data_bmse010372 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010372 _Entry.Title lignin_cw_compound_3058 _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2011-07-19 _Entry.Last_release_date 2012-02-24 _Entry.Original_release_date 2011-07-19 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.21 _Entry.Original_NMR_STAR_version 3.1.0.46 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name lignin_cw_compound_3058 loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 Sally Ralph ? ? bmse010372 2 John Ralph ? ? bmse010372 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010372 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 1 bmse010372 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 30 bmse010372 "1H chemical shifts" 26 bmse010372 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2011-07-19 2009-05-26 original Author "Original spectra from USDA" bmse010372 2 2011-09-07 2011-09-07 update BMRB "Ensured correct reference IDs" bmse010372 3 2011-09-09 2011-09-09 update BMRB "Brought up to date with latest Dictionary" bmse010372 4 2011-12-14 2011-12-14 update BMRB "Set Assembly.Name to match Chem_comp.name" bmse010372 5 2011-12-16 2011-12-16 update BMRB "Standardized solvent" bmse010372 6 2012-02-24 2012-02-24 update BMRB "Set Raw_data_flag to no, since there are no raw data" bmse010372 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010372 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type Internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010372 1 2 John Ralph ? ? ? bmse010372 1 3 Larry Landucci ? L. ? bmse010372 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010372 _Assembly.ID 1 _Assembly.Name lignin_cw_compound_3058 _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 $lignin_cw_compound_3058 1 $lignin_cw_compound_3058 yes native no no ? ? ? bmse010372 1 stop_ save_ save_lignin_cw_compound_3058 _Entity.Sf_category entity _Entity.Sf_framecode lignin_cw_compound_3058 _Entity.Entry_ID bmse010372 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name lignin_cw_compound_3058 _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010372 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010372 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $lignin_cw_compound_3058 . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010372 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010372 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $lignin_cw_compound_3058 . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010372 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010372 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name lignin_cw_compound_3058 _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C30H26O9/c1-35-28-16-21(6-9-25(28)34)13-23(18-32)39-27-11-8-22(17-30(27)37-3)14-24(19-33)38-26-10-7-20(5-4-12-31)15-29(26)36-2/h4-19,34H,1-3H3/b5-4+,23-13-,24-14- ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C30 H26 O9' _Chem_comp.Formula_weight 530.52204 _Chem_comp.Formula_mono_iso_wt_nat 530.1576824335 _Chem_comp.Formula_mono_iso_wt_13C 560.2583275675 _Chem_comp.Formula_mono_iso_wt_15N 530.1576824335 _Chem_comp.Formula_mono_iso_wt_13C_15N 560.2583275675 _Chem_comp.Image_file_name standards/lignin_cw_compound_3058/lit/jr_3058.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/lignin_cw_compound_3058/lit/jr_3058.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID Unnamed synonym bmse010372 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID "To be defined" Beilstein bmse010372 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical COC1=C(C=CC(=C1)C=C(C=O)OC2=C(C=C(C=C2)C=C(C=O)OC3=C(C=C(C=CC=O)C=C3)OC)OC)O bmse010372 1 Isomeric COC1=C(C=CC(=C1)C=C(C=O)OC2=C(C=C(C=C2)C=C(C=O)OC3=C(C=C(C=CC=O)C=C3)OC)OC)O bmse010372 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 AOMe C ? ? ? ? 132.1055 55.0000 ? ? ? bmse010372 1 C2 COMe C ? ? ? ? 365.9315 190.0000 ? ? ? bmse010372 1 C3 BOMe C ? ? ? ? 158.0855 160.0000 ? ? ? bmse010372 1 C4 CB C ? ? ? ? 391.9145 325.0000 ? ? ? bmse010372 1 C5 CA C ? ? ? ? 391.9145 295.0000 ? ? ? bmse010372 1 C6 A6 C ? ? ? ? 236.0285 25.0000 ? ? ? bmse010372 1 C7 C6 C ? ? ? ? 339.9515 295.0000 ? ? ? bmse010372 1 C8 B6 C ? ? ? ? 262.0085 190.0000 ? ? ? bmse010372 1 C9 A5 C ? ? ? ? 210.0485 10.0000 ? ? ? bmse010372 1 C10 C5 C ? ? ? ? 313.9715 280.0000 ? ? ? bmse010372 1 C11 B5 C ? ? ? ? 262.0085 160.0000 ? ? ? bmse010372 1 C12 CG C ? ? ? ? 417.8945 340.0000 ? ? ? bmse010372 1 C13 AA C ? ? ? ? 262.0085 70.0000 ? ? ? bmse010372 1 C14 BA C ? ? ? ? 236.0285 235.0000 ? ? ? bmse010372 1 C15 C2 C ? ? ? ? 365.9315 250.0000 ? ? ? bmse010372 1 C16 A2 C ? ? ? ? 210.0485 70.0000 ? ? ? bmse010372 1 C17 B2 C ? ? ? ? 210.0485 190.0000 ? ? ? bmse010372 1 C18 AG C ? ? ? ? 287.9915 115.0000 ? ? ? bmse010372 1 C19 BG C ? ? ? ? 262.0085 280.0000 ? ? ? bmse010372 1 C20 C1 C ? ? ? ? 365.9315 280.0000 ? ? ? bmse010372 1 C21 A1 C ? ? ? ? 236.0285 55.0000 ? ? ? bmse010372 1 C22 B1 C ? ? ? ? 236.0285 205.0000 ? ? ? bmse010372 1 C23 AB C ? ? ? ? 262.0085 100.0000 ? ? ? bmse010372 1 C24 BB C ? ? ? ? 262.0085 250.0000 ? ? ? bmse010372 1 C25 A4 C ? ? ? ? 184.0685 25.0000 ? ? ? bmse010372 1 C26 ? C ? ? ? ? 313.9715 250.0000 ? ? ? bmse010372 1 C27 B4 C ? ? ? ? 236.0285 145.0000 ? ? ? bmse010372 1 C28 A3 C ? ? ? ? 184.0685 55.0000 ? ? ? bmse010372 1 C29 C3 C ? ? ? ? 339.9515 235.0000 ? ? ? bmse010372 1 C30 B3 C ? ? ? ? 210.0485 160.0000 ? ? ? bmse010372 1 O31 ? O ? ? ? ? 417.8945 370.0000 ? ? ? bmse010372 1 O32 ? O ? ? ? ? 313.9715 100.0000 ? ? ? bmse010372 1 O33 ? O ? ? ? ? 236.0285 295.0000 ? ? ? bmse010372 1 O34 ? O ? ? ? ? 158.0855 10.0000 ? ? ? bmse010372 1 O35 ? O ? ? ? ? 158.0855 70.0000 ? ? ? bmse010372 1 O36 ? O ? ? ? ? 