439160 -OEChem-02210610592D 29 29 0 1 0 0 0 0 0999 V2000 4.7208 -0.2959 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0298 0.6552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7208 -0.2959 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3086 -1.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2208 1.2430 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 3.4118 0.6552 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1330 -1.1049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3031 -1.0004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8086 2.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6330 2.0520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4607 0.9642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8909 -1.8094 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 5.8031 1.9475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4787 -2.6184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6999 -1.2216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0819 -2.3972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3332 -0.1989 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1085 -0.1989 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7514 -1.3767 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4795 -1.7009 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9734 0.2168 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3852 -1.6713 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9795 2.6480 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2514 2.3238 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8852 2.6184 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 0.5493 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1676 2.4491 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0953 -2.5536 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6351 -0.6050 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 3 1 0 0 0 0 1 4 1 6 0 0 0 1 17 1 0 0 0 0 2 5 1 0 0 0 0 3 6 1 0 0 0 0 3 7 1 1 0 0 0 3 18 1 0 0 0 0 4 8 1 0 0 0 0 4 19 1 0 0 0 0 4 20 1 0 0 0 0 5 6 1 0 0 0 0 5 9 1 0 0 0 0 5 10 1 0 0 0 0 6 11 1 6 0 0 0 6 21 1 0 0 0 0 7 22 1 0 0 0 0 8 12 1 0 0 0 0 9 13 1 0 0 0 0 9 23 1 0 0 0 0 9 24 1 0 0 0 0 10 25 1 0 0 0 0 11 26 1 0 0 0 0 12 14 1 0 0 0 0 12 15 1 0 0 0 0 12 16 2 0 0 0 0 13 27 1 0 0 0 0 14 28 1 0 0 0 0 15 29 1 0 0 0 0 M END > 1 > 439160 > 9 > 6 > 4 > AAADcQI8YMAAAAAAAAAAAAAAAAAAIAEAAAAAAAAAAAAAAAAAGgAAACAIAACgFAgACAACgBAHAAAAAEAAAACAAAAAAAAAAAAAEBEAAAAAAAIFAEACAAcAAAxgwAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA== > [(2R,3R,4S)-3,4,5-trihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]methoxyphosphonic acid > [(2R,3R,4S)-3,4,5-trihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]methoxyphosphonic acid > [(2R,3R,4S)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxyphosphonic acid > [(2R,3R,4S)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxyphosphonic acid > [(2R,3R,4S)-3,4,5-trihydroxy-5-methylol-tetrahydrofuran-2-yl]methoxyphosphonic acid > InChI=1/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6u/m1/s1/f/h11-12H > -3.512 > C6H13O9P > 260.136 > C(C1C(C(C(O1)(CO)O)O)O)OP(=O)(O)O > C([C@@H]1[C@H]([C@@H](C(O1)(CO)O)O)O)OP(=O)(O)O > 156.91 > 0 > 16 > 3 > 1 > 0 > 0 > 0 > 1 > 1 > 3385 > 2 > KEGG > C00085 > Is a reactant or product of enzyme EC 1.1.1.17 Is a reactant or product of enzyme EC 2.2.1.1 Is a reactant or product of enzyme EC 2.2.1.2 Is a reactant or product of enzyme EC 2.4.1.14 Is a reactant or product of enzyme EC 2.6.1.16 Is a reactant or product of enzyme EC 2.7.1.1 Is a reactant or product of enzyme EC 2.7.1.4 Is a