439155 -OEChem-04260609302D 46 48 0 1 0 0 0 0 0999 V2000 5.3548 1.2890 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 6.7485 -2.3044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7523 -0.1288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7735 5.6278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4025 -1.2125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0587 4.4666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4327 4.1438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -5.7778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6783 -2.9731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6783 -4.5825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -4.2778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -2.7778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.4105 3.9342 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0474 2.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7178 2.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6844 0.5471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9889 -2.0226 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9917 -0.4045 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9405 -1.7152 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9423 -0.7152 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0809 4.6762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -4.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -3.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -4.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2619 -3.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -3.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3154 -2.0532 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3182 -0.3820 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1892 6.0878 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0170 3.6838 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2421 4.7338 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4030 -6.0878 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3291 -6.0878 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2199 4.5242 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6665 2.7299 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4995 1.9505 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2658 3.2727 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0987 2.4934 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3035 1.0363 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1364 0.2569 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4266 -2.4617 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3795 -0.3065 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4934 -1.4347 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4942 -0.9976 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8819 -3.7778 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4631 -2.9678 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 14 1 0 0 0 0 1 16 1 0 0 0 0 19 2 1 1 0 0 0 2 27 1 0 0 0 0 20 3 1 1 0 0 0 3 28 1 0 0 0 0 4 21 1 0 0 0 0 4 29 1 0 0 0 0 5 17 1 0 0 0 0 5 18 1 0 0 0 0 6 21 2 0 0 0 0 13 7 1 6 0 0 0 7 30 1 0 0 0 0 7 31 1 0 0 0 0 8 22 1 0 0 0 0 8 32 1 0 0 0 0 8 33 1 0 0 0 0 17 9 1 6 0 0 0 9 23 1 0 0 0 0 9 25 1 0 0 0 0 10 24 1 0 0 0 0 10 25 2 0 0 0 0 11 22 1 0 0 0 0 11 26 2 0 0 0 0 12 23 2 0 0 0 0 12 26 1 0 0 0 0 13 15 1 0 0 0 0 13 21 1 0 0 0 0 13 34 1 0 0 0 0 14 15 1 0 0 0 0 14 35 1 0 0 0 0 14 36 1 0 0 0 0 15 37 1 0 0 0 0 15 38 1 0 0 0 0 18 16 1 6 0 0 0 16 39 