17 C 13 103.76 ? ? 1 ? ? ? ? ? A6 ? bmse010328 1 12 ? 1 1 1 1 1 C8 C 13 106.31 ? ? 1 ? ? ? ? ? B2 ? bmse010328 1 13 ? 1 1 1 1 1 C9 C 13 106.31 ? ? 1 ? ? ? ? ? B6 ? bmse010328 1 14 ? 1 1 1 1 1 C15 C 13 119.10 ? ? 1 ? ? ? ? ? CB ? bmse010328 1 15 ? 1 1 1 1 1 C13 C 13 123.16 ? ? 1 ? ? ? ? ? C3 ? bmse010328 1 16 ? 1 1 1 1 1 C14 C 13 123.16 ? ? 1 ? ? ? ? ? C5 ? bmse010328 1 17 ? 1 1 1 1 1 C7 C 13 124.83 ? ? 1 ? ? ? ? ? B1 ? bmse010328 1 18 ? 1 1 1 1 1 C32 C 13 128.69 ? ? 1 ? ? ? ? ? A4 ? bmse010328 1 19 ? 1 1 1 1 1 C10 C 13 130.11 ? ? 1 ? ? ? ? ? C2 ? bmse010328 1 20 ? 1 1 1 1 1 C11 C 13 130.11 ? ? 1 ? ? ? ? ? C6 ? bmse010328 1 21 ? 1 1 1 1 1 C21 C 13 132.93 ? ? 1 ? ? ? ? ? C1 ? bmse010328 1 22 ? 1 1 1 1 1 C31 C 13 136.57 ? ? 1 ? ? ? ? ? B4 ? bmse010328 1 23 ? 1 1 1 1 1 C22 C 13 140.05 ? ? 1 ? ? ? ? ? A1 ? bmse010328 1 24 ? 1 1 1 1 1 C12 C 13 144.00 ? ? 1 ? ? ? ? ? CA ? bmse010328 1 25 ? 1 1 1 1 1 C26 C 13 152.94 ? ? 1 ? ? ? ? ? A3 ? bmse010328 1 26 ? 1 1 1 1 1 C27 C 13 152.94 ? ? 1 ? ? ? ? ? A5 ? bmse010328 1 27 ? 1 1 1 1 1 C23 C 13 153.36 ? ? 1 ? ? ? ? ? C4 ? bmse010328 1 28 ? 1 1 1 1 1 C24 C 13 154.51 ? ? 1 ? ? ? ? ? B3 ? bmse010328 1 29 ? 1 1 1 1 1 C25 C 13 154.51 ? ? 1 ? ? ? ? ? B5 ? bmse010328 1 30 ? 1 1 1 1 1 C29 C 13 166.71 ? ? 1 ? ? ? ? ? CG ? bmse010328 1 31 ? 1 1 1 1 1 C19 C 13 168.59 ? ? 4 ? ? ? ? ? AcC=O ? bmse010328 1 32 ? 1 1 1 1 1 C20 C 13 169.45 ? ? 4 ? ? ? ? ? AcC=O ? bmse010328 1 33 ? 1 1 1 1 1 H45 H 1 2.19 ? ? 4 ? ? ? ? ? AcMe ? bmse010328 1 34 ? 1 1 1 1 1 H46 H 1 2.19 ? ? 4 ? ? ? ? ? AcMe ? bmse010328 1 35 ? 1 1 1 1 1 H47 H 1 2.19 ? ? 4 ? ? ? ? ? AcMe ? bmse010328 1 36 ? 1 1 1 1 1 H48 H 1 2.26 ? ? 4 ? ? ? ? ? AcMe ? bmse010328 1 37 ? 1 1 1 1 1 H49 H 1 2.26 ? ? 4 ? ? ? ? ? AcMe ? bmse010328 1 38 ? 1 1 1 1 1 H50 H 1 2.26 ? ? 4 ? ? ? ? ? AcMe ? bmse010328 1 39 ? 1 1 1 1 1 H57 H 1 3.78 ? ? 1 ? ? ? ? ? AOMe ? bmse010328 1 40 ? 1 1 1 1 1 H58 H 1 3.78 ? ? 1 ? ? ? ? ? AOMe ? bmse010328 1 41 ? 1 1 1 1 1 H59 H 1 3.78 ? ? 1 ? ? ? ? ? AOMe ? bmse010328 1 42 ? 1 1 1 1 1 H60 H 1 3.78 ? ? 1 ? ? ? ? ? AOMe ? bmse010328 1 43 ? 1 1 1 1 1 H61 H 1 3.78 ? ? 1 ? ? ? ? ? AOMe ? bmse010328 1 44 ? 1 1 1 1 1 H62 H 1 3.78 ? ? 1 ? ? ? ? ? AOMe ? bmse010328 1 45 ? 1 1 1 1 1 H51 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010328 1 46 ? 1 1 1 1 1 H52 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010328 1 47 ? 1 1 1 1 1 H53 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010328 1 48 ? 1 1 1 1 1 H54 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010328 1 49 ? 1 1 1 1 1 H55 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010328 1 50 ? 1 1 1 1 1 H56 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010328 1 51 ? 1 1 1 1 1 H74 H 1 4.30 ? ? 1 ? ? ? ? ? G1 ? bmse010328 1 52 ? 1 1 1 1 1 H75 H 1 4.51 ? ? 1 ? ? ? ? ? G2 ? bmse010328 1 53 ? 1 1 1 1 1 H76 H 1 4.62 ? ? 1 ? ? ? ? ? B ? bmse010328 1 54 ? 1 1 1 1 1 H73 H 1 5.05 ? ? 1 ? ? ? ? ? A ? bmse010328 1 55 ? 1 1 1 1 1 H71 H 1 6.34 ? ? 1 ? ? ? ? ? CB ? bmse010328 1 56 ? 1 1 1 1 1 H64 H 1 6.09 ? ? 1 ? ? ? ? ? B2 ? bmse010328 1 57 ? 1 1 1 1 1 H65 H 1 6.09 ? ? 1 ? ? ? ? ? B6 ? bmse010328 1 58 ? 1 1 1 1 1 H72 H 1 6.82 ? ? 1 ? ? ? ? ? A2 ? bmse010328 1 59 ? 1 1 1 1 1 H73 H 1 6.82 ? ? 1 ? ? ? ? ? A6 ? bmse010328 1 60 ? 1 1 1 1 1 H63 H 1 7.03 ? ? 1 ? ? ? ? ? B1 ? bmse010328 1 61 ? 1 1 1 1 1 H69 H 1 7.17 ? ? 1 ? ? ? ? ? C3 ? bmse010328 1 62 ? 1 1 1 1 1 H70 H 1 7.17 ? ? 1 ? ? ? ? ? C5 ? bmse010328 1 63 ? 1 1 1 1 1 H68 H 1 7.44 ? ? 1 ? ? ? ? ? CA ? bmse010328 1 64 ? 1 1 1 1 1 H66 H 1 7.66 ? ? 1 ? ? ? ? ? C2 ? bmse010328 1 65 ? 1 1 1 1 1 H67 H 1 7.66 ? ? 1 ? ? ? ? ? C6 ? bmse010328 1 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 1 bmse010328 1 1 2 bmse010328 1 2 31 bmse010328 1 2 32 bmse010328 1 3 33 bmse010328 1 3 34 bmse010328 1 3 35 bmse010328 1 3 36 bmse010328 1 3 37 bmse010328 1 3 38 bmse010328 1 stop_ save_