| NMR-STAR tag name | _Chem_comp_SMILES.Type |
|---|---|
| Description | NMR-STAR name: _Chem_comp_SMILES.Type The type of SMILES string provided is defined by this tag value. |
| Database field name | Type |
| SQL Database type | VARCHAR(31) |
| Part of primary Key | yes |
| Foreign Key on table, column | , |
| Saveframe ID | no |
| Row Index | no |
| Secondary Index | no |
| Internal Flag | no |
| Nulls allowed in database? | yes |
| Prompt | SMILES type |
| Examples | canonical; isomeric; unique |
| Help text |
| NMR-STAR tag name | _Chem_comp_SMILES.String |
|---|---|
| Description | NMR-STAR name: _Chem_comp_SMILES.String SMILES string for the chemical component. |
| Database field name | String |
| SQL Database type | VARCHAR(1024) |
| Part of primary Key | yes |
| Foreign Key on table, column | , |
| Saveframe ID | no |
| Row Index | no |
| Secondary Index | no |
| Internal Flag | no |
| Nulls allowed in database? | yes |
| Prompt | SMILES string |
| Examples | C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O |
| Help text |
| NMR-STAR tag name | _Chem_comp_SMILES.Sf_ID |
|---|---|
| Description | NMR-STAR name: _Chem_comp_SMILES.Sf_ID Pointer to '_Chem_comp.Sf_ID' |
| Database field name | SfID |
| SQL Database type | INTEGER |
| Part of primary Key | no |
| Foreign Key on table, column | Chem_comp, Sf_ID |
| Saveframe ID | no |
| Row Index | no |
| Secondary Index | no |
| Internal Flag | yes This field's data is for internal use only and should be hidden in public versiond of the data. |
| Nulls allowed in database? | yes |
| Prompt | Sf ID |
| Examples | ? |
| Help text |
| NMR-STAR tag name | _Chem_comp_SMILES.Entry_ID |
|---|---|
| Description | NMR-STAR name: _Chem_comp_SMILES.Entry_ID Pointer to '_Entry.ID' |
| Database field name | EntryID |
| SQL Database type | CHAR(12) |
| Part of primary Key | yes |
| Foreign Key on table, column | Chem_comp, Entry_ID |
| Saveframe ID | no |
| Row Index | no |
| Secondary Index | no |
| Internal Flag | no |
| Nulls allowed in database? | yes |
| Prompt | Entry ID |
| Examples | ? |
| Help text |
| NMR-STAR tag name | _Chem_comp_SMILES.Comp_ID |
|---|---|
| Description | NMR-STAR name: _Chem_comp_SMILES.Comp_ID Pointer to '_Chem_comp.ID' |
| Database field name | CompID |
| SQL Database type | CHAR(12) |
| Part of primary Key | yes |
| Foreign Key on table, column | Chem_comp, ID |
| Saveframe ID | no |
| Row Index | no |
| Secondary Index | no |
| Internal Flag | no |
| Nulls allowed in database? | yes |
| Prompt | Comp ID |
| Examples | ? |
| Help text |