1 0 0 0 0 16 40 1 0 0 0 0 17 19 1 0 0 0 0 17 41 1 0 0 0 0 18 20 1 0 0 0 0 18 42 1 0 0 0 0 19 20 1 0 0 0 0 19 43 1 0 0 0 0 20 44 1 0 0 0 0 22 24 2 0 0 0 0 23 24 1 0 0 0 0 25 45 1 0 0 0 0 26 46 1 0 0 0 0 M END > 1 > 439155 > 11 > 5 > 7 > AAADceBzuABAAAAAAAAAAAAAAAAAAWJAAAAsAAAAAAAAAFgB+AAAHgQQCAAACDzl1waF+L9MFgioAQbxbACAgC0RELABUKGoVBCDWBJgyEAeRAgPEALzACDwAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA== > (2S)-2-amino-4-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methylsulfanyl]butanoic acid > (2S)-2-amino-4-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methylthio]butanoic acid > (2S)-2-amino-4-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methylsulfanyl]butanoic acid > (2S)-2-amino-4-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methylsulfanyl]butanoic acid > (2S)-2-amino-4-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methylthio]butanoic acid > InChI=1/C14H20N6O5S/c15-6(14(23)24)1-2-26-3-7-9(21)10(22)13(25-7)20-5-19-8-11(16)17-4-18-12(8)20/h4-7,9-10,13,21-22H,1-3,15H2,(H,23,24)(H2,16,17,18)/t6-,7+,9+,10+,13+/m0/s1/f/h23H,16H2 > -3.234 > 384.122 > C14H20N6O5S > 384.412 > C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)CSCCC(C(=O)O)N)O)O > C1=NC2=C(C(=N1)N)N=CN2[C@H]3[C@@H]([C@H]([C@@H](O3)CSCC[C@@H](C(=O)O)N)O)O > 182.63 > 384.122 > 0 > 26 > 5 > 0 > 0 > 0 > 0 > 1 > 3 > 3323 > 2 > KEGG > C00021 > Is a reactant or product of enzyme EC 1.16.1.8 Is a reactant or product of enzyme EC 2.1.1.1 Is a reactant or product of enzyme EC 2.1.1.2 Is a reactant or product of enzyme EC 2.1.1.4 Is a reactant or product of enzyme EC 2.1.1.6 Is a reactant or product of enzyme EC 2.1.1.7 Is a reactant or product of enzyme EC 2.1.1.8 Is a reactant or product of enzyme EC 2.1.1.9 Is a reactant or product of enzyme EC 2.1.1.10 Is a reactant or product of enzyme EC 2.1.1.11 Is a reactant or product of enzyme EC 2.1.1.12 Is a reactant or product of enzyme EC 2.1.1.15 Is a reactant or product of enzyme EC 2.1.1.16 Is a reactant or product of enzyme EC 2.1.1.17 Is a reactant or product of enzyme EC 2.1.1.18 Is a reactant or product of enzyme EC 2.1.1.20 Is a reactant or product of enzyme EC 2.1.1.22 Is a reactant or product of enzyme EC 2.1.1.25 Is a reactant or product of enzyme EC 2.1.1.26 Is a reactant or product of enzyme EC 2.1.1.27 Is a reactant or product of enzyme EC 2.1.1.28 Is a reactant or product of enzyme EC 2.1.1.29 Is a reactant or product of enzyme EC 2.1.1.31 Is a reactant or product of enzyme EC 2.1.1.32 Is a reactant or product of enzyme EC 2.1.1.33 Is a reactant or product of enzyme EC 2.1.1.34 Is a reactant or product of enzyme EC 2.1.1.35 Is a reactant or product of enzyme EC 2.1.1.36 Is a reactant or product of enzyme EC 2.1.1.37 Is a reactant or product of enzyme EC 2.1.1.38 Is a reactant or product of enzyme EC 2.1.1.39 Is a reactant or product of enzyme EC 2.1.1.40 Is a reactant or product of enzyme EC 2.1.1.41 Is a reactant or product of enzyme EC 2.1.1.42 Is a reactant or product of enzyme EC 2.1.1.43 Is a reactant or product of enzyme EC 2.1.1.44 Is a reactant or product of enzyme EC 2.1.1.46 Is a reactant or product of enzyme EC 2.1.1.47 Is a reactant or product of enzyme EC 2.1.1.49 Is a reactant or product of enzyme EC 2.1.1.50 Is a reactant or product of enzyme EC 2.1.1.53 Is a reactant or product of enzyme EC 2.1.1.55 Is a reactant or product of enzyme EC 2.1.1.56 Is a reactant or product of enzyme EC 2.1.1.57 Is a reactant or product of enzyme EC 2.1.1.59 Is a reactant or product of enzyme EC 2.1.1.60 Is a reactant or