6816 -OEChem-04260609162D 84 86 0 1 0 0 0 0 0999 V2000 2.6062 8.0020 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 11.2950 0.8253 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 12.5801 -0.3359 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 15.8304 -1.1783 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 12.2727 0.6157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3172 1.0349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8875 -1.2875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.9332 -2.1730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5046 1.8031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6285 -0.6433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.8251 -1.0755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.7276 -0.1836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3838 1.6637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.9294 -4.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5835 -3.2567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0854 -0.1525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5317 -0.0286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8357 -1.2811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4173 4.0992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8470 6.4216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7691 3.5669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.1988 5.8893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.0469 -7.8220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.8592 -5.0173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.8592 -6.6267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 11.1809 -6.3220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.0469 -4.8220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.0320 2.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0542 2.4057 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 2.9136 7.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0098 1.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8914 6.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4617 4.5185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8653 -1.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4839 4.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8224 1.2183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2416 3.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1698 -4.0667 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 14.1726 -2.4487 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 15.1214 -3.7594 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 15.1232 -2.7594 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7469 3.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1765 5.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0469 -6.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9130 -5.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9130 -6.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4428 -5.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1809 -5.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 8.1320 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0945 1.9936 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4986 -1.2495 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1886 -1.5777 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 16.2298 0.1800 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7776 1.7936 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 16.4963 -4.0974 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3534 3.1068 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7831 5.4292 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5100 -8.1320 