439154 -OEChem-02210610582D 86 91 0 1 0 0 0 0 0999 V2000 9.7310 -8.1789 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7310 -4.8696 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6006 5.2559 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9127 6.5159 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8559 2.6788 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4828 3.2333 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8076 3.8134 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5858 4.7106 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6416 -7.0127 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4179 -7.8605 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2657 -8.0841 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2657 -4.9644 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4179 -5.1880 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6416 -6.0358 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7642 2.8681 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3657 3.5584 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0944 -4.6319 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6958 -3.9416 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3623 -1.6319 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9638 -0.9416 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9249 -3.6243 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7517 -3.3243 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3106 -3.4243 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6856 -7.3571 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1413 8.4484 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2094 8.5588 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5765 1.8993 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4583 3.1412 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2148 -4.2143 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3488 -2.7143 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4838 -1.9043 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7238 -7.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7238 -5.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1028 5.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2960 6.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8177 -7.0451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8177 -6.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6178 -7.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7229 6.7923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6178 -6.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3498 -7.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8257 5.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8100 7.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2437 -7.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3498 -6.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1498 -6.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3741 3.0690 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7050 3.8122 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2876 3.4757 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2050 4.6782 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9537 -7.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9537 -5.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1537 2.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4838 -4.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7517 -1.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6178 -4.0243 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 9.7517 -2.5243 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 10.6178 -3.0243 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 3.0156 5.2112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 6.6142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6328 7.1927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 11.4838 -7.5243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.2437 -5.4896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.1498 -7.0451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.7982 5.5917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 11.4838 -5.5243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.7072 8.1953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.5197 2.3418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8857 -0.0243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.2322 -8.5588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0139 -5.5001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5197 0.6097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8857 -0.0243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1831 4.4703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1662 2.0909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7104 3.7076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7517 -4.5243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8857 -3.0243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4838 -2.5243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1537 1.9757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8857 -1.0243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8857 0.9757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0197 1.4757 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 8.8857 -0.0243 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 9.1397 2.3418 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5757 -0.5612 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 32 1 0 0 0 0 2 33 1 0 0 0 0 3 34 1 0 0 0 0 4 35 1 0 0 0 0 5 47 1 0 0 0 0 6 48 1 0 0 0 0 7 49 1 0 0 0 0 8 50 1 0 0 0 0 9 51 1 0 0 0 0 10 51 1 0 0 0 0 11 51 1 0 0 0 0 12 52 1 0 0 0 0 13 52 1 0 0 0 0 14 52 1 0 0 0 0 15 53 1 0 0 0 0 16 53 1 0 0 0 0 17 54 1 0 0 0 0 18 54 1 0 0 0 0 19 55 1 0 0 0 0 20 55 1 0 0 0 0 21 56 1 0 0 0 0 22 57 1 0 0 0 0 23 58 1 0 0 0 0 24 64 1 0 0 0 0 25 67 1 0 0 0 0 26 67 1 0 0 0 0 27 75 1 0 0 0 0 28 76 1 0 0 0 0 29 77 1 0 0 0 0 30 78 1 0 0 0 0 31 79 1 0 0 0 0 32 36 2 0 0 0 0 32 38 1 0 0 0 0 33 37 2 0 0 0 0 33 40 1 0 0 0 0 34 59 2 0 0 0 0 34 60 1 0 0 0 0 35 61 2 0 0 0 0 35 65 1 0 0 0 0 36 37 1 0 0 0 0 36 51 1 0 0 0 0 37 52 1 0 0 0 0 38 40 2 0 0 0 0 38 62 1 0 0 0 0 39 42 2 0 0 0 0 39 43 1 0 0 0 0 39 61 1 0 0 0 0 40 66 1 0 0 0 0 41 44 1 0 0 0 0 41 45 1 0 0 0 0 41 62 2 0 0 0 0 42 59 1 0 0 0 0 42 65 1 0 0 0 0 43 60 2 0 0 0 0 43 67 1 0 0 0 0 44 64 1 0 0 0 0 44 70 2 0 0 0 0 45 63 2 0 0 0 0 45 66 1 0 0 0 0 46 63 1 0 0 0 0 46 64 1 0 0 0 0 46 71 2 0 0 0 0 47 48 1 0 0 0 0 47 49 1 0 0 0 0 47 75 1 1 0 0 0 48 50 1 0 0 0 0 48 76 1 1 0 0 0 49 53 1 6 0 0 0 49 74 1 0 0 0 0 50 65 1 6 0 0 0 50 74 1 0 0 0 0 53 80 1 0 0 0 0 54 56 1 0 0 0 0 54 66 1 0 0 0 0 55 57 1 0 0 0 0 55 81 1 0 0 0 0 56 58 1 0 0 0 0 56 77 1 0 0 0 0 57 58 1 0 0 0 0 57 78 1 0 0 0 0 58 79 1 0 0 0 0 68 83 1 0 0 0 0 68 85 1 0 0 0 0 69 84 1 0 0 0 0 69 86 1 0 0 0 0 72 83 2 0 0 0 0 73 84 2 0 0 0 0 80 83 1 0 0 0 0 81 84 1 0 0 0 0 82 83 1 0 0 0 0 82 84 1 0 0 0 0 M END > 1 > 439154 > 23 > 9 > 13 > AAADcQP8e/AAAAAAAAAAAAAAAABAYgEAQDwAAAAAAIGBWAAAHgAA/CAIEADhHAwA8DcGnxAXzL9zJ0OogIKAdKASMS0oIdgBeIuYdNHZwCpvCGSeyNsihYqw8CcAAIgOABAAQAAAECAAIACAAAAAQAAAAA== > InChI=1/C27H33N9O15P2/c1-10-3-12-13(4-11(10)2)35(24-18(32-12)25(42)34-27(43)33-24)5-14(37)19(39)15(38)6-48-52(44,45)51-53(46,47)49-7-16-20(40)21(41)26(50-16)36-9-31-17-22(28)29-8-30-23(17)36/h3-4,8-9,14-16,19-21,26,37-41H,5-7H2,1-2H3,(H,44,45)(H,46,47)(H2,28,29,30)(H,34,42,43)/t14u,15u,16-,19u,20-,21-,26-/m1/s1/f/h34,44,46H,28H2 > -5.406 > C27H33N9O15P2 > 785.55 > CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)N5C=NC6=C5N=CN=C6N)O)O)O)O)O > CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OC[C@@H]4[C@H]([C@H]([C@@H](O4)N5C=NC6=C5N=CN=C6N)O)O)O)O)O > 356.42 > 0 > 53 > 4 > 3 > 0 > 0 > 0 > 1 > 9 > 3318 > 2 > KEGG > C00016 > Is a reactant or product of enzyme EC 1.1.1.158 Is a reactant or product of enzyme EC 1.1.2.4 Is a reactant or product of enzyme EC 1.1.3.3 Is a reactant or product of enzyme EC 1.1.3.4 Is a reactant or product of enzyme EC 1.1.3.8 Is a reactant or product of enzyme EC 1.1.3.10 Is a reactant or product of enzyme EC 1.1.3.12 Is a reactant or product of enzyme EC 1.1.3.13 Is a reactant or product of enzyme EC 1.1.3.17 Is a reactant or product of enzyme EC 1.1.3.19 Is a reactant or product of enzyme EC 1.1.3.21 Is a reactant or product of enzyme EC 1.1.3.23 Is a reactant or product of enzyme EC 1.1.3.24 Is a reactant or product of enzyme EC 1.1.3.37 Is a reactant or product of enzyme EC 1.1.3.38 Is a reactant or product of enzyme EC 1.1.99.1 Is a reactant or product of enzyme EC 1.1.99.2 Is a reactant or product of enzyme EC 1.1.99.3 Is a reactant or product of enzyme EC 1.1.99.3 Is a reactant or product of enzyme EC 1.1.99.4 Is a reactant or product of enzyme EC 1.1.99.5 Is a reactant or product of enzyme EC 1.1.99.6 Is a reactant or product of enzyme EC 1.1.99.9 Is a reactant or product of enzyme EC 1.1.99.10 Is a reactant or product of enzyme EC 1.1.99.13 Is a reactant or product of enzyme EC 1.1.99.13 Is a reactant or product of enzyme EC 1.1.99.16 Is a reactant or product of enzyme EC 1.1.99.16 Is a reactant or product of enzyme EC 1.1.99.18 Is a reactant or product of enzyme EC 1.1.99.21 Is a reactant or product of enzyme EC 1.1.99.21 Is a reactant or product of enzyme EC 1.2.1.36 Is a reactant or product of enzyme EC 1.2.1.58 Is a reactant or product of enzyme EC 1.2.2.2 Is a reactant or product of enzyme EC 1.2.3.1 Is a reactant or product of enzyme EC 1.2.3.3 Is a reactant or product of enzyme EC 1.2.3.4 Is a reactant or product of enzyme EC 1.2.3.6 Is a reactant or product of enzyme EC 1.2.3.7 Is a reactant or product of enzyme EC 1.3.1.14 Is a reactant or product of enzyme EC 1.3.1.15 Is a reactant or product of enzyme EC 1.3.1.31 Is a reactant or product of enzyme EC 1.3.1.52 Is a reactant or product of enzyme EC 1.3.3.1 Is a reactant or product of enzyme EC 1.3.3.2 Is a reactant or product of enzyme EC 1.3.3.6 Is a reactant or product of enzyme EC 1.3.3.6 Is a reactant or product of enzyme EC 1.3.5.1 Is a reactant or product of enzyme EC 1.3.99.1 Is a reactant or product of enzyme EC 1.3.99.1 Is a reactant or product of enzyme EC 1.3.99.2 Is a reactant or product of enzyme EC 1.3.99.2 Is a reactant or product of enzyme EC 1.3.99.3 Is a reactant or product of enzyme EC 1.3.99.3 Is a reactant or product of enzyme EC 1.3.99.7 Is a reactant or product of enzyme EC 1.3.99.7 Is a reactant or product of enzyme EC 1.3.99.10 Is a reactant or product of enzyme EC 1.3.99.10 Is a reactant or product of enzyme EC 1.3.99.12 Is a reactant or product of enzyme EC 1.3.99.13 Is a reactant or product of enzyme EC 1.3.99.13 Is a reactant or product of enzyme EC 1.3.99.- Is a reactant or product of enzyme EC 1.4.1.13 Is a reactant or product of enzyme EC 1.4.3.1 Is a reactant or product of enzyme EC 1.4.3.2 Is a reactant or product of enzyme EC 1.4.3.3 Is a reactant or product of enzyme EC 1.4.3.4 Is a reactant or product of enzyme EC 1.4.3.10 Is a reactant or product of enzyme EC 1.4.3.11 Is a reactant or product of enzyme EC 1.4.3.12 Is a reactant or product of enzyme EC 1.4.3.15 Is a reactant or product of enzyme EC 1.4.3.16 Is a reactant or product of enzyme EC 1.4.7.1 Is a reactant or product of enzyme EC 1.4.99.1 Is a reactant or product of enzyme EC 1.5.1.12 Is a reactant or product of enzyme EC 1.5.1.20 Is a reactant or product of enzyme EC 1.5.1.20 Is a reactant or product of enzyme EC 1.5.3.1 Is a reactant or