339.9515 205.0000 ? ? ? bmse010372 1 O37 ? O ? ? ? ? 184.0685 145.0000 ? ? ? bmse010372 1 O38 ? O ? ? ? ? 287.9915 235.0000 ? ? ? bmse010372 1 O39 ? O ? ? ? ? 236.0285 115.0000 ? ? ? bmse010372 1 H40 AOMe H ? ? ? ? 122.8053 71.1080 ? ? ? bmse010372 1 H41 AOMe H ? ? ? ? 115.9975 45.6998 ? ? ? bmse010372 1 H42 AOMe H ? ? ? ? 141.4057 38.8920 ? ? ? bmse010372 1 H43 COMe H ? ? ? ? 356.6313 173.8920 ? ? ? bmse010372 1 H44 COMe H ? ? ? ? 382.0394 180.6998 ? ? ? bmse010372 1 H45 COMe H ? ? ? ? 375.2317 206.1080 ? ? ? bmse010372 1 H46 BOMe H ? ? ? ? 167.3849 176.1084 ? ? ? bmse010372 1 H47 BOMe H ? ? ? ? 141.9771 169.2994 ? ? ? bmse010372 1 H48 BOMe H ? ? ? ? 148.7861 143.8916 ? ? ? bmse010372 1 H49 CB H ? ? ? ? 375.8064 334.2999 ? ? ? bmse010372 1 H50 CA H ? ? ? ? 408.0224 285.6997 ? ? ? bmse010372 1 H51 A6 H ? ? ? ? 252.1366 15.7001 ? ? ? bmse010372 1 H52 C6 H ? ? ? ? 339.9515 313.6000 ? ? ? bmse010372 1 H53 B6 H ? ? ? ? 278.1166 199.2999 ? ? ? bmse010372 1 H54 A5 H ? ? ? ? 210.0485 -8.6000 ? ? ? bmse010372 1 H55 C5 H ? ? ? ? 297.8634 289.2999 ? ? ? bmse010372 1 H56 B5 H ? ? ? ? 278.1166 150.7001 ? ? ? bmse010372 1 H57 CG H ? ? ? ? 434.0026 330.7001 ? ? ? bmse010372 1 H58 AA H ? ? ? ? 278.1166 60.7001 ? ? ? bmse010372 1 H59 BA H ? ? ? ? 219.9204 244.2999 ? ? ? bmse010372 1 H60 C2 H ? ? ? ? 382.0396 240.7001 ? ? ? bmse010372 1 H61 A2 H ? ? ? ? 210.0485 88.6000 ? ? ? bmse010372 1 H62 B2 H ? ? ? ? 193.9404 199.2999 ? ? ? bmse010372 1 H63 AG H ? ? ? ? 287.9919 133.6000 ? ? ? bmse010372 1 H64 BG H ? ? ? ? 278.1166 289.2999 ? ? ? bmse010372 1 H65 ? H ? ? ? ? 141.9778 19.3006 ? ? ? bmse010372 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010372 1 C2 C2 BMRB bmse010372 1 C3 C3 BMRB bmse010372 1 C4 C4 BMRB bmse010372 1 C5 C5 BMRB bmse010372 1 C6 C6 BMRB bmse010372 1 C7 C7 BMRB bmse010372 1 C8 C8 BMRB bmse010372 1 C9 C9 BMRB bmse010372 1 C10 C10 BMRB bmse010372 1 C11 C11 BMRB bmse010372 1 C12 C12 BMRB bmse010372 1 C13 C13 BMRB bmse010372 1 C14 C14 BMRB bmse010372 1 C15 C15 BMRB bmse010372 1 C16 C16 BMRB bmse010372 1 C17 C17 BMRB bmse010372 1 C18 C18 BMRB bmse010372 1 C19 C19 BMRB bmse010372 1 C20 C20 BMRB bmse010372 1 C21 C21 BMRB bmse010372 1 C22 C22 BMRB bmse010372 1 C23 C23 BMRB bmse010372 1 C24 C24 BMRB bmse010372 1 C25 C25 BMRB bmse010372 1 C26 C26 BMRB bmse010372 1 C27 C27 BMRB bmse010372 1 C28 C28 BMRB bmse010372 1 C29 C29 BMRB bmse010372 1 C30 C30 BMRB bmse010372 1 O31 O31 BMRB bmse010372 1 O32 O32 BMRB bmse010372 1 O33 O33 BMRB bmse010372 1 O34 O34 BMRB bmse010372 1 O35 O35 BMRB bmse010372 1 O36 O36 BMRB bmse010372 1 O37 O37 BMRB bmse010372 1 O38 O38 BMRB bmse010372 1 O39 O39 BMRB bmse010372 1 H40 H40 BMRB bmse010372 1 H41 H41 BMRB bmse010372 1 H42 H42 BMRB bmse010372 1 H43 H43 BMRB bmse010372 1 H44 H44 BMRB bmse010372 1 H45 H45 BMRB bmse010372 1 H46 H46 BMRB bmse010372 1 H47 H47 BMRB bmse010372 1 