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5839 -8.1320 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2448 1.8157 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2995 6.9652 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8909 6.4309 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0325 2.6060 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6239 2.0717 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9141 7.4604 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5055 6.9261 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4844 5.1380 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0758 4.6037 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4794 -1.4119 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8880 -0.8775 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4612 4.1085 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8698 4.6428 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8478 3.0439 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4286 1.0883 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6925 0.6121 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2162 1.3482 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6354 3.3038 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3716 3.7801 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6075 -4.5059 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5604 -2.3507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.0234 -4.3716 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6751 -3.0418 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.0628 -5.8220 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6440 -5.0120 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 30 1 0 0 0 0 1 49 1 0 0 0 0 2 5 1 0 0 0 0 2 6 1 0 0 0 0 2 9 1 0 0 0 0 2 16 2 0 0 0 0 3 5 1 0 0 0 0 3 7 1 0 0 0 0 3 10 1 0 0 0 0 3 17 2 0 0 0 0 4 8 1 0 0 0 0 4 11 1 0 0 0 0 4 12 1 0 0 0 0 4 18 2 0 0 0 0 6 31 1 0 0 0 0 7 34 1 0 0 0 0 41 8 1 1 0 0 0 9 50 1 0 0 0 0 10 51 1 0 0 0 0 11 52 1 0 0 0 0 12 53 1 0 0 0 0 13 29 1 0 0 0 0 13 54 1 0 0 0 0 40 14 1 1 0 0 0 14 55 1 0 0 0 0 15 38 1 0 0 0 0 15 39 1 0 0 0 0 19 42 2 0 0 0 0 20 43 2 0 0 0 0 21 33 1 0 0 0 0 21 42 1 0 0 0 0 21 56 1 0 0 0 0 22 32 1 0 0 0 0 22 43 1 0 0 0 0 22 57 1 0 0 0 0 23 44 1 0 0 0 0 23 58 1 0 0 0 0 23 59 1 0 0 0 0 38 24 1 6 0 0 0 24 45 1 0 0 0 0 24 47 1 0 0 0 0 25 46 1 0 0 0 0 25 47 2 0 0 0 0 26 44 1 0 0 0 0 26 48 2 0 0 0 0 27 45 2 0 0 0 0 27 48 1 0 0 0 0 28 29 1 0 0 0 0 28 31 1 0 0 0 0 28 36 1 0 0 0 0 28 37 1 0 0 0 0 29 42 1 0 0 0 0 29 60 1 0 0 0 0 30 32 1 0 0 0 0 30 61 1 0 0 0 0 30 62 1 0 0 0 0 31 63 1 0 0 0 0 31 64 1 0 0 0 0 32 65 1 0 0 0 0 32 66 1 0 0 0 0 33 35 1 0 0 0 0 33 67 1 0 0 0 0 33 68 1 0 0 0 0 39 34 1 6 0 0 0 34 69 1 0 0 0 0 34 70 1 0 0 0 0 35 43 1 0 0 0 0 35 71 1 0 0 0 0 35 72 1 0 0 0 0 36 74 1 0 0 0 0 36 75 1 0 0 0 0 36 76 1 0 0 0 0 37 73 1 0 0 0 0 37 77 1 0 0 0 0 37 78 1 0 0 0 0 38 40 1 0 0 0 0 38 79 1 0 0 0 0 39 41 1 0 0 0 0 39 80 1 0 0 0 0 40 41 1 0 0 0 0 40 81 1 0 0 0 0 41 82 1 0 0 0 0 44 46 2 0 0 0 0 45 46 1 0 0 0 0 47 83 1 0 0 0 0 48 84 1 0 0 0 0 M END > 1 > 6816 > 21 > 9 > 18 > AAADcfB7vgNAAAAAAAAAAAAAAAAAAWJAAAAsAAAAAAAAAFgB+AAAHgQQCCAADhzl1waH8L/MFxSoQQdxdIKAgC0REKABUKFoVBCDWBpAyEAeRAgPFgLTACDyMAoJAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA== > [(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy-[hydroxy-[3-hydroxy-2,2-dimethyl-3-[2-(2-sulfanylethylcarbamoyl)ethylcarbamoyl]propoxy]phosphoryl]oxy-phosphoryl]oxymethyl]tetrahydrofuran-3-yl]oxyphosphonic acid > [(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy-[hydroxy-[3-hydroxy-3-[[2-[(2-mercaptoethylamino)-oxo-methyl]ethylamino]-oxo-methyl]-2,2-dimethyl-propoxy]phosphoryl]oxy-phosphoryl]oxymethyl]tetrahydrofuran-3-yl]oxyphosphonic