product of enzyme EC 2.1.1.61 Is a reactant or product of enzyme EC 2.1.1.62 Is a reactant or product of enzyme EC 2.1.1.64 Is a reactant or product of enzyme EC 2.1.1.65 Is a reactant or product of enzyme EC 2.1.1.66 Is a reactant or product of enzyme EC 2.1.1.67 Is a reactant or product of enzyme EC 2.1.1.68 Is a reactant or product of enzyme EC 2.1.1.69 Is a reactant or product of enzyme EC 2.1.1.70 Is a reactant or product of enzyme EC 2.1.1.71 Is a reactant or product of enzyme EC 2.1.1.72 Is a reactant or product of enzyme EC 2.1.1.75 Is a reactant or product of enzyme EC 2.1.1.76 Is a reactant or product of enzyme EC 2.1.1.77 Is a reactant or product of enzyme EC 2.1.1.78 Is a reactant or product of enzyme EC 2.1.1.79 Is a reactant or product of enzyme EC 2.1.1.80 Is a reactant or product of enzyme EC 2.1.1.82 Is a reactant or product of enzyme EC 2.1.1.83 Is a reactant or product of enzyme EC 2.1.1.84 Is a reactant or product of enzyme EC 2.1.1.85 Is a reactant or product of enzyme EC 2.1.1.87 Is a reactant or product of enzyme EC 2.1.1.88 Is a reactant or product of enzyme EC 2.1.1.89 Is a reactant or product of enzyme EC 2.1.1.91 Is a reactant or product of enzyme EC 2.1.1.92 Is a reactant or product of enzyme EC 2.1.1.93 Is a reactant or product of enzyme EC 2.1.1.94 Is a reactant or product of enzyme EC 2.1.1.96 Is a reactant or product of enzyme EC 2.1.1.97 Is a reactant or product of enzyme EC 2.1.1.98 Is a reactant or product of enzyme EC 2.1.1.99 Is a reactant or product of enzyme EC 2.1.1.100 Is a reactant or product of enzyme EC 2.1.1.101 Is a reactant or product of enzyme EC 2.1.1.102 Is a reactant or product of enzyme EC 2.1.1.103 Is a reactant or product of enzyme EC 2.1.1.104 Is a reactant or product of enzyme EC 2.1.1.105 Is a reactant or product of enzyme EC 2.1.1.106 Is a reactant or product of enzyme EC 2.1.1.107 Is a reactant or product of enzyme EC 2.1.1.108 Is a reactant or product of enzyme EC 2.1.1.109 Is a reactant or product of enzyme EC 2.1.1.110 Is a reactant or product of enzyme EC 2.1.1.111 Is a reactant or product of enzyme EC 2.1.1.112 Is a reactant or product of enzyme EC 2.1.1.113 Is a reactant or product of enzyme EC 2.1.1.114 Is a reactant or product of enzyme EC 2.1.1.115 Is a reactant or product of enzyme EC 2.1.1.116 Is a reactant or product of enzyme EC 2.1.1.117 Is a reactant or product of enzyme EC 2.1.1.118 Is a reactant or product of enzyme EC 2.1.1.119 Is a reactant or product of enzyme EC 2.1.1.120 Is a reactant or product of enzyme EC 2.1.1.121 Is a reactant or product of enzyme EC 2.1.1.122 Is a reactant or product of enzyme EC 2.1.1.123 Is a reactant or product of enzyme EC 2.1.1.124 Is a reactant or product of enzyme EC 2.1.1.125 Is a reactant or product of enzyme EC 2.1.1.126 Is a reactant or product of enzyme EC 2.1.1.127 Is a reactant or product of enzyme EC 2.1.1.128 Is a reactant or product of enzyme EC 2.1.1.129 Is a reactant or product of enzyme EC 2.1.1.130 Is a reactant or product of enzyme EC 2.1.1.131 Is a reactant or product of enzyme EC 2.1.1.132 Is a reactant or product of enzyme EC 2.1.1.133 Is a reactant or product of enzyme EC 2.1.1.136 Is a reactant or product of enzyme EC 2.1.1.137 Is a reactant or product of enzyme EC 2.1.1.139 Is a reactant or product of enzyme EC 2.1.1.140 Is a reactant or product of enzyme EC 2.1.1.141 Is a reactant or product of enzyme EC 2.1.1.142 Is a reactant or product of enzyme EC 2.1.1.143 Is a reactant or product of enzyme EC 2.1.1.144 Is a reactant or product of enzyme EC 2.1.1.145 Is a reactant or product of enzyme EC 2.1.1.149 Is a reactant or product of enzyme EC 2.1.1.150 Is a reactant or product of enzyme EC 2.1.1.152 Is a reactant or product of enzyme EC 2.1.1.153 Is a reactant or product of enzyme EC 2.1.1.155 Is a reactant or product of enzyme EC 2.1.1.