data_bmse010335 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010335 _Entry.Title lignin_cw_compound_3006 _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2011-07-19 _Entry.Last_release_date 2012-02-24 _Entry.Original_release_date 2011-07-19 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.21 _Entry.Original_NMR_STAR_version 3.1.0.46 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name lignin_cw_compound_3006 loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 Sally Ralph ? ? bmse010335 2 Liming Zhang ? ? bmse010335 3 John Ralph ? ? bmse010335 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010335 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 1 bmse010335 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 25 bmse010335 "1H chemical shifts" 28 bmse010335 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2011-07-19 2009-05-26 original Author "Original spectra from USDA" bmse010335 2 2011-09-07 2011-09-07 update BMRB "Ensured correct reference IDs" bmse010335 3 2011-09-09 2011-09-09 update BMRB "Brought up to date with latest Dictionary" bmse010335 4 2011-12-08 2011-12-08 update BMRB ; Changing chemcomp name from Acetic acid3-acetoxy-2,3-bis-(4-acetoxy-3-methoxyphenyl)propyl ester for database consistency ; bmse010335 5 2011-12-14 2011-12-14 update BMRB "Set Assembly.Name to match Chem_comp.name" bmse010335 6 2011-12-16 2011-12-16 update BMRB "Standardized solvent" bmse010335 7 2012-02-24 2012-02-24 update BMRB "Set Raw_data_flag to no, since there are no raw data" bmse010335 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010335 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type Internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010335 1 2 John Ralph ? ? ? bmse010335 1 3 Larry Landucci ? L. ? bmse010335 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010335 _Assembly.ID 1 _Assembly.Name lignin_cw_compound_3006 _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 $lignin_cw_compound_3006 1 $lignin_cw_compound_3006 yes native no no ? ? ? bmse010335 1 stop_ save_ save_lignin_cw_compound_3006 _Entity.Sf_category entity _Entity.Sf_framecode lignin_cw_compound_3006 _Entity.Entry_ID bmse010335 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name 'Acetic acid3-acetoxy-2,3-bis-(4-acetoxy-3-methoxyphenyl)propyl ester' _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010335 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010335 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $lignin_cw_compound_3006 . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010335 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010335 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $lignin_cw_compound_3006 . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010335 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010335 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name lignin_cw_compound_3006 _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C25H28O10/c1-14(26)32-13-20(18-7-9-21(33-15(2)27)23(11-18)30-5)25(35-17(4)29)19-8-10-22(34-16(3)28)24(12-19)31-6/h7-12,20,25H,13H2,1-6H3 ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C25 H28 O10' _Chem_comp.Formula_weight 488.48382 _Chem_comp.Formula_mono_iso_wt_nat 488.1682471198 _Chem_comp.Formula_mono_iso_wt_13C 513.2521180648 _Chem_comp.Formula_mono_iso_wt_15N 488.1682471198 _Chem_comp.Formula_mono_iso_wt_13C_15N 513.2521180648 _Chem_comp.Image_file_name standards/lignin_cw_compound_3006/lit/jr_3006.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/lignin_cw_compound_3006/lit/jr_3006.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID "Acetic acid3-acetoxy-2,3-bis-(4-acetoxy-3-methoxyphenyl)propyl ester" synonym bmse010335 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID "Acetic acid3-acetoxy-2,3-bis-(4-acetoxy-3-methoxyphenyl)propyl ester" Beilstein bmse010335 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical CC(=O)OCC(C1=CC(=C(C=C1)OC(C)=O)OC)C(C2=CC(=C(C=C2)OC(C)=O)OC)OC(C)=O bmse010335 1 Isomeric CC(=O)OCC(C1=CC(=C(C=C1)OC(C)=O)OC)C(C2=CC(=C(C=C2)OC(C)=O)OC)OC(C)=O bmse010335 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 AcMe C ? ? ? ? 385.8512 198.0000 ? ? ? bmse010335 1 C2 AcMe C ? ? ? ? 302.7120 374.0000 ? ? ? bmse010335 1 C3 AcMe C ? ? ? ? 275.0000 6.0000 ? ? ? bmse010335 1 C4 AcMe C ? ? ? ? 164.1488 198.0000 ? ? ? bmse010335 1 C5 OMe C ? ? ? ? 219.5760 326.0000 ? ? ? bmse010335 1 C6 OMe C ? ? ? ? 164.1488 102.0000 ? ? ? bmse010335 1 C7 B6 C ? ? ? ? 302.7120 246.0000 ? ? ? bmse010335 1 C8 A6 C ? ? ? ? 275.0000 134.0000 ? ? ? bmse010335 1 C9 B5 C ? ? ? ? 302.7120 278.0000 ? ? ? bmse010335 1 C10 A5 C ? ? ? ? 275.0000 102.0000 ? ? ? bmse010335 1 C11 B2 C ? ? ? ? 247.2880 246.0000 ? ? ? bmse010335 1 C12 A2 C ? ? ? ? 219.5760 134.0000 ? ? ? bmse010335 1 C13 G C ? ? ? ? 302.7120 182.0000 ? ? ? bmse010335 1 C14 GAcC=O C ? ? ? ? 358.1392 182.0000 ? ? ? bmse010335 1 C15 AcC=O C ? ? ? ? 302.7120 342.0000 ? ? ? bmse010335 1 C16 AcC=O C ? ? ? ? 275.0000 38.0000 ? ? ? bmse010335 1 C17 AAcC=O C ? ? ? ? 191.8608 182.0000 ? ? ? bmse010335 1 C18 B1 C ? ? ? ? 275.0000 230.0000 ? ? ? bmse010335 1 C19 A1 C ? ? ? ? 247.2880 150.0000 ? ? ? bmse010335 1 C20 B C ? ? ? ? 275.0000 198.0000 ? ? ? bmse010335 1 C21 B4 C ? ? ? ? 275.0000 294.0000 ? ? ? bmse010335 1 C22 A4 C ? ? ? ? 247.2880 86.0000 ? ? ? bmse010335 1 C23 B3 C ? ? ? ? 247.2880 278.0000 ? ? ? bmse010335 1 C24 A3 C ? ? ? ? 219.5760 102.0000 ? ? ? bmse010335 1 C25 A C ? ? ? ? 247.2880 182.0000 ? ? ? bmse010335 1 O26 ? O ? ? ? ? 358.1392 150.0000 ? ? ? bmse010335 1 O27 ? O ? ? ? ? 330.4272 326.0000 ? ? ? bmse010335 1 O28 ? O ? ? ? ? 302.7120 54.0000 ? ? ? bmse010335 1 O29 ? O ? ? ? ? 191.8608 150.0000 ? ? ? bmse010335 1 O30 ? O ? ? ? ? 219.5760 294.0000 ? ? ? bmse010335 1 O31 ? O ? ? ? ? 