acid > [(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy-[hydroxy-[3-hydroxy-2,2-dimethyl-3-[2-(2-sulfanylethylcarbamoyl)ethylcarbamoyl]propoxy]phosphoryl]oxy-phosphoryl]oxymethyl]oxolan-3-yl]oxyphosphonic acid > [(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy-[hydroxy-[3-hydroxy-2,2-dimethyl-3-[2-(2-sulfanylethylcarbamoyl)ethylcarbamoyl]propoxy]phosphoryl]oxy-phosphoryl]oxymethyl]oxolan-3-yl]oxyphosphonic acid > [(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[hydroxy-[hydroxy-[3-hydroxy-3-[2-(2-mercaptoethylcarbamoyl)ethylcarbamoyl]-2,2-dimethyl-propoxy]phosphoryl]oxy-phosphoryl]oxymethyl]tetrahydrofuran-3-yl]oxyphosphonic acid > InChI=1/C21H36N7O16P3S/c1-21(2,16(31)19(32)24-4-3-12(29)23-5-6-48)8-41-47(38,39)44-46(36,37)40-7-11-15(43-45(33,34)35)14(30)20(42-11)28-10-27-13-17(22)25-9-26-18(13)28/h9-11,14-16,20,30-31,48H,3-8H2,1-2H3,(H,23,29)(H,24,32)(H,36,37)(H,38,39)(H2,22,25,26)(H2,33,34,35)/t11-,14-,15-,16?,20-/m1/s1/f/h23-24,33-34,36,38H,22H2 > -3.771 > 767.115 > C21H36N7O16P3S > 767.535 > CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O > CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1[C@@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O > 346.56 > 767.115 > 0 > 48 > 4 > 0 > 0 > 0 > 0 > 1 > 12 > 3312 > 2 > KEGG > C00010 > Is a reactant or product of enzyme EC 1.1.1.34 Is a reactant or product of enzyme EC 1.1.1.88 Is a reactant or product of enzyme EC 1.1.1.- Is a reactant or product of enzyme EC 1.2.1.10 Is a reactant or product of enzyme EC 1.2.1.17 Is a reactant or product of enzyme EC 1.2.1.18 Is a reactant or product of enzyme EC 1.2.1.25 Is a reactant or product of enzyme EC 1.2.1.27 Is a reactant or product of enzyme EC 1.2.1.42 Is a reactant or product of enzyme EC 1.2.1.44 Is a reactant or product of enzyme EC 1.2.1.50 Is a reactant or product of enzyme EC 1.2.1.51 Is a reactant or product of enzyme EC 1.2.1.52 Is a reactant or product of enzyme EC 1.2.1.57 Is a reactant or product of enzyme EC 1.2.1.58 Is a reactant or product of enzyme EC 1.2.3.6 Is a reactant or product of enzyme EC 1.2.4.1 Is a reactant or product of enzyme EC 1.2.4.2 Is a reactant or product of enzyme EC 1.2.7.1 Is a reactant or product of enzyme EC 1.2.7.2 Is a reactant or product of enzyme EC 1.2.7.3 Is a reactant or product of enzyme EC 1.8.1.4 Is a reactant or product of enzyme EC 1.8.1.10 Is a reactant or product of enzyme EC 1.8.1.14 Is a reactant or product of enzyme EC 1.8.4.3 Is a reactant or product of enzyme EC 2.3.1.1 Is a reactant or product of enzyme EC 2.3.1.2 Is a reactant or product of enzyme EC 2.3.1.3 Is a reactant or product of enzyme EC 2.3.1.4 Is a reactant or product of enzyme EC 2.3.1.5 Is a reactant or product of enzyme EC 2.3.1.6 Is a reactant or product of enzyme EC 2.3.1.7 Is a reactant or product of enzyme EC 2.3.1.8 Is a reactant or product of enzyme EC 2.3.1.9 Is a reactant or product of enzyme EC 2.3.1.10 Is a reactant or product of enzyme EC 2.3.1.11 Is a reactant or product of enzyme EC 2.3.1.12 Is a reactant or product of enzyme EC 2.3.1.13 Is a reactant or product of enzyme EC 2.3.1.14 Is a reactant or product of enzyme EC 2.3.1.15 Is a reactant or product of enzyme EC 2.3.1.16 Is a reactant or product of enzyme EC 2.3.1.17 Is a reactant or product of enzyme EC 2.3.1.18 Is a reactant or product of enzyme EC 2.3.1.19 Is a reactant or product of enzyme EC 2.3.1.20 Is a reactant or product of enzyme EC 2.3.1.21 Is a reactant or product of enzyme EC 2.3.1.22 Is a reactant or product of enzyme EC 2.3.1.23 Is a reactant or product of enzyme EC 2.3.1.24 Is a reactant or product of enzyme EC 2.3.1.25 Is a reactant or product of enzyme EC 2.3.1.26 Is a reactant or product of enzyme EC 2.3.1.27 Is a reactant or product of enzyme EC 