H48 H48 BMRB bmse010372 1 H49 H49 BMRB bmse010372 1 H50 H50 BMRB bmse010372 1 H51 H51 BMRB bmse010372 1 H52 H52 BMRB bmse010372 1 H53 H53 BMRB bmse010372 1 H54 H54 BMRB bmse010372 1 H55 H55 BMRB bmse010372 1 H56 H56 BMRB bmse010372 1 H57 H57 BMRB bmse010372 1 H58 H58 BMRB bmse010372 1 H59 H59 BMRB bmse010372 1 H60 H60 BMRB bmse010372 1 H61 H61 BMRB bmse010372 1 H62 H62 BMRB bmse010372 1 H63 H63 BMRB bmse010372 1 H64 H64 BMRB bmse010372 1 H65 H65 BMRB bmse010372 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 O35 ? bmse010372 1 2 covalent SING C2 O36 ? bmse010372 1 3 covalent SING C3 O37 ? bmse010372 1 4 covalent DOUB C4 C5 ? bmse010372 1 5 covalent SING C4 C12 ? bmse010372 1 6 covalent SING C5 C20 ? bmse010372 1 7 covalent DOUB C6 C9 ? bmse010372 1 8 covalent SING C6 C21 ? bmse010372 1 9 covalent DOUB C7 C10 ? bmse010372 1 10 covalent SING C7 C20 ? bmse010372 1 11 covalent DOUB C8 C11 ? bmse010372 1 12 covalent SING C8 C22 ? bmse010372 1 13 covalent SING C9 C25 ? bmse010372 1 14 covalent SING C10 C26 ? bmse010372 1 15 covalent SING C11 C27 ? bmse010372 1 16 covalent DOUB C12 O31 ? bmse010372 1 17 covalent SING C13 C21 ? bmse010372 1 18 covalent DOUB C13 C23 ? bmse010372 1 19 covalent SING C14 C22 ? bmse010372 1 20 covalent DOUB C14 C24 ? bmse010372 1 21 covalent DOUB C15 C20 ? bmse010372 1 22 covalent SING C15 C29 ? bmse010372 1 23 covalent DOUB C16 C21 ? bmse010372 1 24 covalent SING C16 C28 ? bmse010372 1 25 covalent DOUB C17 C22 ? bmse010372 1 26 covalent SING C17 C30 ? bmse010372 1 27 covalent SING C18 C23 ? bmse010372 1 28 covalent DOUB C18 O32 ? bmse010372 1 29 covalent SING C19 C24 ? bmse010372 1 30 covalent DOUB C19 O33 ? bmse010372 1 31 covalent SING C23 O39 ? bmse010372 1 32 covalent SING C24 O38 ? bmse010372 1 33 covalent DOUB C25 C28 ? bmse010372 1 34 covalent SING C25 O34 ? bmse010372 1 35 covalent DOUB C26 C29 ? bmse010372 1 36 covalent SING C26 O38 ? bmse010372 1 37 covalent DOUB C27 C30 ? bmse010372 1 38 covalent SING C27 O39 ? bmse010372 1 39 covalent SING C28 O35 ? bmse010372 1 40 covalent SING C29 O36 ? bmse010372 1 41 covalent SING C30 O37 ? bmse010372 1 42 covalent SING C1 H40 ? bmse010372 1 43 covalent SING C1 H41 ? bmse010372 1 44 covalent SING C1 H42 ? bmse010372 1 45 covalent SING C2 H43 ? bmse010372 1 46 covalent SING C2 H44 ? bmse010372 1 47 covalent SING C2 H45 ? bmse010372 1 48 covalent SING C3 H46 ? bmse010372 1 49 covalent SING C3 H47 ? bmse010372 1 50 covalent SING C3 H48 ? bmse010372 1 51 covalent SING C4 H49 ? bmse010372 1 52 covalent SING C5 H50 ? bmse010372 1 53 covalent SING C6 H51 ? bmse010372 1 54 covalent SING C7 H52 ? bmse010372 1 55 covalent SING C8 H53 ? bmse010372 1 56 covalent SING C9 H54 ? bmse010372 1 57 covalent SING C10 H55 ? bmse010372 1 58 covalent SING C11 H56 ? bmse010372 1 59 covalent SING C12 H57 ? bmse010372 1 60 covalent SING C13 H58 ? bmse010372 