data_bmse010496 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010496 _Entry.Title lignin_cw_compound_2082 _Entry.Version_type original _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2013-01-09 _Entry.Last_release_date 2013-01-17 _Entry.Original_release_date 2013-01-17 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.31 _Entry.Original_NMR_STAR_version 3.1.0.46 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name lignin_cw_compound_2082 loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 John Ralph ? ? bmse010496 2 Sally Ralph ? ? bmse010496 3 Stephane Quideau ? ? bmse010496 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010496 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 1 bmse010496 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 21 bmse010496 "1H chemical shifts" 24 bmse010496 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2013-01-17 2009-05-26 original BMRB "Original spectra from MMC" bmse010496 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010496 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010496 1 2 John Ralph ? ? ? bmse010496 1 3 Larry Landucci ? L. ? bmse010496 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010496 _Assembly.ID 1 _Assembly.Name lignin_cw_compound_2082 _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 lignin_cw_compound_2082 1 $lignin_cw_compound_2082 yes native no no ? ? ? bmse010496 1 stop_ save_ save_lignin_cw_compound_2082 _Entity.Sf_category entity _Entity.Sf_framecode lignin_cw_compound_2082 _Entity.Entry_ID bmse010496 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name lignin_cw_compound_2082 _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010496 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010496 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $lignin_cw_compound_2082 . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010496 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010496 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $lignin_cw_compound_2082 . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010496 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010496 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name lignin_cw_compound_2082 _Chem_comp.Type non-polymer _Chem_comp.BMRB_code bmse010496 _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C21H24O9/c1-12(23)29-21-16(27-4)9-13(10-17(21)28-5)19(24)18(11-22)30-20-14(25-2)7-6-8-15(20)26-3/h6-10,18,22H,11H2,1-5H3 ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C21 H24 O9' _Chem_comp.Formula_weight 420.40986 _Chem_comp.Formula_mono_iso_wt_nat 420.1420323693 _Chem_comp.Formula_mono_iso_wt_13C 441.2124839631 _Chem_comp.Formula_mono_iso_wt_15N 420.1420323693 _Chem_comp.Formula_mono_iso_wt_13C_15N 441.2124839631 _Chem_comp.Image_file_name standards/lignin_cw_compound_2082/lit/jr_2082.