2.3.1.28 Is a reactant or product of enzyme EC 2.3.1.29 Is a reactant or product of enzyme EC 2.3.1.30 Is a reactant or product of enzyme EC 2.3.1.31 Is a reactant or product of enzyme EC 2.3.1.33 Is a reactant or product of enzyme EC 2.3.1.34 Is a reactant or product of enzyme EC 2.3.1.36 Is a reactant or product of enzyme EC 2.3.1.37 Is a reactant or product of enzyme EC 2.3.1.38 Is a reactant or product of enzyme EC 2.3.1.39 Is a reactant or product of enzyme EC 2.3.1.41 Is a reactant or product of enzyme EC 2.3.1.42 Is a reactant or product of enzyme EC 2.3.1.44 Is a reactant or product of enzyme EC 2.3.1.45 Is a reactant or product of enzyme EC 2.3.1.46 Is a reactant or product of enzyme EC 2.3.1.47 Is a reactant or product of enzyme EC 2.3.1.48 Is a reactant or product of enzyme EC 2.3.1.50 Is a reactant or product of enzyme EC 2.3.1.51 Is a reactant or product of enzyme EC 2.3.1.52 Is a reactant or product of enzyme EC 2.3.1.53 Is a reactant or product of enzyme EC 2.3.1.54 Is a reactant or product of enzyme EC 2.3.1.57 Is a reactant or product of enzyme EC 2.3.1.58 Is a reactant or product of enzyme EC 2.3.1.59 Is a reactant or product of enzyme EC 2.3.1.60 Is a reactant or product of enzyme EC 2.3.1.61 Is a reactant or product of enzyme EC 2.3.1.62 Is a reactant or product of enzyme EC 2.3.1.63 Is a reactant or product of enzyme EC 2.3.1.64 Is a reactant or product of enzyme EC 2.3.1.65 Is a reactant or product of enzyme EC 2.3.1.66 Is a reactant or product of enzyme EC 2.3.1.67 Is a reactant or product of enzyme EC 2.3.1.68 Is a reactant or product of enzyme EC 2.3.1.69 Is a reactant or product of enzyme EC 2.3.1.70 Is a reactant or product of enzyme EC 2.3.1.71 Is a reactant or product of enzyme EC 2.3.1.74 Is a reactant or product of enzyme EC 2.3.1.75 Is a reactant or product of enzyme EC 2.3.1.76 Is a reactant or product of enzyme EC 2.3.1.78 Is a reactant or product of enzyme EC 2.3.1.79 Is a reactant or product of enzyme EC 2.3.1.80 Is a reactant or product of enzyme EC 2.3.1.81 Is a reactant or product of enzyme EC 2.3.1.82 Is a reactant or product of enzyme EC 2.3.1.84 Is a reactant or product of enzyme EC 2.3.1.85 Is a reactant or product of enzyme EC 2.3.1.86 Is a reactant or product of enzyme EC 2.3.1.87 Is a reactant or product of enzyme EC 2.3.1.88 Is a reactant or product of enzyme EC 2.3.1.89 Is a reactant or product of enzyme EC 2.3.1.93 Is a reactant or product of enzyme EC 2.3.1.94 Is a reactant or product of enzyme EC 2.3.1.95 Is a reactant or product of enzyme EC 2.3.1.96 Is a reactant or product of enzyme EC 2.3.1.97 Is a reactant or product of enzyme EC 2.3.1.99 Is a reactant or product of enzyme EC 2.3.1.100 Is a reactant or product of enzyme EC 2.3.1.102 Is a reactant or product of enzyme EC 2.3.1.104 Is a reactant or product of enzyme EC 2.3.1.105 Is a reactant or product of enzyme EC 2.3.1.106 Is a reactant or product of enzyme EC 2.3.1.107 Is a reactant or product of enzyme EC 2.3.1.108 Is a reactant or product of enzyme EC 2.3.1.109 Is a reactant or product of enzyme EC 2.3.1.110 Is a reactant or product of enzyme EC 2.3.1.111 Is a reactant or product of enzyme EC 2.3.1.112 Is a reactant or product of enzyme EC 2.3.1.113 Is a reactant or product of enzyme EC 2.3.1.114 Is a reactant or product of enzyme EC 2.3.1.115 Is a reactant or product of enzyme EC 2.3.1.116 Is a reactant or product of enzyme EC 2.3.1.117 Is a reactant or product of enzyme EC 2.3.1.118 Is a reactant or product of enzyme EC 2.3.1.119 Is a reactant or product of enzyme EC 2.3.1.121 Is a reactant or product of enzyme EC 2.3.1.123 Is a reactant or product of enzyme EC 2.3.1.125 Is a reactant or product of enzyme EC 2.3.1.126 Is a reactant or product of enzyme EC 2.3.1.127 Is a reactant or