reactant or product of enzyme EC 2.7.1.11 Is a reactant or product of enzyme EC 2.7.1.90 Is a reactant or product of enzyme EC 2.7.1.105 Is a reactant or product of enzyme EC 2.7.1.146 Is a reactant or product of enzyme EC 3.1.3.11 Is a reactant or product of enzyme EC 3.1.3.46 Is a reactant or product of enzyme EC 3.5.99.6 Is a reactant or product of enzyme EC 4.1.2.9 Is a reactant or product of enzyme EC 4.1.2.22 Is a reactant or product of enzyme EC 5.3.1.8 Is a reactant or product of enzyme EC 5.3.1.9 Is a reactant or product of enzyme EC 5.-.-.- > 643-13-0 C00085 D-Fructose 6-phosphate D-Fructose 6-phosphoric acid Neuberg ester > 643-13-0 > C00085 > 229903 229904 229993 230242 230243 230244 230506 230507 230658 230659 230660 230661 230790 230854 230855 230908 231009 231010 231011 231012 231058 231138 231139 442888 442889 442890 442891 442892 442893 442894 442895 442896 442897 442898 442899 442911 442912 515259 515260 809401 809402 809440 809441 809442 809443 809444 809445 999621 999622 999623 999624 999828 999829 999832 999833 999834 999835 999838 999839 1311146 1311147 1311148 1311149 1633050 1633051 1633052 1633053 1633395 1633396 1633397 1633398 1633399 1633400 1633401 1633402 1941982 1941983 1941990 1942293 1942294 1942586 1942587 1942588 1942589 1942590 1942591 2392330 2392331 2392593 2392594 2554912 2554913 2624499 2914269 2914270 3212468 3212469 3319075 3319076 3745751 3745752 3891376 5107491 5107572 5542103 5542104 5542527 5822132 6137441 6573505 6573639 6573640 6729708 6729954 6729955 6730296 6730297 6730298 6730299 6730303 6730304 6730305 6730306 6730311 6730312 6730313 6730314 7245352 7245424 7245763 7245764 9955241 9955242 10121019 10121020 10121021 10121022 10121023 10835796 10835797 11514531 11514533 11514534 14277922 14277923 14277924 14277925 14277926 14277927 14277928 14277929 14277930 14277931 14278239 14488628 14488629 14488680 15826114 15826115 17942686 17942687 17942688 20149857 20149858 20150540 21465638 21465639 21465640 21465641 21465895 21465896 21465959 21465960 21466040 21466041 21466042 21466043 21466044 21466045 21466046 21466047 21466048 21466049 21730305 21730379 21730380 21730381 21730382 22218827 24158668 24158669 24987288 24987483 24987484 24987565 24987566 27573692 27573693 27573982 27573983 27573984 27573985 27573986 27573987 27573988 27573989 28948382 28948383 28948384 28948422 28948423 28948424 28948425 28948769 28948770 28949023 33356831 33356832 33356833 33356834 33356835 33357491 33357492 33357493 33357494 33357496 33357497 33357498 33357499 33357500 33357501 33357502 33357503 33357504 33358167 33358168 37926898 37926899 37926900 37926901 37926902 37926903 39654660 39654661 40889466 40889467 40889473 40889474 40889475 40889476 46014898 46014899 46014900 46014901 46014902 46014903 46015375 46015376 47169424 47169425 50513338 50513682 51247785 51247786 51247787 51247788 51247850 55670153 55670154 55670838 55670839 55670840 55670841 56554050 56554051 56554060 56554061 56554062 56554063 56554097 56554098 56554099 56554100 56554101 56554102 56554404 56554405 56554406 56554407 56554463 56965908 56965909 58177030 58177031 58177032 58177033 58177034 58177035 58177036 58177037 58177038 58177039 58177040 58177041 58177042 58177043 58177044 58177045 58177046 58177047 58177048 58177049 58177277 58177278 58177279 58177280 60593942 60593943 60593944 60593945 60593946 60593947 60593948 60593949 60593950 60593951 62738516 62738517 62738819 62738850 62738851 62738852 62739000 62739001 62739002 62739003 73536163 > http://www.genome.jp/kegg/kegg2.html > http://www.genome.jp/dbget-bin/www_bget?cpd+C00085 > 439160 1 > 1 4 6 3 7 5 5 9 3 6 11 6 $$$$