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/lignin_cw_compound_2082/lit/jr_2082.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID Unnamed synonym bmse010496 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical CC(=O)OC1=C(C=C(C=C1OC)C(C(CO)OC2=C(C=CC=C2OC)OC)=O)OC bmse010496 1 Isomeric CC(=O)OC1=C(C=C(C=C1OC)C(C(CO)OC2=C(C=CC=C2OC)OC)=O)OC bmse010496 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 ? C ? ? ? ? 316.5680 350.0000 ? ? ? bmse010496 1 C2 ? C ? ? ? ? 178.0048 174.0000 ? ? ? bmse010496 1 C3 ? C ? ? ? ? 261.1440 30.0000 ? ? ? bmse010496 1 C4 ? C ? ? ? ? 205.7168 254.0000 ? ? ? bmse010496 1 C5 ? C ? ? ? ? 371.9952 254.0000 ? ? ? bmse010496 1 C6 ? C ? ? ? ? 178.0048 78.0000 ? ? ? bmse010496 1 C7 ? C ? ? ? ? 178.0048 110.0000 ? ? ? bmse010496 1 C8 ? C ? ? ? ? 205.7168 62.0000 ? ? ? bmse010496 1 C9 ? C ? ? ? ? 261.1440 222.0000 ? ? ? bmse010496 1 C10 ? C ? ? ? ? 316.5680 222.0000 ? ? ? bmse010496 1 C11 ? C ? ? ? ? 233.4320 174.0000 ? ? ? bmse010496 1 C12 ? C ? ? ? ? 316.5680 318.0000 ? ? ? bmse010496 1 C13 ? C ? ? ? ? 288.8560 206.0000 ? ? ? bmse010496 1 C14 ? C ? ? ? ? 205.7168 126.0000 ? ? ? bmse010496 1 C15 ? C ? ? ? ? 233.4320 78.0000 ? ? ? bmse010496 1 C16 ? C ? ? ? ? 261.1440 254.0000 ? ? ? bmse010496 1 C17 ? C ? ? ? ? 316.5680 254.0000 ? ? ? bmse010496 1 C18 ? C ? ? ? ? 261.1440 158.0000 ? ? ? bmse010496 1 C19 ? C ? ? ? ? 288.8560 174.0000 ? ? ? bmse010496 1 C20 ? C ? ? ? ? 233.4320 110.0000 ? ? ? bmse010496 1 C21 ? C ? ? ? ? 288.8560 270.0000 ? ? ? bmse010496 1 O22 ? O ? ? ? ? 233.4320 206.0000 ? ? ? bmse010496 1 O23 ? O ? ? ? ? 344.2832 302.0000 ? ? ? bmse010496 1 O24 ? O ? ? ? ? 316.5680 158.0000 ? ? ? bmse010496 1 O25 ? O ? ? ? ? 205.7168 158.0000 ? ? ? bmse010496 1 O26 ? O ? ? ? ? 261.1440 62.0000 ? ? ? bmse010496 1 O27 ? O ? ? ? ? 233.4320 270.0000 ? ? ? bmse010496 1 O28 ? O ? ? ? ? 344.2832 270.0000 ? ? ? bmse010496 1 O29 ? O ? ? ? ? 288.8560 302.0000 ? ? ? bmse010496 1 O30 ? O ? ? ? ? 261.1440 126.0000 ? ? ? bmse010496 1 H31 ? H ? ? ? ? 336.4080 350.0000 ? ? ? bmse010496 1 H32 ? H ? ? ? ? 316.5680 369.8400 ? ? ? bmse010496 1 H33 ? H ? ? ? ? 296.7280 350.0000 ? ? ? bmse010496 1 H34 ? H ? ? ? ? 187.9250 191.1818 ? ? ? bmse010496 1 H35 ? H ? ? ? ? 160.8230 183.9202 ? ? ? bmse010496 1 H36 ? H ? ? ? ? 168.0846 156.8182 ? ? ? bmse010496 1 H37 ? H ? ? ? ? 241.3040 30.0000 ? ? ? bmse010496 1 H38 ? H ? ? ? ? 261.1440 10.1600 ? ? ? bmse010496 1 H39 ? H ? ? ? ? 280.9840 30.0000 ? ? ? bmse010496 1 H40 ? H ? ? ? ? 195.7974 271.1823 ? ? ? bmse010496 1 H41 ? H ? ? ? ? 188.5345 244.0806 ? ? ? bmse010496 1 H42 ? H ? ? ? ? 215.6362 236.8177 ? ? ? bmse010496 1 H43 ? H ? ? ? ? 362.0750 236.8182 ? ? ? bmse010496 1 H44 ? H ? ? ? ? 