product of enzyme EC 2.3.1.128 Is a reactant or product of enzyme EC 2.3.1.130 Is a reactant or product of enzyme EC 2.3.1.131 Is a reactant or product of enzyme EC 2.3.1.132 Is a reactant or product of enzyme EC 2.3.1.133 Is a reactant or product of enzyme EC 2.3.1.136 Is a reactant or product of enzyme EC 2.3.1.137 Is a reactant or product of enzyme EC 2.3.1.138 Is a reactant or product of enzyme EC 2.3.1.139 Is a reactant or product of enzyme EC 2.3.1.140 Is a reactant or product of enzyme EC 2.3.1.142 Is a reactant or product of enzyme EC 2.3.1.144 Is a reactant or product of enzyme EC 2.3.1.145 Is a reactant or product of enzyme EC 2.3.1.146 Is a reactant or product of enzyme EC 2.3.1.150 Is a reactant or product of enzyme EC 2.3.1.151 Is a reactant or product of enzyme EC 2.3.1.153 Is a reactant or product of enzyme EC 2.3.1.154 Is a reactant or product of enzyme EC 2.3.1.156 Is a reactant or product of enzyme EC 2.3.1.157 Is a reactant or product of enzyme EC 2.3.1.160 Is a reactant or product of enzyme EC 2.3.1.162 Is a reactant or product of enzyme EC 2.3.1.164 Is a reactant or product of enzyme EC 2.3.1.166 Is a reactant or product of enzyme EC 2.3.1.167 Is a reactant or product of enzyme EC 2.3.1.171 Is a reactant or product of enzyme EC 2.3.1.172 Is a reactant or product of enzyme EC 2.3.1.173 Is a reactant or product of enzyme EC 2.3.1.- Is a reactant or product of enzyme EC 2.3.3.1 Is a reactant or product of enzyme EC 2.3.3.2 Is a reactant or product of enzyme EC 2.3.3.3 Is a reactant or product of enzyme EC 2.3.3.4 Is a reactant or product of enzyme EC 2.3.3.5 Is a reactant or product of enzyme EC 2.3.3.6 Is a reactant or product of enzyme EC 2.3.3.7 Is a reactant or product of enzyme EC 2.3.3.8 Is a reactant or product of enzyme EC 2.3.3.9 Is a reactant or product of enzyme EC 2.3.3.10 Is a reactant or product of enzyme EC 2.3.3.11 Is a reactant or product of enzyme EC 2.3.3.12 Is a reactant or product of enzyme EC 2.3.3.13 Is a reactant or product of enzyme EC 2.3.3.14 Is a reactant or product of enzyme EC 2.3.-.- Is a reactant or product of enzyme EC 2.6.1.33 Is a reactant or product of enzyme EC 2.7.1.24 Is a reactant or product of enzyme EC 2.7.8.7 Is a reactant or product of enzyme EC 3.1.2.1 Is a reactant or product of enzyme EC 3.1.2.2 Is a reactant or product of enzyme EC 3.1.2.3 Is a reactant or product of enzyme EC 3.1.2.4 Is a reactant or product of enzyme EC 3.1.2.5 Is a reactant or product of enzyme EC 3.1.2.10 Is a reactant or product of enzyme EC 3.1.2.11 Is a reactant or product of enzyme EC 3.1.2.17 Is a reactant or product of enzyme EC 3.1.2.18 Is a reactant or product of enzyme EC 3.1.2.19 Is a reactant or product of enzyme EC 3.1.2.20 Is a reactant or product of enzyme EC 3.1.2.22 Is a reactant or product of enzyme EC 3.1.2.23 Is a reactant or product of enzyme EC 3.1.2.- Is a reactant or product of enzyme EC 4.1.3.36 Is a reactant or product of enzyme EC 4.1.3.- Is a reactant or product of enzyme EC 6.2.1.1 Is a reactant or product of enzyme EC 6.2.1.2 Is a reactant or product of enzyme EC 6.2.1.3 Is a reactant or product of enzyme EC 6.2.1.4 Is a reactant or product of enzyme EC 6.2.1.5 Is a reactant or product of enzyme EC 6.2.1.6 Is a reactant or product of enzyme EC 6.2.1.7 Is a reactant or product of enzyme EC 6.2.1.8 Is a reactant or product of enzyme EC 6.2.1.9 Is a reactant or product of enzyme EC 6.2.1.10 Is a reactant or product of enzyme EC 6.2.1.11 Is a reactant or product of enzyme EC 6.2.1.12 Is a reactant or product of enzyme EC 6.2.1.13 Is a reactant or product of enzyme EC 6.2.1.14 Is a reactant or product of enzyme EC 6.2.1.15 Is a reactant or product of enzyme EC 6.2.1.16 Is a reactant or product of enzyme EC 6.2.1.17 Is a reactant or