1 61 covalent SING C14 H59 ? bmse010372 1 62 covalent SING C15 H60 ? bmse010372 1 63 covalent SING C16 H61 ? bmse010372 1 64 covalent SING C17 H62 ? bmse010372 1 65 covalent SING C18 H63 ? bmse010372 1 66 covalent SING C19 H64 ? bmse010372 1 67 covalent SING O34 H65 ? bmse010372 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID yes USDA_NMR_database 3058 "Compound Number" ? lignin_cw_compound_3058 ? "matching entry" ? bmse010372 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010372 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010372 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_3058 "natural abundance" 1 $lignin_cw_compound_3058 ? Solute Saturated ? ? 1 ? "Sally Ralph" lignin_cw_compound_3058 n/a bmse010372 1 2 acetone "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010372 1 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010372 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010372 1 temperature 297 ? K bmse010372 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010372 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010372 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010372 1 stop_ save_ save_Bruker_360 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_360 _NMR_spectrometer.Entry_ID bmse010372 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model DRX _NMR_spectrometer.Field_strength 360 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010372 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 1H" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010372 1 2 "1D 13C" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010372 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010372 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010372 1 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010372 1 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010372 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 1H" 1 $sample_1 bmse010372 1 2 "1D 13C" 1 $sample_1 bmse010372 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010372 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 55.93 ? ? 1 ? ? ? ? ? AOMe ? bmse010372 1 2 ? 1 1 1 1 1 C3 C 13 56.14 ? ? 1 ? ? ? ? ? BOMe ? bmse010372 1 3 ? 1 1 1 1 1 C2 C 13 56.50 ? ? 1 ? ? ? ? ? COMe ? bmse010372 1 4 ? 1 1 1 1 1 C15 C 13 112.55 ? ? 1 ? ? ? ? ? C2 ? bmse010372 1 5 ? 1 1 1 1 1 C16 C 13 113.95 ? ? 1 ? ? ? ? ? A2 ? bmse010372 1 6 ? 1 1 1 1 1 C17 C 13 114.87 ? ? 1 ? ? ? ? ? B2 ? bmse010372 1 7 ? 1 1 1 1 1 C11 C 13 115.18 ? ? 1 ? ? ? ? ? B5 ? bmse010372 1 8 ? 1 1 1 1 1 C10 C 13 115.42 ? ? 1 ? ? ? ? ? C5 ? bmse010372 1 9 ? 1 1 1 1 1 C9 C 13 116.26 ? ? 1 ? ? ? ? ? A5 ? bmse010372 1 10 ? 1 1 1 1 1 C7 C 13 123.59 ? ? 1 ? ? ? ? ? C6 ? bmse010372 1 11 ? 1 1 1 1 1 C21 C 13 125.21 ? ? 1 ? ? ? ? ? A1 ? bmse010372 1 12 ? 1 1 1 1 1 C8 C 13 125.59 ? ? 1 ? ? ? ? ? B6 ? bmse010372 1 13 ? 