389.1770 244.0798 ? ? ? bmse010496 1 H45 ? H ? ? ? ? 381.9154 271.1818 ? ? ? bmse010496 1 H46 ? H ? ? ? ? 160.8228 68.0801 ? ? ? bmse010496 1 H47 ? H ? ? ? ? 160.8228 119.9199 ? ? ? bmse010496 1 H48 ? H ? ? ? ? 205.7163 42.1600 ? ? ? bmse010496 1 H49 ? H ? ? ? ? 243.9620 212.0801 ? ? ? bmse010496 1 H50 ? H ? ? ? ? 333.7500 212.0801 ? ? ? bmse010496 1 H51 ? H ? ? ? ? 213.8934 177.4453 ? ? ? bmse010496 1 H52 ? H ? ? ? ? 226.6462 155.3566 ? ? ? bmse010496 1 H53 ? H ? ? ? ? 278.3260 148.0801 ? ? ? bmse010496 1 H54 ? H ? ? ? ? 250.6140 215.9200 ? ? ? bmse010496 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 ? bmse010496 1 C2 C2 ? bmse010496 1 C3 C3 ? bmse010496 1 C4 C4 ? bmse010496 1 C5 C5 ? bmse010496 1 C6 C6 ? bmse010496 1 C7 C7 ? bmse010496 1 C8 C8 ? bmse010496 1 C9 C9 ? bmse010496 1 C10 C10 ? bmse010496 1 C11 C11 ? bmse010496 1 C12 C12 ? bmse010496 1 C13 C13 ? bmse010496 1 C14 C14 ? bmse010496 1 C15 C15 ? bmse010496 1 C16 C16 ? bmse010496 1 C17 C17 ? bmse010496 1 C18 C18 ? bmse010496 1 C19 C19 ? bmse010496 1 C20 C20 ? bmse010496 1 C21 C21 ? bmse010496 1 O22 O22 ? bmse010496 1 O23 O23 ? bmse010496 1 O24 O24 ? bmse010496 1 O25 O25 ? bmse010496 1 O26 O26 ? bmse010496 1 O27 O27 ? bmse010496 1 O28 O28 ? bmse010496 1 O29 O29 ? bmse010496 1 O30 O30 ? bmse010496 1 H31 H31 ? bmse010496 1 H32 H32 ? bmse010496 1 H33 H33 ? bmse010496 1 H34 H34 ? bmse010496 1 H35 H35 ? bmse010496 1 H36 H36 ? bmse010496 1 H37 H37 ? bmse010496 1 H38 H38 ? bmse010496 1 H39 H39 ? bmse010496 1 H40 H40 ? bmse010496 1 H41 H41 ? bmse010496 1 H42 H42 ? bmse010496 1 H43 H43 ? bmse010496 1 H44 H44 ? bmse010496 1 H45 H45 ? bmse010496 1 H46 H46 ? bmse010496 1 H47 H47 ? bmse010496 1 H48 H48 ? bmse010496 1 H49 H49 ? bmse010496 1 H50 H50 ? bmse010496 1 H51 H51 ? bmse010496 1 H52 H52 ? bmse010496 1 H53 H53 ? bmse010496 1 H54 H54 ? bmse010496 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C12 ? bmse010496 1 2 covalent SING C2 O25 ? bmse010496 1 3 covalent SING C3 O26 ? bmse010496 1 4 covalent SING C4 O27 ? bmse010496 1 5 covalent SING C5 O28 ? bmse010496 1 6 covalent DOUB C6 C7 ? bmse010496 1 7 covalent SING C6 C8 ? bmse010496 1 8 covalent SING C7 C14 ? bmse010496 1 9 covalent DOUB C8 C15 ? bmse010496 1 10 covalent DOUB C9 C13 ? bmse010496 1 11 covalent SING C9 C16 ? bmse010496 1 12 covalent SING C10 C13 ? bmse010496 1 13 covalent DOUB C10 C17 ? bmse010496 1 14 covalent SING C11 C18 ? bmse010496 1 15 covalent SING C11 O22 ? bmse010496 1 16 covalent DOUB C12 O23 ? bmse010496 1 17 covalent SING C12 O29 ? bmse010496 1 18 covalent SING C13 C19 ? bmse010496 1 19 covalent DOUB C14 C20 ? bmse010496 1 20 covalent SING C14 O25 ? bmse010496 1 21 covalent SING C15 C20 ? bmse010496 1 22 covalent SING C15 O26 ? bmse010496 1 23 covalent