product of enzyme EC 6.2.1.18 Is a reactant or product of enzyme EC 6.2.1.23 Is a reactant or product of enzyme EC 6.2.1.24 Is a reactant or product of enzyme EC 6.2.1.25 Is a reactant or product of enzyme EC 6.2.1.26 Is a reactant or product of enzyme EC 6.2.1.27 Is a reactant or product of enzyme EC 6.2.1.28 Is a reactant or product of enzyme EC 6.2.1.29 Is a reactant or product of enzyme EC 6.2.1.30 Is a reactant or product of enzyme EC 6.2.1.31 Is a reactant or product of enzyme EC 6.2.1.32 Is a reactant or product of enzyme EC 6.2.1.33 Is a reactant or product of enzyme EC 6.2.1.34 Is a reactant or product of enzyme EC 6.2.1.- > 85-61-0 C00010 CoA CoA-SH Coenzyme A > 85-61-0 > C00010 > 229747 230457 230823 230967 442864 442865 442866 442867 442868 442869 443087 443088 493858 493871 493937 494262 494263 494294 494878 494879 640367 640368 809279 1064951 1064952 1064957 1065085 1065086 1065087 1065088 1311280 1421660 1633234 1633235 1633236 1942194 1942195 1942691 1942692 2392097 2392098 2554694 3402005 3891785 3891863 3891864 4139448 4139825 4557950 4558091 4558092 4558102 4558103 4558104 4558105 4558106 4558221 4558222 4929869 4929920 5542119 5821865 5821886 5821988 5821989 5821990 5822009 5822444 5822445 5822495 5822496 5822497 5822498 6137613 6573501 6573502 6573503 6573504 6730181 6730182 6730550 6730551 6730552 6730553 6730554 6730555 6730556 6730557 6730585 6730586 6980559 6980560 6980727 6980728 6980729 6980730 6980731 6980732 6980733 6980734 7245353 7245354 7245355 7245356 7245357 7245358 7245359 7245360 7245361 7245362 7245363 7245364 7245717 7245718 7245719 7245808 7245809 7245988 7245989 7245990 7245991 7766908 7766909 7766963 7766964 7766965 7766966 7766967 7766968 7766969 7766970 7767028 7767029 7767030 7767031 8569373 8569374 8569436 8569437 9954927 9955019 9955020 9955021 9955022 9955297 9955298 9955299 9955300 9955301 9955302 9955303 9955304 9955321 9955322 9955323 9955324 10120827 10120828 10120829 10120830 10120831 10120832 10120833 10120834 10835612 10835613 11513728 11513729 11513730 11513731 12084276 12084277 12084278 12084279 12084280 12084281 12084461 12084604 12084728 13096235 13096236 13096639 14277743 14277744 14277745 14277746 14277747 14277748 14277749 14277750 14277753 14277754 14277755 14277756 14277757 14277758 14277848 14277849 14277850 14277851 14277852 14277853 14277854 14277855 14277856 14277857 14277858 14277859 14277860 14277861 14277862 14277863 14277864 14277865 14277866 14277867 14277868 14277869 14277870 14277871 14278152 14278153 14278218 14278219 14278220 14278221 14278222 14278223 14278224 14278225 14278241 14278242 14278243 14278244 14278623 14278624 14278625 14278626 14278633 14278634 14278635 14278636 14719507 14719508 14719509 14719510 14719511 14719512 14719535 14719536 14719537 14719538 14719539 14719540 14719541 14719783 14719784 15826394 15826395 15826602 15826603 15826604 15826605 15988400 15988401 15988402 15988403 15988404 15988405 15988406 15988407 15988408 16974972 16975186 16975187 17942894 17943398 17943399 17943400 17943401 17943402 17943403 17943404 17943418 17943419 17943420 17943421 18158649 18158650 18158651 18158652 18158653 18655523 18655524 18655525 18655526 18655527 18655528 18655529 18655530 20150772 20150773 20151068 20151069 20151070 20663909 20664162 20664163 20664164 20664173 20664174 20664175 20664178 20664179 20664180 20664183 20664184 20664185 21466132 21466133 21466134 21730255 21730256 21730257 21730258 21730597 22218878 22219207 22219208 22219354 22219355 24987297 24987298 24987299 24987300 27065512 27065513 27065514 27065515 27065519 27065520 27065521 27065522 27065540 27065541 27065542 27065543 27065551 27065552 27065553 27065554 27065565 27065566 27065567 27065568 27065572 27065573 27065574 27065575 27065814 