- Is a reactant or product of enzyme EC 3.2.2.9 Is a reactant or product of enzyme EC 3.3.1.1 Is a reactant or product of enzyme EC 3.5.4.28 > 979-92-0 C00021 S-Adenosyl-L-homocysteine S-Adenosylhomocysteine > 979-92-0 > C00021 > 443019 1127162 1127163 1633081 1942354 1942355 1942356 1942357 1942407 1942408 1942410 1942411 2914405 4139415 4139416 4139571 4139572 4139573 4139574 4139941 4139942 4929854 4929855 5107542 5107707 6137381 6137382 6435570 6435571 6435572 6435573 6435574 6435575 6729829 6729995 11514446 12084575 12084576 13096481 13096482 13096483 13096484 13096485 13096486 13096487 13096488 13096489 13096490 13096491 13096492 13096616 13399509 13399510 16975273 16975274 16975275 16975276 16975277 16975278 16975279 16975280 17942640 17942641 17942642 17942643 17942644 17942645 17942646 17943296 17943297 17943330 17943331 18655936 18655937 18655938 18655939 18655940 18655941 18655942 18655943 18655944 18655945 18655946 20150076 20150791 20151018 20151187 20151188 20663549 20663550 22218867 22218868 22218869 22218870 23200180 23200293 23200294 23200295 23200296 23200297 23200298 24158768 24158769 24158796 24158797 24158798 24158799 24158800 24158801 24158802 24158803 24987775 24987776 24987777 24987778 24987800 24987807 27065098 27065099 28948805 28948806 28948807 28948808 28948809 28948810 28948811 28948812 28949094 28949095 28949096 28949097 29726609 29726610 30750119 30750120 30750121 30750122 30750123 30750124 31615498 31615892 33357237 33357238 33357239 33357240 33357815 33357816 33357817 33357822 33357823 33357824 33358175 33358176 33358177 33358178 34810278 34810279 34810280 34810281 34810282 34810283 34810284 34810875 34810876 34810877 34810878 34810984 34810985 34810986 34810987 34811344 37927717 37927719 37927720 38492825 39654256 39654257 39654400 39654401 39654402 39654476 39654477 39654478 39654479 39654480 39654481 40889090 40889091 40889092 40889093 40889537 40889956 40889957 48425869 49258440 50513617 50513618 52695513 52696100 52696101 52696102 52696103 55669632 55669633 55670156 55670157 55670158 56554003 56554255 56554256 56554257 56554258 56965975 56965976 56965977 56965978 56965979 56965980 56965981 56965982 56965983 56965984 56965985 56965986 56966766 56967215 56967216 56967217 56967218 58177307 58177308 60593702 60593703 61680112 61680113 61680524 61680525 61680526 61680527 62737984 62737985 62737986 62737987 62737988 62737989 62737990 62737991 62738114 62738115 62738895 66360292 66360293 66361276 66361277 66361563 66361564 67464239 67464240 67464246 67464247 67464248 67464249 67464250 67464251 67464264 67464265 67464266 67464267 71042360 71042361 71042362 71042363 71042364 71042365 71042366 71042367 71042532 71042533 71042534 71042535 71042599 71042709 71042710 71042711 71042712 73535448 73535449 > 1127158 1127159 1127160 1127161 13399511 13399513 13787182 13787183 37927721 37927722 52695514 52695515 67464241 67464242 67464252 67464253 67464254 67464255 67464256 67464257 67464258 67464259 67464260 67464261 67464268 67464269 67464270 67464271 > http://www.genome.jp/kegg/kegg2.html > http://www.genome.jp/dbget-bin/www_bget?cpd+C00021 > 439155 1 > 10 24 8 10 25 8 11 22 8 11 26 8 12 23 8 12 26 8 18 16 6 19 2 5 22 24 8 23 24 8 20 3 5 13 7 6 17 9 6 9 23 8 9 25 8 $$$$