DOUB C16 C21 ? bmse010496 1 24 covalent SING C16 O27 ? bmse010496 1 25 covalent SING C17 C21 ? bmse010496 1 26 covalent SING C17 O28 ? bmse010496 1 27 covalent SING C18 C19 ? bmse010496 1 28 covalent SING C18 O30 ? bmse010496 1 29 covalent DOUB C19 O24 ? bmse010496 1 30 covalent SING C20 O30 ? bmse010496 1 31 covalent SING C21 O29 ? bmse010496 1 32 covalent SING C1 H31 ? bmse010496 1 33 covalent SING C1 H32 ? bmse010496 1 34 covalent SING C1 H33 ? bmse010496 1 35 covalent SING C2 H34 ? bmse010496 1 36 covalent SING C2 H35 ? bmse010496 1 37 covalent SING C2 H36 ? bmse010496 1 38 covalent SING C3 H37 ? bmse010496 1 39 covalent SING C3 H38 ? bmse010496 1 40 covalent SING C3 H39 ? bmse010496 1 41 covalent SING C4 H40 ? bmse010496 1 42 covalent SING C4 H41 ? bmse010496 1 43 covalent SING C4 H42 ? bmse010496 1 44 covalent SING C5 H43 ? bmse010496 1 45 covalent SING C5 H44 ? bmse010496 1 46 covalent SING C5 H45 ? bmse010496 1 47 covalent SING C6 H46 ? bmse010496 1 48 covalent SING C7 H47 ? bmse010496 1 49 covalent SING C8 H48 ? bmse010496 1 50 covalent SING C9 H49 ? bmse010496 1 51 covalent SING C10 H50 ? bmse010496 1 52 covalent SING C11 H51 ? bmse010496 1 53 covalent SING C11 H52 ? bmse010496 1 54 covalent SING C18 H53 ? bmse010496 1 55 covalent SING O22 H54 ? bmse010496 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID yes USDA_NMR_database 2082 "Compound Number" ? lignin_cw_compound_2082 ? "matching entry" ? bmse010496 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010496 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010496 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 Unnamed "natural abundance" 1 $lignin_cw_compound_2082 ? Solute Saturated ? ? 1 ? "John Ralph Lab" Unnamed n/a bmse010496 1 2 Acetone ? 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010496 1 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010496 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID 1 297 ? K bmse010496 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010496 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010496 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010496 1 stop_ save_ save_Bruker_360 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_360 _NMR_spectrometer.Entry_ID bmse010496 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model DRX _NMR_spectrometer.Field_strength 360 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010496 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 1H" yes ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010496 1 2 "1D 13C" yes ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010496 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010496 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010496 1 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010496 1 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010496 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 1H" 1 $sample_1 bmse010496 1 2 "1D 13C" 1 $sample_1 bmse010496 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010496 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 1 1 1 C1 C 13 20.21 ? ? 