product of enzyme EC 1.5.3.2 Is a reactant or product of enzyme EC 1.5.3.5 Is a reactant or product of enzyme EC 1.5.3.6 Is a reactant or product of enzyme EC 1.5.3.10 Is a reactant or product of enzyme EC 1.5.3.11 Is a reactant or product of enzyme EC 1.5.5.1 Is a reactant or product of enzyme EC 1.5.99.2 Is a reactant or product of enzyme EC 1.5.99.3 Is a reactant or product of enzyme EC 1.5.99.6 Is a reactant or product of enzyme EC 1.5.99.8 Is a reactant or product of enzyme EC 1.6.1.1 Is a reactant or product of enzyme EC 1.6.2.2 Is a reactant or product of enzyme EC 1.6.2.4 Is a reactant or product of enzyme EC 1.6.2.5 Is a reactant or product of enzyme EC 1.6.5.2 Is a reactant or product of enzyme EC 1.6.5.3 Is a reactant or product of enzyme EC 1.6.6.9 Is a reactant or product of enzyme EC 1.6.99.1 Is a reactant or product of enzyme EC 1.6.99.3 Is a reactant or product of enzyme EC 1.6.99.6 Is a reactant or product of enzyme EC 1.7.1.1 Is a reactant or product of enzyme EC 1.7.1.2 Is a reactant or product of enzyme EC 1.7.1.3 Is a reactant or product of enzyme EC 1.7.1.4 Is a reactant or product of enzyme EC 1.7.2.1 Is a reactant or product of enzyme EC 1.7.99.1 Is a reactant or product of enzyme EC 1.8.1.2 Is a reactant or product of enzyme EC 1.8.1.4 Is a reactant or product of enzyme EC 1.8.1.7 Is a reactant or product of enzyme EC 1.8.1.9 Is a reactant or product of enzyme EC 1.8.1.10 Is a reactant or product of enzyme EC 1.8.1.12 Is a reactant or product of enzyme EC 1.8.3.3 Is a reactant or product of enzyme EC 1.8.99.2 Is a reactant or product of enzyme EC 1.10.3.4 Is a reactant or product of enzyme EC 1.11.1.1 Is a reactant or product of enzyme EC 1.12.1.2 Is a reactant or product of enzyme EC 1.13.12.1 Is a reactant or product of enzyme EC 1.13.12.2 Is a reactant or product of enzyme EC 1.13.12.11 Is a reactant or product of enzyme EC 1.14.12.3 Is a reactant or product of enzyme EC 1.14.12.4 Is a reactant or product of enzyme EC 1.14.12.5 Is a reactant or product of enzyme EC 1.14.12.10 Is a reactant or product of enzyme EC 1.14.13.1 Is a reactant or product of enzyme EC 1.14.13.2 Is a reactant or product of enzyme EC 1.14.13.3 Is a reactant or product of enzyme EC 1.14.13.4 Is a reactant or product of enzyme EC 1.14.13.5 Is a reactant or product of enzyme EC 1.14.13.6 Is a reactant or product of enzyme EC 1.14.13.7 Is a reactant or product of enzyme EC 1.14.13.8 Is a reactant or product of enzyme EC 1.14.13.9 Is a reactant or product of enzyme EC 1.14.13.10 Is a reactant or product of enzyme EC 1.14.13.18 Is a reactant or product of enzyme EC 1.14.13.19 Is a reactant or product of enzyme EC 1.14.13.20 Is a reactant or product of enzyme EC 1.14.13.22 Is a reactant or product of enzyme EC 1.14.13.23 Is a reactant or product of enzyme EC 1.14.13.24 Is a reactant or product of enzyme EC 1.14.13.27 Is a reactant or product of enzyme EC 1.14.13.29 Is a reactant or product of enzyme EC 1.14.13.32 Is a reactant or product of enzyme EC 1.14.13.33 Is a reactant or product of enzyme EC 1.14.13.40 Is a reactant or product of enzyme EC 1.14.13.63 Is a reactant or product of enzyme EC 1.14.13.64 Is a reactant or product of enzyme EC 1.14.13.- Is a reactant or product of enzyme EC 1.14.99.3 Is a reactant or product of enzyme EC 1.14.99.7 Is a reactant or product of enzyme EC 1.14.99.21 Is a reactant or product of enzyme EC 1.16.1.3 Is a reactant or product of enzyme EC 1.16.1.4 Is a reactant or product of enzyme EC 1.16.1.5 Is a reactant or product of enzyme EC 1.16.1.6 Is a reactant or product of enzyme EC 1.17.1.5 Is a reactant or product of enzyme EC 1.17.3.2 Is a reactant or product of enzyme EC 1.17.99.1 Is a reactant or product of enzyme EC 1.18.1.1 Is a reactant or product of enzyme EC 1.18.1.2 Is a reactant or product of enzyme EC 1.21.99.1 Is a reactant or product of enzyme