191.8608 86.0000 ? ? ? bmse010335 1 O32 ? O ? ? ? ? 330.4272 198.0000 ? ? ? bmse010335 1 O33 ? O ? ? ? ? 275.0000 326.0000 ? ? ? bmse010335 1 O34 ? O ? ? ? ? 247.2880 54.0000 ? ? ? bmse010335 1 O35 ? O ? ? ? ? 219.5760 198.0000 ? ? ? bmse010335 1 H36 GAcMe H ? ? ? ? 395.7714 180.8182 ? ? ? bmse010335 1 H37 GAcMe H ? ? ? ? 403.0330 207.9202 ? ? ? bmse010335 1 H38 GAcMe H ? ? ? ? 375.9310 215.1818 ? ? ? bmse010335 1 H39 AcMe H ? ? ? ? 322.5520 374.0000 ? ? ? bmse010335 1 H40 AcMe H ? ? ? ? 302.7120 393.8400 ? ? ? bmse010335 1 H41 AcMe H ? ? ? ? 282.8720 374.0000 ? ? ? bmse010335 1 H42 AcMe H ? ? ? ? 255.1600 6.0000 ? ? ? bmse010335 1 H43 AcMe H ? ? ? ? 275.0000 -13.8400 ? ? ? bmse010335 1 H44 AcMe H ? ? ? ? 294.8400 6.0000 ? ? ? bmse010335 1 H45 AAcMe H ? ? ? ? 174.0690 215.1818 ? ? ? bmse010335 1 H46 AAcMe H ? ? ? ? 146.9670 207.9202 ? ? ? bmse010335 1 H47 AAcMe H ? ? ? ? 154.2286 180.8182 ? ? ? bmse010335 1 H48 OMe H ? ? ? ? 239.4160 326.0000 ? ? ? bmse010335 1 H49 OMe H ? ? ? ? 219.5760 345.8400 ? ? ? bmse010335 1 H50 OMe H ? ? ? ? 199.7360 326.0000 ? ? ? bmse010335 1 H51 OMe H ? ? ? ? 174.0690 119.1818 ? ? ? bmse010335 1 H52 OMe H ? ? ? ? 146.9670 111.9202 ? ? ? bmse010335 1 H53 OMe H ? ? ? ? 154.2286 84.8182 ? ? ? bmse010335 1 H54 B6 H ? ? ? ? 319.8940 236.0801 ? ? ? bmse010335 1 H55 A6 H ? ? ? ? 292.1820 143.9199 ? ? ? bmse010335 1 H56 B5 H ? ? ? ? 319.8940 287.9199 ? ? ? bmse010335 1 H57 A5 H ? ? ? ? 292.1820 92.0801 ? ? ? bmse010335 1 H58 B2 H ? ? ? ? 230.1060 236.0801 ? ? ? bmse010335 1 H59 A2 H ? ? ? ? 202.3940 143.9199 ? ? ? bmse010335 1 H60 G1 H ? ? ? ? 289.9588 166.8019 ? ? ? bmse010335 1 H61 G2 H ? ? ? ? 315.4645 166.8013 ? ? ? bmse010335 1 H62 B H ? ? ? ? 292.1820 207.9199 ? ? ? bmse010335 1 H63 A H ? ? ? ? 230.1060 172.0801 ? ? ? bmse010335 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010335 1 C2 C2 BMRB bmse010335 1 C3 C3 BMRB bmse010335 1 C4 C4 BMRB bmse010335 1 C5 C5 BMRB bmse010335 1 C6 C6 BMRB bmse010335 1 C7 C7 BMRB bmse010335 1 C8 C8 BMRB bmse010335 1 C9 C9 BMRB bmse010335 1 C10 C10 BMRB bmse010335 1 C11 C11 BMRB bmse010335 1 C12 C12 BMRB bmse010335 1 C13 C13 BMRB bmse010335 1 C14 C14 BMRB bmse010335 1 C15 C15 BMRB bmse010335 1 C16 C16 BMRB bmse010335 1 C17 C17 BMRB bmse010335 1 C18 C18 BMRB bmse010335 1 C19 C19 BMRB bmse010335 1 C20 C20 BMRB bmse010335 1 C21 C21 BMRB bmse010335 1 C22 C22 BMRB bmse010335 1 C23 C23 BMRB bmse010335 1 C24 C24 BMRB bmse010335 1 C25 C25 BMRB bmse010335 1 O26 O26 BMRB bmse010335 1 O27 O27 BMRB bmse010335 1 O28 O28 BMRB bmse010335 1 O29 O29 BMRB bmse010335 1 O30 O30 BMRB bmse010335 1 O31 O31 BMRB bmse010335 1 O32 O32 BMRB bmse010335 1 O33 O33 BMRB bmse010335 1 O34 O34 BMRB bmse010335 1 O35 O35 BMRB bmse010335 1 H36 H36 BMRB bmse010335 1 H37 H37 BMRB bmse010335 1 H38 H38 BMRB bmse010335 1 H39 H39 BMRB bmse010335 1 H40 H40 BMRB bmse010335 1 H41 H41 BMRB bmse010335 1 H42 H42 BMRB bmse010335 1 H43 H43 BMRB