1 ? ? ? AcMe ? bmse010496 1 2 1 1 1 C2 C 13 56.28 ? ? 1 ? ? ? BOMe ? bmse010496 1 3 1 1 1 C3 C 13 56.28 ? ? 1 ? ? ? BOMe ? bmse010496 1 4 1 1 1 C4 C 13 56.61 ? ? 1 ? ? ? AOMe ? bmse010496 1 5 1 1 1 C5 C 13 56.61 ? ? 1 ? ? ? AOMe ? bmse010496 1 6 1 1 1 C11 C 13 63.35 ? ? 1 ? ? ? G ? bmse010496 1 7 1 1 1 C18 C 13 86.41 ? ? 1 ? ? ? B ? bmse010496 1 8 1 1 1 C7 C 13 106.22 ? ? 1 ? ? ? B2 ? bmse010496 1 9 1 1 1 C8 C 13 106.22 ? ? 1 ? ? ? B6 ? bmse010496 1 10 1 1 1 C9 C 13 106.51 ? ? 1 ? ? ? A2 ? bmse010496 1 11 1 1 1 C10 C 13 106.51 ? ? 1 ? ? ? A6 ? bmse010496 1 12 1 1 1 C6 C 13 124.92 ? ? 1 ? ? ? B1 ? bmse010496 1 13 1 1 1 C21 C 13 133.59 ? ? 1 ? ? ? A4 ? bmse010496 1 14 1 1 1 C13 C 13 135.01 ? ? 1 ? ? ? A1 ? bmse010496 1 15 1 1 1 C20 C 13 137.01 ? ? 1 ? ? ? B4 ? bmse010496 1 16 1 1 1 C16 C 13 153.06 ? ? 1 ? ? ? A3 ? bmse010496 1 17 1 1 1 C17 C 13 153.06 ? ? 1 ? ? ? A5 ? bmse010496 1 18 1 1 1 C14 C 13 153.77 ? ? 1 ? ? ? B3 ? bmse010496 1 19 1 1 1 C15 C 13 153.77 ? ? 1 ? ? ? B5 ? bmse010496 1 20 1 1 1 C12 C 13 168.18 ? ? 1 ? ? ? AcC=O ? bmse010496 1 21 1 1 1 C19 C 13 196.25 ? ? 1 ? ? ? A ? bmse010496 1 22 1 1 1 H31 H 1 2.27 ? ? 1 ? ? ? AcMe ? bmse010496 1 23 1 1 1 H32 H 1 2.27 ? ? 1 ? ? ? AcMe ? bmse010496 1 24 1 1 1 H33 H 1 2.27 ? ? 1 ? ? ? AcMe ? bmse010496 1 25 1 1 1 H34 H 1 3.73 ? ? 1 ? ? ? BOMe ? bmse010496 1 26 1 1 1 H35 H 1 3.73 ? ? 1 ? ? ? BOMe ? bmse010496 1 27 1 1 1 H36 H 1 3.73 ? ? 1 ? ? ? BOMe ? bmse010496 1 28 1 1 1 H37 H 1 3.73 ? ? 1 ? ? ? BOMe ? bmse010496 1 29 1 1 1 H38 H 1 3.73 ? ? 1 ? ? ? BOMe ? bmse010496 1 30 1 1 1 H39 H 1 3.73 ? ? 1 ? ? ? BOMe ? bmse010496 1 31 1 1 1 H40 H 1 3.86 ? ? 1 ? ? ? AOMe ? bmse010496 1 32 1 1 1 H41 H 1 3.86 ? ? 1 ? ? ? AOMe ? bmse010496 1 33 1 1 1 H42 H 1 3.86 ? ? 1 ? ? ? AOMe ? bmse010496 1 34 1 1 1 H43 H 1 3.86 ? ? 1 ? ? ? AOMe ? bmse010496 1 35 1 1 1 H44 H 1 3.86 ? ? 1 ? ? ? AOMe ? bmse010496 1 36 1 1 1 H45 H 1 3.86 ? ? 1 ? ? ? AOMe ? bmse010496 1 37 1 1 1 H51 H 1 3.94 0.04 ? 1 ? ? ? G ? bmse010496 1 38 1 1 1 H52 H 1 3.94 0.04 ? 1 ? ? ? G ? bmse010496 1 39 1 1 1 H54 H 1 3.94 0.04 ? 1 ? ? ? GOH ? bmse010496 1 40 1 1 1 H53 H 1 5.22 ? ? 1 ? ? ? B ? bmse010496 1 41 1 1 1 H47 H 1 6.67 ? ? 1 ? ? ? B2 ? bmse010496 1 42 1 1 1 H48 H 1 6.67 ? ? 1 ? ? ? B6 ? bmse010496 1 43 1 1 1 H46 H 1 7.02 ? ? 1 ? ? ? B1 ? bmse010496 1 44 1 1 1 H49 H 1 7.48 ? ? 1 ? ? ? A2 ? bmse010496 1 45 1 1 1 H50 H 1 7.48 ? ? 1 ? ? ? A6 ? bmse010496 1 stop_ save_