EC 2.1.1.13 Is a reactant or product of enzyme EC 2.1.1.74 Is a reactant or product of enzyme EC 2.1.1.148 Is a reactant or product of enzyme EC 2.2.1.6 Is a reactant or product of enzyme EC 2.7.7.2 Is a reactant or product of enzyme EC 3.6.1.9 Is a reactant or product of enzyme EC 3.6.1.18 Is a reactant or product of enzyme EC 4.1.1.47 Is a reactant or product of enzyme EC 4.1.99.3 > 146-14-5 C00016 FAD Flavin adenine dinucleotide > 146-14-5 > C00016 > 230246 230663 442927 494262 494263 494294 494414 494456 494457 494458 494459 494823 494878 494879 640342 640343 640344 640345 640346 640350 640351 640352 640353 809279 809322 809323 996181 999766 999768 999771 999817 999857 999858 999859 999860 999997 1065138 1065139 1065243 1065244 1065268 1065270 1065272 1065318 1421187 1421191 1421203 1421660 1633194 1633195 1633196 1633197 1633198 1633199 1633200 1633201 1633209 1633210 1633234 1633235 1633236 1633393 1827629 1827631 1827916 1827917 1941977 1942624 1942777 2098351 2098352 2098406 2098437 2098479 2194029 2392241 2392242 2392243 2392244 2392245 2392246 2392247 2392248 2392255 2392256 2392257 2392258 2392259 2392260 2392261 2392262 2392308 2392309 2392310 2392311 2392312 2392313 2392314 2392315 2554655 2554661 2624510 2624511 2624512 2624513 2624595 2624596 2624685 2624686 2624729 2624730 2624863 2624864 2624865 2624866 2624867 2624868 2781046 2914543 2914552 2914557 2914558 2914563 2914564 2914567 2914568 2914576 2914577 2914604 2914646 3212539 3212540 3212541 3212542 3318897 3318898 3318899 3318900 3318958 3318959 3660005 3660016 3660017 3660331 3660332 3891549 4699615 4699636 4930011 4930012 4930013 4930018 4930119 4930120 4930121 4930122 4930123 4930124 4930128 4930129 5107503 5107587 5107588 5822225 5822226 5822227 5822228 5822229 5822230 6573307 6573308 6573309 6573310 6573311 6573312 6573376 6729754 6729755 6729757 6729758 6729801 6730081 6730082 6730083 6730084 6730359 6730360 6730361 6730362 6730363 6730364 6730365 6730366 6730464 6730465 6730466 6730467 6730468 6730469 6730470 6730471 6730472 6730473 6730474 6730475 6980424 6980460 6980890 7246021 7246022 7546627 7546628 7767103 7767104 7767105 8569319 9955321 9955322 9955323 9955324 9955357 9955358 9955361 9955362 10120751 10120752 10120753 10120754 10120755 10120756 10120757 10120758 10120759 10120760 10120761 10120762 10835627 10835628 10835815 10835816 11513459 11513463 11513748 11513749 11513750 11514094 11514095 11514353 11514354 11514762 12084180 12084181 12084636 12084637 12084638 12084639 12084640 12084641 12084642 12084643 12084644 12084645 13096126 13096127 13096128 13096165 13096166 13096167 13096168 13096169 13096271 13096272 13096273 13096274 13096275 13096276 13096277 13096278 13096279 13096280 13096281 13096282 13096283 13096284 13096285 13096500 13096501 13096502 13096503 13096504 13096505 13399607 13399608 13399609 13399610 13399611 13399908 13399909 13787122 14278154 14278247 14278675 14278676 14278677 14278678 14278679 14278680 14278681 14278682 14278683 14278684 14278685 14278686 14488707 14488721 14488722 14488723 14719468 14719489 14719490 14719491 14719492 15825726 15825727 15825728 15825729 15826394 15826395 15826611 15826612 15826613 15826744 15826745 15826746 15826747 15826748 15826749 15988209 15988210 16974900 16974901 16974902 16974903 16974904 16974905 16974912 16974913 17942695 17942696 17942830 17942836 17942894 17942911 17942912 17943394 17943395 17943396 17943405 18158881 18158882 20149792 20149793 20150473 20150474 20150475 20150476 20150477 20150478 20150479 20150480 20150494 20150495 20150623 20150624 20150625 20150748 20150749 20150750 20150751 20150752 20150753 20150754 20150755 20150760 20150761 20150762 20150763 20150764 20150765 20150766 20150767 20151163 20151164 20151165 20151166 20151167 20151168 20151169 20151170 20151222 20151223 20663870 20663871 20664127 20664130 20664323 