bmse010335 1 H44 H44 BMRB bmse010335 1 H45 H45 BMRB bmse010335 1 H46 H46 BMRB bmse010335 1 H47 H47 BMRB bmse010335 1 H48 H48 BMRB bmse010335 1 H49 H49 BMRB bmse010335 1 H50 H50 BMRB bmse010335 1 H51 H51 BMRB bmse010335 1 H52 H52 BMRB bmse010335 1 H53 H53 BMRB bmse010335 1 H54 H54 BMRB bmse010335 1 H55 H55 BMRB bmse010335 1 H56 H56 BMRB bmse010335 1 H57 H57 BMRB bmse010335 1 H58 H58 BMRB bmse010335 1 H59 H59 BMRB bmse010335 1 H60 H60 BMRB bmse010335 1 H61 H61 BMRB bmse010335 1 H62 H62 BMRB bmse010335 1 H63 H63 BMRB bmse010335 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C14 ? bmse010335 1 2 covalent SING C2 C15 ? bmse010335 1 3 covalent SING C3 C16 ? bmse010335 1 4 covalent SING C4 C17 ? bmse010335 1 5 covalent SING C5 O30 ? bmse010335 1 6 covalent SING C6 O31 ? bmse010335 1 7 covalent DOUB C7 C9 ? bmse010335 1 8 covalent SING C7 C18 ? bmse010335 1 9 covalent DOUB C8 C10 ? bmse010335 1 10 covalent SING C8 C19 ? bmse010335 1 11 covalent SING C9 C21 ? bmse010335 1 12 covalent SING C10 C22 ? bmse010335 1 13 covalent DOUB C11 C18 ? bmse010335 1 14 covalent SING C11 C23 ? bmse010335 1 15 covalent DOUB C12 C19 ? bmse010335 1 16 covalent SING C12 C24 ? bmse010335 1 17 covalent SING C13 C20 ? bmse010335 1 18 covalent SING C13 O32 ? bmse010335 1 19 covalent DOUB C14 O26 ? bmse010335 1 20 covalent SING C14 O32 ? bmse010335 1 21 covalent DOUB C15 O27 ? bmse010335 1 22 covalent SING C15 O33 ? bmse010335 1 23 covalent DOUB C16 O28 ? bmse010335 1 24 covalent SING C16 O34 ? bmse010335 1 25 covalent DOUB C17 O29 ? bmse010335 1 26 covalent SING C17 O35 ? bmse010335 1 27 covalent SING C18 C20 ? bmse010335 1 28 covalent SING C19 C25 ? bmse010335 1 29 covalent SING C20 C25 ? bmse010335 1 30 covalent DOUB C21 C23 ? bmse010335 1 31 covalent SING C21 O33 ? bmse010335 1 32 covalent DOUB C22 C24 ? bmse010335 1 33 covalent SING C22 O34 ? bmse010335 1 34 covalent SING C23 O30 ? bmse010335 1 35 covalent SING C24 O31 ? bmse010335 1 36 covalent SING C25 O35 ? bmse010335 1 37 covalent SING C1 H36 ? bmse010335 1 38 covalent SING C1 H37 ? bmse010335 1 39 covalent SING C1 H38 ? bmse010335 1 40 covalent SING C2 H39 ? bmse010335 1 41 covalent SING C2 H40 ? bmse010335 1 42 covalent SING C2 H41 ? bmse010335 1 43 covalent SING C3 H42 ? bmse010335 1 44 covalent SING C3 H43 ? bmse010335 1 45 covalent SING C3 H44 ? bmse010335 1 46 covalent SING C4 H45 ? bmse010335 1 47 covalent SING C4 H46 ? bmse010335 1 48 covalent SING C4 H47 ? bmse010335 1 49 covalent SING C5 H48 ? bmse010335 1 50 covalent SING C5 H49 ? bmse010335 1 51 covalent SING C5 H50 ? bmse010335 1 52 covalent SING C6 H51 ? bmse010335 1 53 covalent SING C6 H52 ? bmse010335 1 54 covalent SING C6 H53 ? bmse010335 1 55 covalent SING C7 H54 ? bmse010335 1 56 covalent SING C8 H55 ? bmse010335 1 57 covalent SING C9 H56 ? bmse010335 1 58 covalent SING C10 H57 ? bmse010335 1 59 covalent SING C11 H58 ? bmse010335 1 60 covalent SING C12 H59 ? bmse010335 1 61 covalent SING C13 H60 ? bmse010335 1 62 covalent SING C13 H61 ? bmse010335 1 63 covalent SING C20 H62 ? bmse010335 1 64 covalent SING C25 H63 ? bmse010335 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID yes USDA_NMR_database 3006 "Compound Number" ? lignin_cw_compound_3006 ? "matching entry" ? bmse010335 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010335 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010335 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_3006 "natural abundance" 1 $lignin_cw_compound_3006 ? Solute Saturated ? ? 1 ? "Liming Zhang" "Acetic acid3-acetoxy-2,3-bis-(4-acetoxy-3-methoxyphenyl)propyl ester" n/a bmse010335 1 2 acetone "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010335 1 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010335 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010335 1 temperature 297 ? K bmse010335 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010335 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010335 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010335 1 stop_ save_ save_Bruker_360 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_360 _NMR_spectrometer.Entry_ID bmse010335 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model DRX _NMR_spectrometer.Field_strength 360 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010335 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 1H" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010335 1 2 "1D 13C" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010335 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010335 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010335 1 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010335 1 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010335 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 1H" 1 $sample_1 bmse010335 1 2 "1D 13C" 1 $sample_1 bmse010335 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010335 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? ? 1 1 ? 1 C1 C 13 20.43 ? ? 4 ? ? ? ? ? AcMe ? bmse010335 1 2 ? ? 1 1 ? 1 C2 C 13 20.46 ? ? 4 ? ? ? ? ? AcMe ? bmse010335 1 3 ? ? 1 1 ? 1 C3 C 13 20.65 ? ? 4 ? ? ? ? ? AcMe ? bmse010335 1 4 ? ? 1 1 ? 1 C4 C 13 20.83 ? ? 4 ? ? ? ? ? AcMe ? bmse010335 1 5 ? ? 1 1 ? 1 C20 C 13 50.98 ? ? 1 ? ? ? ? ? B ? bmse010335 1 6 ? ? 1 1 ? 1 C5 C 13 56.20 ? ? 4 ? ? ? ? ? OMe ? bmse010335 1 7 ? ? 1 1 ? 1 C6 C 13 56.22 ? ? 4 ? ? ? ? ? OMe ? bmse010335 1 8 ? ? 1 1 ? 1 C13 C 13 64.86 ? ? 1 ? ? ? ? ? G ? bmse010335 1 9 ? ? 1 1 ? 1 C25 C 13 75.56 ? ? 1 ? ? ? ? ? A ? bmse010335 1 10 ? ? 1 1 ? 1 C12 C 13 112.09 ? ? 1 ? ? ? ? ? A2 ? bmse010335 1 11 ? ? 1 1 ? 1 C11 C 13 114.52 ? ? 1 ? ? ? ? ? B2 ? bmse010335 1 12 ? ? 1 1 ? 1 C8 C 13 119.73 ? ? 1 ? ? ? ? ? A6 ? bmse010335 1 13 ? ? 1 1 ? 1 C7 C 13 121.93 ? ? 1 ? ? ? ? ? B6 ? bmse010335 1 14 ? ? 1 1 ? 1 C9 C 13 123.13 ? ? 