27573654 27573655 27573656 27573657 27573658 27573659 27574020 27574021 27574022 27574023 27574121 28373757 28373758 28373853 28373854 28373855 28373991 28373992 28373993 28373994 28373995 28373996 28374075 29726291 29726292 29726293 29726294 29726295 29726335 29726336 29726705 30750044 30750045 30750046 30750047 30750048 30750145 30750146 30750147 30750148 31616027 31616028 31616029 31616030 33357425 33357459 33357460 33357461 33357462 33357505 33357506 33357507 33357508 33357509 33357510 33357511 33357512 33357657 33357658 33357659 33357757 33357859 33357860 34809669 34809670 34810083 37926496 37927801 37927802 37927807 37927808 37927810 37927811 38493001 38493002 39654837 39654838 40889941 40889942 40889943 40889952 40889953 40889954 40890021 40890022 40890023 42543383 42543384 42543385 42543386 42543387 42543388 42543389 42543390 42543391 42543392 42543393 42543394 42543395 42543396 42543397 42543398 42543399 42543400 42543401 42543402 42543403 42543404 42543405 42543406 42543701 46015312 46015313 46015314 46015315 46015765 47168330 47168331 47168332 47168333 47168414 47168415 47168416 47168417 47168816 47168817 47168898 48425286 48425287 49258334 49258335 49258336 49258337 49258338 49258339 49258340 49258341 49258382 49258383 49258384 49258385 49258450 49258451 49258452 49258453 49258454 49258455 49258456 49258457 49258458 49258459 49258460 49258461 49258557 49258558 49258877 49258878 49258889 49258890 49258899 49259127 49259128 49259135 49259136 49259137 49259138 49259139 49259140 49259141 49259142 49259143 49259144 49259145 49259229 49259230 49259231 50513348 50513349 50513350 50513351 50513718 50513719 50513720 51247226 51247227 51247228 51247229 51247230 51247231 51247232 51247233 51247234 51247235 51247236 51247237 51247481 51247482 51247527 51247528 51247529 51247564 51247565 51247639 51247640 51247641 51247642 51247643 51247644 51247645 51247646 51247723 51247724 51247725 51247726 51247727 51247728 51247729 51247730 51247848 51247849 51247878 51247879 51247880 51247881 51248003 51248014 51248015 51248016 51248017 51248018 51248019 51248020 51248021 51248022 51248023 51248024 51248025 52695441 52695442 52695443 52695444 52695445 52695446 56554111 56554112 56554113 56554114 56554115 56554116 56554298 56554592 56554593 56554594 56554595 56554607 56554608 56554609 56554610 56554623 56554624 56554625 56554626 56554627 56554628 56554629 56554630 56554631 56554632 56554633 56554634 56965957 56965958 56965959 56965960 56965961 56965962 56966610 56966611 56966700 56966701 56966702 56966703 56966704 56966705 56966706 56966707 56966708 56966709 56966713 56966714 56966715 56966716 56966717 56966718 56966719 56966720 56966721 56966722 56966846 58176784 58176785 58176786 58176787 58176788 58176789 58177309 58177310 58177311 58177312 58177313 58177314 60593533 60594150 60594151 60594152 60594162 60594431 60594432 61680085 61680086 61680163 61680164 61680165 61680166 61680217 61680218 61680712 62738065 62738066 62738256 62738257 62738258 62738259 62738260 62738906 66360074 66360075 66360076 66360077 66360144 66360210 66360301 66360302 66360676 66360677 67463815 67463816 67463834 67463835 67463893 67463894 67463897 67463898 67463899 67463900 67464436 67464437 71041778 71041779 71041782 71042395 71042396 71042397 71042398 71042399 71042400 71042401 71042402 71042403 71042404 71042405 71042406 71042407 71042408 71042409 71042410 71042782 71042783 71042784 71042785 71042786 71042787 71042788 71042789 71042790 73535380 73535381 73535382 73535383 73535384 73535385 73535386 73536068 73536069 > http://www.genome.jp/kegg/kegg2.html > http://www.genome.jp/dbget-bin/www_bget?cpd+C00010 > 6816 1 > 40 14 5 38 24 6 24 45 8 24 47 8 25 46 8 25 47 8 26 44 8 26 48 8 27 45 8 27 48 8 39 34 6 44 46 8 45 46 8 41 8 5 $$$$