20664324 21465636 21466151 21730170 22218794 22218795 22218796 22218813 22219247 22219248 22219249 23200167 23200168 23200283 23200284 23200285 23200321 23200322 23200323 23200324 23200325 23200326 24987242 24987243 24987244 24987245 24987253 24987261 24987596 24987597 24987715 24987716 24987883 24987884 27065342 27065343 27065344 27065345 27065347 27065348 27065349 27065350 27065997 27065998 27573645 28373457 28373978 28373979 28948818 28948819 28948820 28948821 28948822 28948823 28948824 28948825 29726291 29726292 29726293 29726294 29726295 29726694 29726695 29726696 29726697 30749263 30749264 30749265 30749266 30749267 30749268 30749906 31615700 31615701 33357687 33357688 33357689 33357690 33358135 33358136 34809590 34809591 34809592 34809593 34809594 34809595 34809596 34809597 34809598 34809599 34809600 34809601 34809915 34809916 34809917 34809918 34810099 34810417 34810418 34810419 34810420 34810421 34810422 34810423 34810424 34810425 34810426 34810427 34810428 34810429 34810430 34810431 34810432 34810433 34810434 34810495 34810496 34810796 34810797 34810798 34810799 34810800 34810801 34810802 34810803 34810804 34810805 34810806 34810807 34810847 34810848 34810849 34810850 34810851 34810852 34810853 34810854 34810855 34810856 34810857 34810858 37926401 37927143 37927145 37927479 37927481 37927484 37927550 37927551 37927552 37927553 39654411 39654412 40889283 40889284 40889285 40889734 40889735 40889736 40889737 47168618 47168619 47168620 47168621 47168622 47168623 47168624 47168625 47168626 47168627 47168629 47168630 47168638 47168916 47168917 47168918 47168919 47168920 47168921 47168985 47168986 47168987 47168988 47168989 47168990 47168991 47168992 47169163 47169164 48425080 48425081 48425082 48425083 48425154 48425155 48425156 48425157 48425158 48425256 48425312 48425898 48425899 49259281 49259282 49259283 49259284 49259285 49259286 49259505 49259506 49259507 50513547 50513548 50513549 50513550 50513590 50513591 50513592 50513730 50513731 50513732 51247342 51247343 51247344 51247345 51247358 51247948 51247985 51247986 51247987 51247988 51247989 51247990 51247991 51247992 52695420 52695421 52695624 52695625 52696048 52696119 55669578 55669579 55669740 55669741 56553865 56553866 56553867 56553868 56554076 56554077 56554078 56554079 56554080 56554081 56554082 56554083 56554196 56966249 56966250 56966949 56966950 56966951 56966952 56966953 56966954 56966955 56966956 56967120 56967121 56967122 56967123 58176771 58176772 58176773 58176774 58176775 58176776 58176777 58176778 58176779 58176780 58176791 58176792 58176793 58176794 58177066 58177067 58177177 58177178 58177179 58177180 60593462 60593694 60593695 61679815 61679816 61680085 61680086 61680914 61680915 61680916 61680917 61680918 61680919 62738266 62738267 62738268 62738269 62738270 62738271 62738319 62738320 62738321 62738322 62738323 62738616 62738617 62738618 62738619 62738830 62738831 62738976 62738977 62738978 71041621 71041622 71041623 71041624 71041630 71041631 71041632 71041633 71041737 71041738 71041739 71041783 71041784 71041785 71041786 71041933 71041934 71041935 71041936 71042051 71042395 71042396 71042397 71042398 71042399 71042400 71042401 71042402 71042403 71042404 71042405 71042406 71042407 71042408 71042409 71042410 71042517 71042612 71042613 71042614 71042615 71042616 71042617 73535574 73535575 73535697 73535698 73535956 73535957 73535958 73535959 73535960 73535961 73535962 73535963 > 58176795 58176796 58176797 58176798 58176799 58176800 58176801 58176802 > http://www.genome.jp/kegg/kegg2.html > http://www.genome.jp/dbget-bin/www_bget?cpd+C00016 > 439154 1 > 32 36 8 32 38 8 33 37 8 33 40 8 34 59 8 34 60 8 35 61 8 35 65 8 36 37 8 38 40 8 38 62 8 39 42 8 39 43 8 39 61 8 40 66 8 41 44 8 41 62 8 42 59 8 42 65 8 43 60 8 44 64 8 45 63 8 45 66 8 46 63 8 46 64 8 47 75 5 48 76 5 49 53 6 50 65 6 56 77 3 57 78 3 58 79 3 $$$$