1 1 1 1 1 C6 C 13 126.78 ? ? 1 ? ? ? ? ? A6 ? bmse010372 1 14 ? 1 1 1 1 1 C22 C 13 128.03 ? ? 1 ? ? ? ? ? B1 ? bmse010372 1 15 ? 1 1 1 1 1 C4 C 13 128.38 ? ? 1 ? ? ? ? ? CB ? bmse010372 1 16 ? 1 1 1 1 1 C20 C 13 130.35 ? ? 1 ? ? ? ? ? C1 ? bmse010372 1 17 ? 1 1 1 1 1 C14 C 13 137.15 ? ? 1 ? ? ? ? ? BA ? bmse010372 1 18 ? 1 1 1 1 1 C13 C 13 138.31 ? ? 1 ? ? ? ? ? AA ? bmse010372 1 19 ? 1 1 1 1 1 C23 C 13 147.52 ? ? 1 ? ? ? ? ? AB ? bmse010372 1 20 ? 1 1 1 1 1 C28 C 13 148.46 ? ? 1 ? ? ? ? ? A3 ? bmse010372 1 21 ? 1 1 1 1 1 C27 C 13 148.47 ? ? 1 ? ? ? ? ? B4 ? bmse010372 1 22 ? 1 1 1 1 1 C24 C 13 148.51 ? ? 1 ? ? ? ? ? BB ? bmse010372 1 23 ? 1 1 1 1 1 C29 C 13 148.72 ? ? 1 ? ? ? ? ? C4 ? bmse010372 1 24 ? 1 1 1 1 1 C30 C 13 149.91 ? ? 1 ? ? ? ? ? B3 ? bmse010372 1 25 ? 1 1 1 1 1 C29 C 13 150.35 ? ? 1 ? ? ? ? ? C3 ? bmse010372 1 26 ? 1 1 1 1 1 C25 C 13 150.58 ? ? 1 ? ? ? ? ? A4 ? bmse010372 1 27 ? 1 1 1 1 1 C5 C 13 153.13 ? ? 1 ? ? ? ? ? CA ? bmse010372 1 28 ? 1 1 1 1 1 C18 C 13 187.43 ? ? 1 ? ? ? ? ? AG ? bmse010372 1 29 ? 1 1 1 1 1 C19 C 13 187.65 ? ? 1 ? ? ? ? ? BG ? bmse010372 1 30 ? 1 1 1 1 1 C12 C 13 193.91 ? ? 1 ? ? ? ? ? CG ? bmse010372 1 31 ? 1 1 1 1 1 H40 H 1 3.69 ? ? 1 ? ? ? ? ? AOMe ? bmse010372 1 32 ? 1 1 1 1 1 H41 H 1 3.69 ? ? 1 ? ? ? ? ? AOMe ? bmse010372 1 33 ? 1 1 1 1 1 H42 H 1 3.69 ? ? 1 ? ? ? ? ? AOMe ? bmse010372 1 34 ? 1 1 1 1 1 H46 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010372 1 35 ? 1 1 1 1 1 H47 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010372 1 36 ? 1 1 1 1 1 H48 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010372 1 37 ? 1 1 1 1 1 H43 H 1 3.98 ? ? 1 ? ? ? ? ? COMe ? bmse010372 1 38 ? 1 1 1 1 1 H44 H 1 3.98 ? ? 1 ? ? ? ? ? COMe ? bmse010372 1 39 ? 1 1 1 1 1 H45 H 1 3.98 ? ? 1 ? ? ? ? ? COMe ? bmse010372 1 40 ? 1 1 1 1 1 H49 H 1 6.70 ? ? 1 ? ? ? ? ? CB ? bmse010372 1 41 ? 1 1 1 1 1 H56 H 1 6.79 ? ? 1 ? ? ? ? ? B5 ? bmse010372 1 42 ? 1 1 1 1 1 H55 H 1 6.82 ? ? 1 ? ? ? ? ? C5 ? bmse010372 1 43 ? 1 1 1 1 1 H54 H 1 6.85 ? ? 1 ? ? ? ? ? A5 ? bmse010372 1 44 ? 1 1 1 1 1 H52 H 1 7.15 ? ? 1 ? ? ? ? ? C6 ? bmse010372 1 45 ? 1 1 1 1 1 H53 H 1 7.28 ? ? 1 ? ? ? ? ? B6 ? bmse010372 1 46 ? 1 1 1 1 1 H51 H 1 7.30 ? ? 1 ? ? ? ? ? A6 ? bmse010372 1 47 ? 1 1 1 1 1 H58 H 1 7.30 ? ? 1 ? ? ? ? ? AA ? bmse010372 1 48 ? 1 1 1 1 1 H59 H 1 7.33 ? ? 1 ? ? ? ? ? BA ? bmse010372 1 49 ? 1 1 1 1 1 H60 H 1 7.48 ? ? 1 ? ? ? ? ? C2 ? bmse010372 1 50 ? 1 1 1 1 1 H61 H 1 7.52 ? ? 1 ? ? ? ? ? A2 ? bmse010372 1 51 ? 1 1 1 1 1 H50 H 1 7.58 ? ? 1 ? ? ? ? ? CA ? bmse010372 1 52 ? 1 1 1 1 1 H62 H 1 7.67 ? ? 1 ? ? ? ? ? B2 ? bmse010372 1 53 ? 1 1 1 1 1 H34 H 1 8.37 ? ? 1 ? ? ? ? ? AOH ? bmse010372 1 54 ? 1 1 1 1 1 H63 H 1 9.48 ? ? 1 ? ? ? ? ? AG ? bmse010372 1 55 ? 1 1 1 1 1 H64 H 1 9.53 ? ? 1 ? ? ? ? ? BG ? bmse010372 1 56 ? 1 1 1 1 1 H57 H 1 9.65 ? ? 1 ? ? ? ? ? CG ? bmse010372 1 stop_ save_