1 ? ? ? ? ? B5 ? bmse010335 1 15 ? ? 1 1 ? 1 C10 C 13 123.30 ? ? 1 ? ? ? ? ? A5 ? bmse010335 1 16 ? ? 1 1 ? 1 C18 C 13 137.43 ? ? 1 ? ? ? ? ? B1 ? bmse010335 1 17 ? ? 1 1 ? 1 C19 C 13 138.72 ? ? 1 ? ? ? ? ? A1 ? bmse010335 1 18 ? ? 1 1 ? 1 C21 C 13 140.05 ? ? 1 ? ? ? ? ? B4 ? bmse010335 1 19 ? ? 1 1 ? 1 C22 C 13 140.51 ? ? 1 ? ? ? ? ? A4 ? bmse010335 1 20 ? ? 1 1 ? 1 C23 C 13 151.80 ? ? 1 ? ? ? ? ? B3 ? bmse010335 1 21 ? ? 1 1 ? 1 C24 C 13 152.00 ? ? 1 ? ? ? ? ? A3 ? bmse010335 1 22 ? ? 1 1 ? 1 C15 C 13 168.89 ? ? 4 ? ? ? ? ? AcC=O ? bmse010335 1 23 ? ? 1 1 ? 1 C16 C 13 168.95 ? ? 4 ? ? ? ? ? AcC=O ? bmse010335 1 24 ? ? 1 1 ? 1 C17 C 13 169.94 ? ? 1 ? ? ? ? ? AAcC=O ? bmse010335 1 25 ? ? 1 1 ? 1 C14 C 13 170.74 ? ? 1 ? ? ? ? ? GAcC=O ? bmse010335 1 26 ? ? 1 1 ? 1 H36 H 1 1.92 ? ? 1 ? ? ? ? ? GAcMe ? bmse010335 1 27 ? ? 1 1 ? 1 H37 H 1 1.92 ? ? 1 ? ? ? ? ? GAcMe ? bmse010335 1 28 ? ? 1 1 ? 1 H38 H 1 1.92 ? ? 1 ? ? ? ? ? GAcMe ? bmse010335 1 29 ? ? 1 1 ? 1 H45 H 1 1.97 ? ? 1 ? ? ? ? ? AAcMe ? bmse010335 1 30 ? ? 1 1 ? 1 H46 H 1 1.97 ? ? 1 ? ? ? ? ? AAcMe ? bmse010335 1 31 ? ? 1 1 ? 1 H47 H 1 1.97 ? ? 1 ? ? ? ? ? AAcMe ? bmse010335 1 32 ? ? 1 1 ? 1 H39 H 1 2.20 ? ? 4 ? ? ? ? ? AcMe ? bmse010335 1 33 ? ? 1 1 ? 1 H40 H 1 2.20 ? ? 4 ? ? ? ? ? AcMe ? bmse010335 1 34 ? ? 1 1 ? 1 H41 H 1 2.20 ? ? 4 ? ? ? ? ? AcMe ? bmse010335 1 35 ? ? 1 1 ? 1 H42 H 1 2.21 ? ? 4 ? ? ? ? ? AcMe ? bmse010335 1 36 ? ? 1 1 ? 1 H43 H 1 2.21 ? ? 4 ? ? ? ? ? AcMe ? bmse010335 1 37 ? ? 1 1 ? 1 H44 H 1 2.21 ? ? 4 ? ? ? ? ? AcMe ? bmse010335 1 38 ? ? 1 1 ? 1 H62 H 1 3.50 ? ? 1 ? ? ? ? ? B ? bmse010335 1 39 ? ? 1 1 ? 1 H48 H 1 3.69 ? ? 4 ? ? ? ? ? OMe ? bmse010335 1 40 ? ? 1 1 ? 1 H49 H 1 3.69 ? ? 4 ? ? ? ? ? OMe ? bmse010335 1 41 ? ? 1 1 ? 1 H50 H 1 3.69 ? ? 4 ? ? ? ? ? OMe ? bmse010335 1 42 ? ? 1 1 ? 1 H51 H 1 3.73 ? ? 4 ? ? ? ? ? OMe ? bmse010335 1 43 ? ? 1 1 ? 1 H52 H 1 3.73 ? ? 4 ? ? ? ? ? OMe ? bmse010335 1 44 ? ? 1 1 ? 1 H53 H 1 3.73 ? ? 4 ? ? ? ? ? OMe ? bmse010335 1 45 ? ? 1 1 ? 1 H60 H 1 4.20 ? ? 1 ? ? ? ? ? G1 ? bmse010335 1 46 ? ? 1 1 ? 1 H61 H 1 4.37 ? ? 1 ? ? ? ? ? G2 ? bmse010335 1 47 ? ? 1 1 ? 1 H63 H 1 6.16 ? ? 1 ? ? ? ? ? A ? bmse010335 1 48 ? ? 1 1 ? 1 H54 H 1 6.84 ? ? 1 ? ? ? ? ? B6 ? bmse010335 1 49 ? ? 1 1 ? 1 H59 H 1 6.84 ? ? 1 ? ? ? ? ? A2 ? bmse010335 1 50 ? ? 1 1 ? 1 H55 H 1 6.87 ? ? 1 ? ? ? ? ? A6 ? bmse010335 1 51 ? ? 1 1 ? 1 H58 H 1 6.92 ? ? 1 ? ? ? ? ? B2 ? bmse010335 1 52 ? ? 1 1 ? 1 H56 H 1 6.96 ? ? 1 ? ? ? ? ? B5 ? bmse010335 1 53 ? ? 1 1 ? 1 H57 H 1 6.98 ? ? 1 ? ? ? ? ? A5 ? bmse010335 1 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 1 bmse010335 1 1 2 bmse010335 1 1 3 bmse010335 1 1 4 bmse010335 1 2 6 bmse010335 1 2 7 bmse010335 1 3 32 bmse010335 1 3 33 bmse010335 1 3 34 bmse010335 1 3 35 bmse010335 1 3 36 bmse010335 1 3 37 bmse010335 1 4 39 bmse010335 1 4 40 bmse010335 1 4 41 bmse010335 1 4 42 bmse010335 1 4 43 bmse010335 1 4 44 bmse010335 1 stop_ save_